A59项目初版工程 1.电压+光感adc采样优化 2.串口逻辑优化
116
lib/awtk/awtk-examples/Meter.v2-Demo/.clang-format
Normal file
@ -0,0 +1,116 @@
|
||||
---
|
||||
Language: Cpp
|
||||
# BasedOnStyle: Google
|
||||
AccessModifierOffset: -1
|
||||
AlignAfterOpenBracket: Align
|
||||
AlignConsecutiveAssignments: false
|
||||
AlignConsecutiveDeclarations: false
|
||||
AlignEscapedNewlines: Left
|
||||
AlignOperands: true
|
||||
AlignTrailingComments: true
|
||||
AllowAllParametersOfDeclarationOnNextLine: true
|
||||
AllowShortBlocksOnASingleLine: false
|
||||
AllowShortCaseLabelsOnASingleLine: false
|
||||
AllowShortFunctionsOnASingleLine: false
|
||||
AllowShortIfStatementsOnASingleLine: true
|
||||
AllowShortLoopsOnASingleLine: true
|
||||
AlwaysBreakAfterDefinitionReturnType: None
|
||||
AlwaysBreakAfterReturnType: None
|
||||
AlwaysBreakBeforeMultilineStrings: true
|
||||
AlwaysBreakTemplateDeclarations: true
|
||||
BinPackArguments: true
|
||||
BinPackParameters: true
|
||||
BraceWrapping:
|
||||
AfterClass: false
|
||||
AfterControlStatement: false
|
||||
AfterEnum: false
|
||||
AfterFunction: false
|
||||
AfterNamespace: false
|
||||
AfterObjCDeclaration: false
|
||||
AfterStruct: false
|
||||
AfterUnion: false
|
||||
AfterExternBlock: false
|
||||
BeforeCatch: false
|
||||
BeforeElse: false
|
||||
IndentBraces: false
|
||||
SplitEmptyFunction: true
|
||||
SplitEmptyRecord: true
|
||||
SplitEmptyNamespace: true
|
||||
BreakBeforeBinaryOperators: None
|
||||
BreakBeforeBraces: Attach
|
||||
BreakBeforeInheritanceComma: false
|
||||
BreakBeforeTernaryOperators: true
|
||||
BreakConstructorInitializersBeforeComma: false
|
||||
BreakConstructorInitializers: BeforeColon
|
||||
BreakAfterJavaFieldAnnotations: false
|
||||
BreakStringLiterals: true
|
||||
ColumnLimit: 100
|
||||
CommentPragmas: '^ IWYU pragma:'
|
||||
CompactNamespaces: false
|
||||
ConstructorInitializerAllOnOneLineOrOnePerLine: true
|
||||
ConstructorInitializerIndentWidth: 4
|
||||
ContinuationIndentWidth: 4
|
||||
Cpp11BracedListStyle: true
|
||||
DerivePointerAlignment: false
|
||||
DisableFormat: false
|
||||
ExperimentalAutoDetectBinPacking: false
|
||||
FixNamespaceComments: true
|
||||
ForEachMacros:
|
||||
- foreach
|
||||
- Q_FOREACH
|
||||
- BOOST_FOREACH
|
||||
IncludeCategories:
|
||||
- Regex: '^<ext/.*\.h>'
|
||||
Priority: 2
|
||||
- Regex: '^<.*\.h>'
|
||||
Priority: 1
|
||||
- Regex: '^<.*'
|
||||
Priority: 2
|
||||
- Regex: '.*'
|
||||
Priority: 3
|
||||
IncludeIsMainRegex: '([-_](test|unittest))?$'
|
||||
IndentCaseLabels: true
|
||||
IndentPPDirectives: None
|
||||
IndentWidth: 2
|
||||
IndentWrappedFunctionNames: false
|
||||
JavaScriptQuotes: Leave
|
||||
JavaScriptWrapImports: true
|
||||
KeepEmptyLinesAtTheStartOfBlocks: false
|
||||
MacroBlockBegin: ''
|
||||
MacroBlockEnd: ''
|
||||
MaxEmptyLinesToKeep: 1
|
||||
NamespaceIndentation: None
|
||||
ObjCBlockIndentWidth: 2
|
||||
ObjCSpaceAfterProperty: false
|
||||
ObjCSpaceBeforeProtocolList: false
|
||||
PenaltyBreakAssignment: 2
|
||||
PenaltyBreakBeforeFirstCallParameter: 1
|
||||
PenaltyBreakComment: 300
|
||||
PenaltyBreakFirstLessLess: 100
|
||||
PenaltyBreakString: 1000
|
||||
PenaltyExcessCharacter: 1000000
|
||||
PenaltyReturnTypeOnItsOwnLine: 200
|
||||
PointerAlignment: Left
|
||||
RawStringFormats:
|
||||
- Delimiter: pb
|
||||
Language: TextProto
|
||||
BasedOnStyle: google
|
||||
ReflowComments: true
|
||||
SortIncludes: false
|
||||
SortUsingDeclarations: true
|
||||
SpaceAfterCStyleCast: false
|
||||
SpaceAfterTemplateKeyword: true
|
||||
SpaceBeforeAssignmentOperators: true
|
||||
SpaceBeforeParens: ControlStatements
|
||||
SpaceInEmptyParentheses: false
|
||||
SpacesBeforeTrailingComments: 2
|
||||
SpacesInAngles: false
|
||||
SpacesInContainerLiterals: true
|
||||
SpacesInCStyleCastParentheses: false
|
||||
SpacesInParentheses: false
|
||||
SpacesInSquareBrackets: false
|
||||
Standard: Auto
|
||||
TabWidth: 2
|
||||
UseTab: Never
|
||||
...
|
||||
|
BIN
lib/awtk/awtk-examples/Meter.v2-Demo/.sconsign.dblite
Normal file
@ -0,0 +1,115 @@
|
||||
---
|
||||
Language: Cpp
|
||||
# BasedOnStyle: Google
|
||||
AccessModifierOffset: -1
|
||||
AlignAfterOpenBracket: Align
|
||||
AlignConsecutiveAssignments: false
|
||||
AlignConsecutiveDeclarations: false
|
||||
AlignEscapedNewlines: Left
|
||||
AlignOperands: true
|
||||
AlignTrailingComments: true
|
||||
AllowAllParametersOfDeclarationOnNextLine: true
|
||||
AllowShortBlocksOnASingleLine: false
|
||||
AllowShortCaseLabelsOnASingleLine: false
|
||||
AllowShortFunctionsOnASingleLine: false
|
||||
AllowShortIfStatementsOnASingleLine: true
|
||||
AllowShortLoopsOnASingleLine: true
|
||||
AlwaysBreakAfterDefinitionReturnType: None
|
||||
AlwaysBreakAfterReturnType: None
|
||||
AlwaysBreakBeforeMultilineStrings: true
|
||||
AlwaysBreakTemplateDeclarations: true
|
||||
BinPackArguments: true
|
||||
BinPackParameters: true
|
||||
BraceWrapping:
|
||||
AfterClass: false
|
||||
AfterControlStatement: false
|
||||
AfterEnum: false
|
||||
AfterFunction: false
|
||||
AfterNamespace: false
|
||||
AfterObjCDeclaration: false
|
||||
AfterStruct: false
|
||||
AfterUnion: false
|
||||
AfterExternBlock: false
|
||||
BeforeCatch: false
|
||||
BeforeElse: false
|
||||
IndentBraces: false
|
||||
SplitEmptyFunction: true
|
||||
SplitEmptyRecord: true
|
||||
SplitEmptyNamespace: true
|
||||
BreakBeforeBinaryOperators: None
|
||||
BreakBeforeBraces: Attach
|
||||
BreakBeforeInheritanceComma: false
|
||||
BreakBeforeTernaryOperators: true
|
||||
BreakConstructorInitializersBeforeComma: false
|
||||
BreakConstructorInitializers: BeforeColon
|
||||
BreakAfterJavaFieldAnnotations: false
|
||||
BreakStringLiterals: true
|
||||
ColumnLimit: 100
|
||||
CommentPragmas: '^ IWYU pragma:'
|
||||
CompactNamespaces: false
|
||||
ConstructorInitializerAllOnOneLineOrOnePerLine: true
|
||||
ConstructorInitializerIndentWidth: 4
|
||||
ContinuationIndentWidth: 4
|
||||
Cpp11BracedListStyle: true
|
||||
DerivePointerAlignment: false
|
||||
DisableFormat: false
|
||||
ExperimentalAutoDetectBinPacking: false
|
||||
FixNamespaceComments: true
|
||||
ForEachMacros:
|
||||
- foreach
|
||||
- Q_FOREACH
|
||||
- BOOST_FOREACH
|
||||
IncludeCategories:
|
||||
- Regex: '^<ext/.*\.h>'
|
||||
Priority: 2
|
||||
- Regex: '^<.*\.h>'
|
||||
Priority: 1
|
||||
- Regex: '^<.*'
|
||||
Priority: 2
|
||||
- Regex: '.*'
|
||||
Priority: 3
|
||||
IncludeIsMainRegex: '([-_](test|unittest))?$'
|
||||
IndentCaseLabels: true
|
||||
IndentPPDirectives: None
|
||||
IndentWidth: 2
|
||||
IndentWrappedFunctionNames: false
|
||||
JavaScriptQuotes: Leave
|
||||
JavaScriptWrapImports: true
|
||||
KeepEmptyLinesAtTheStartOfBlocks: false
|
||||
MacroBlockBegin: ''
|
||||
MacroBlockEnd: ''
|
||||
MaxEmptyLinesToKeep: 1
|
||||
NamespaceIndentation: None
|
||||
ObjCBlockIndentWidth: 2
|
||||
ObjCSpaceAfterProperty: false
|
||||
ObjCSpaceBeforeProtocolList: false
|
||||
PenaltyBreakAssignment: 2
|
||||
PenaltyBreakBeforeFirstCallParameter: 1
|
||||
PenaltyBreakComment: 600
|
||||
PenaltyBreakFirstLessLess: 100
|
||||
PenaltyBreakString: 1000
|
||||
PenaltyExcessCharacter: 1000000
|
||||
PenaltyReturnTypeOnItsOwnLine: 200
|
||||
PointerAlignment: Left
|
||||
RawStringFormats:
|
||||
- Language: TextProto
|
||||
BasedOnStyle: google
|
||||
ReflowComments: false
|
||||
SortIncludes: false
|
||||
SortUsingDeclarations: true
|
||||
SpaceAfterCStyleCast: false
|
||||
SpaceAfterTemplateKeyword: true
|
||||
SpaceBeforeAssignmentOperators: true
|
||||
SpaceBeforeParens: ControlStatements
|
||||
SpaceInEmptyParentheses: false
|
||||
SpacesBeforeTrailingComments: 2
|
||||
SpacesInAngles: false
|
||||
SpacesInContainerLiterals: true
|
||||
SpacesInCStyleCastParentheses: false
|
||||
SpacesInParentheses: false
|
||||
SpacesInSquareBrackets: false
|
||||
Standard: Auto
|
||||
TabWidth: 2
|
||||
UseTab: Never
|
||||
...
|
||||
|
34
lib/awtk/awtk-examples/Meter.v2-Demo/3rd/awtk-widget-qr/.gitignore
vendored
Normal file
@ -0,0 +1,34 @@
|
||||
*.o
|
||||
*.a
|
||||
*.so
|
||||
*.swp
|
||||
*.pdb
|
||||
*.ilk
|
||||
*.idb
|
||||
*.obj
|
||||
*.exe
|
||||
*.os
|
||||
*.pyc
|
||||
/bin
|
||||
/lib
|
||||
.sconsign.dblite
|
||||
lua/demo1
|
||||
lua/lftk_run
|
||||
tags
|
||||
bin/demo1*
|
||||
bin/demo_animator*
|
||||
bin/demo_thread*
|
||||
bin/demotr*
|
||||
bin/demovg*
|
||||
bin/fontgen*
|
||||
bin/preview_ui*
|
||||
bin/resgen*
|
||||
bin/runLua*
|
||||
bin/runTest*
|
||||
bin/strgen*
|
||||
bin/image*
|
||||
bin/hello*
|
||||
.vscode
|
||||
.vs
|
||||
*.os
|
||||
res
|
504
lib/awtk/awtk-examples/Meter.v2-Demo/3rd/awtk-widget-qr/LICENSE
Normal file
@ -0,0 +1,504 @@
|
||||
GNU LESSER GENERAL PUBLIC LICENSE
|
||||
Version 2.1, February 1999
|
||||
|
||||
Copyright (C) 1991, 1999 Free Software Foundation, Inc.
|
||||
51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA
|
||||
Everyone is permitted to copy and distribute verbatim copies
|
||||
of this license document, but changing it is not allowed.
|
||||
|
||||
[This is the first released version of the Lesser GPL. It also counts
|
||||
as the successor of the GNU Library Public License, version 2, hence
|
||||
the version number 2.1.]
|
||||
|
||||
Preamble
|
||||
|
||||
The licenses for most software are designed to take away your
|
||||
freedom to share and change it. By contrast, the GNU General Public
|
||||
Licenses are intended to guarantee your freedom to share and change
|
||||
free software--to make sure the software is free for all its users.
|
||||
|
||||
This license, the Lesser General Public License, applies to some
|
||||
specially designated software packages--typically libraries--of the
|
||||
Free Software Foundation and other authors who decide to use it. You
|
||||
can use it too, but we suggest you first think carefully about whether
|
||||
this license or the ordinary General Public License is the better
|
||||
strategy to use in any particular case, based on the explanations below.
|
||||
|
||||
When we speak of free software, we are referring to freedom of use,
|
||||
not price. Our General Public Licenses are designed to make sure that
|
||||
you have the freedom to distribute copies of free software (and charge
|
||||
for this service if you wish); that you receive source code or can get
|
||||
it if you want it; that you can change the software and use pieces of
|
||||
it in new free programs; and that you are informed that you can do
|
||||
these things.
|
||||
|
||||
To protect your rights, we need to make restrictions that forbid
|
||||
distributors to deny you these rights or to ask you to surrender these
|
||||
rights. These restrictions translate to certain responsibilities for
|
||||
you if you distribute copies of the library or if you modify it.
|
||||
|
||||
For example, if you distribute copies of the library, whether gratis
|
||||
or for a fee, you must give the recipients all the rights that we gave
|
||||
you. You must make sure that they, too, receive or can get the source
|
||||
code. If you link other code with the library, you must provide
|
||||
complete object files to the recipients, so that they can relink them
|
||||
with the library after making changes to the library and recompiling
|
||||
it. And you must show them these terms so they know their rights.
|
||||
|
||||
We protect your rights with a two-step method: (1) we copyright the
|
||||
library, and (2) we offer you this license, which gives you legal
|
||||
permission to copy, distribute and/or modify the library.
|
||||
|
||||
To protect each distributor, we want to make it very clear that
|
||||
there is no warranty for the free library. Also, if the library is
|
||||
modified by someone else and passed on, the recipients should know
|
||||
that what they have is not the original version, so that the original
|
||||
author's reputation will not be affected by problems that might be
|
||||
introduced by others.
|
||||
|
||||
Finally, software patents pose a constant threat to the existence of
|
||||
any free program. We wish to make sure that a company cannot
|
||||
effectively restrict the users of a free program by obtaining a
|
||||
restrictive license from a patent holder. Therefore, we insist that
|
||||
any patent license obtained for a version of the library must be
|
||||
consistent with the full freedom of use specified in this license.
|
||||
|
||||
Most GNU software, including some libraries, is covered by the
|
||||
ordinary GNU General Public License. This license, the GNU Lesser
|
||||
General Public License, applies to certain designated libraries, and
|
||||
is quite different from the ordinary General Public License. We use
|
||||
this license for certain libraries in order to permit linking those
|
||||
libraries into non-free programs.
|
||||
|
||||
When a program is linked with a library, whether statically or using
|
||||
a shared library, the combination of the two is legally speaking a
|
||||
combined work, a derivative of the original library. The ordinary
|
||||
General Public License therefore permits such linking only if the
|
||||
entire combination fits its criteria of freedom. The Lesser General
|
||||
Public License permits more lax criteria for linking other code with
|
||||
the library.
|
||||
|
||||
We call this license the "Lesser" General Public License because it
|
||||
does Less to protect the user's freedom than the ordinary General
|
||||
Public License. It also provides other free software developers Less
|
||||
of an advantage over competing non-free programs. These disadvantages
|
||||
are the reason we use the ordinary General Public License for many
|
||||
libraries. However, the Lesser license provides advantages in certain
|
||||
special circumstances.
|
||||
|
||||
For example, on rare occasions, there may be a special need to
|
||||
encourage the widest possible use of a certain library, so that it becomes
|
||||
a de-facto standard. To achieve this, non-free programs must be
|
||||
allowed to use the library. A more frequent case is that a free
|
||||
library does the same job as widely used non-free libraries. In this
|
||||
case, there is little to gain by limiting the free library to free
|
||||
software only, so we use the Lesser General Public License.
|
||||
|
||||
In other cases, permission to use a particular library in non-free
|
||||
programs enables a greater number of people to use a large body of
|
||||
free software. For example, permission to use the GNU C Library in
|
||||
non-free programs enables many more people to use the whole GNU
|
||||
operating system, as well as its variant, the GNU/Linux operating
|
||||
system.
|
||||
|
||||
Although the Lesser General Public License is Less protective of the
|
||||
users' freedom, it does ensure that the user of a program that is
|
||||
linked with the Library has the freedom and the wherewithal to run
|
||||
that program using a modified version of the Library.
|
||||
|
||||
The precise terms and conditions for copying, distribution and
|
||||
modification follow. Pay close attention to the difference between a
|
||||
"work based on the library" and a "work that uses the library". The
|
||||
former contains code derived from the library, whereas the latter must
|
||||
be combined with the library in order to run.
|
||||
|
||||
GNU LESSER GENERAL PUBLIC LICENSE
|
||||
TERMS AND CONDITIONS FOR COPYING, DISTRIBUTION AND MODIFICATION
|
||||
|
||||
0. This License Agreement applies to any software library or other
|
||||
program which contains a notice placed by the copyright holder or
|
||||
other authorized party saying it may be distributed under the terms of
|
||||
this Lesser General Public License (also called "this License").
|
||||
Each licensee is addressed as "you".
|
||||
|
||||
A "library" means a collection of software functions and/or data
|
||||
prepared so as to be conveniently linked with application programs
|
||||
(which use some of those functions and data) to form executables.
|
||||
|
||||
The "Library", below, refers to any such software library or work
|
||||
which has been distributed under these terms. A "work based on the
|
||||
Library" means either the Library or any derivative work under
|
||||
copyright law: that is to say, a work containing the Library or a
|
||||
portion of it, either verbatim or with modifications and/or translated
|
||||
straightforwardly into another language. (Hereinafter, translation is
|
||||
included without limitation in the term "modification".)
|
||||
|
||||
"Source code" for a work means the preferred form of the work for
|
||||
making modifications to it. For a library, complete source code means
|
||||
all the source code for all modules it contains, plus any associated
|
||||
interface definition files, plus the scripts used to control compilation
|
||||
and installation of the library.
|
||||
|
||||
Activities other than copying, distribution and modification are not
|
||||
covered by this License; they are outside its scope. The act of
|
||||
running a program using the Library is not restricted, and output from
|
||||
such a program is covered only if its contents constitute a work based
|
||||
on the Library (independent of the use of the Library in a tool for
|
||||
writing it). Whether that is true depends on what the Library does
|
||||
and what the program that uses the Library does.
|
||||
|
||||
1. You may copy and distribute verbatim copies of the Library's
|
||||
complete source code as you receive it, in any medium, provided that
|
||||
you conspicuously and appropriately publish on each copy an
|
||||
appropriate copyright notice and disclaimer of warranty; keep intact
|
||||
all the notices that refer to this License and to the absence of any
|
||||
warranty; and distribute a copy of this License along with the
|
||||
Library.
|
||||
|
||||
You may charge a fee for the physical act of transferring a copy,
|
||||
and you may at your option offer warranty protection in exchange for a
|
||||
fee.
|
||||
|
||||
2. You may modify your copy or copies of the Library or any portion
|
||||
of it, thus forming a work based on the Library, and copy and
|
||||
distribute such modifications or work under the terms of Section 1
|
||||
above, provided that you also meet all of these conditions:
|
||||
|
||||
a) The modified work must itself be a software library.
|
||||
|
||||
b) You must cause the files modified to carry prominent notices
|
||||
stating that you changed the files and the date of any change.
|
||||
|
||||
c) You must cause the whole of the work to be licensed at no
|
||||
charge to all third parties under the terms of this License.
|
||||
|
||||
d) If a facility in the modified Library refers to a function or a
|
||||
table of data to be supplied by an application program that uses
|
||||
the facility, other than as an argument passed when the facility
|
||||
is invoked, then you must make a good faith effort to ensure that,
|
||||
in the event an application does not supply such function or
|
||||
table, the facility still operates, and performs whatever part of
|
||||
its purpose remains meaningful.
|
||||
|
||||
(For example, a function in a library to compute square roots has
|
||||
a purpose that is entirely well-defined independent of the
|
||||
application. Therefore, Subsection 2d requires that any
|
||||
application-supplied function or table used by this function must
|
||||
be optional: if the application does not supply it, the square
|
||||
root function must still compute square roots.)
|
||||
|
||||
These requirements apply to the modified work as a whole. If
|
||||
identifiable sections of that work are not derived from the Library,
|
||||
and can be reasonably considered independent and separate works in
|
||||
themselves, then this License, and its terms, do not apply to those
|
||||
sections when you distribute them as separate works. But when you
|
||||
distribute the same sections as part of a whole which is a work based
|
||||
on the Library, the distribution of the whole must be on the terms of
|
||||
this License, whose permissions for other licensees extend to the
|
||||
entire whole, and thus to each and every part regardless of who wrote
|
||||
it.
|
||||
|
||||
Thus, it is not the intent of this section to claim rights or contest
|
||||
your rights to work written entirely by you; rather, the intent is to
|
||||
exercise the right to control the distribution of derivative or
|
||||
collective works based on the Library.
|
||||
|
||||
In addition, mere aggregation of another work not based on the Library
|
||||
with the Library (or with a work based on the Library) on a volume of
|
||||
a storage or distribution medium does not bring the other work under
|
||||
the scope of this License.
|
||||
|
||||
3. You may opt to apply the terms of the ordinary GNU General Public
|
||||
License instead of this License to a given copy of the Library. To do
|
||||
this, you must alter all the notices that refer to this License, so
|
||||
that they refer to the ordinary GNU General Public License, version 2,
|
||||
instead of to this License. (If a newer version than version 2 of the
|
||||
ordinary GNU General Public License has appeared, then you can specify
|
||||
that version instead if you wish.) Do not make any other change in
|
||||
these notices.
|
||||
|
||||
Once this change is made in a given copy, it is irreversible for
|
||||
that copy, so the ordinary GNU General Public License applies to all
|
||||
subsequent copies and derivative works made from that copy.
|
||||
|
||||
This option is useful when you wish to copy part of the code of
|
||||
the Library into a program that is not a library.
|
||||
|
||||
4. You may copy and distribute the Library (or a portion or
|
||||
derivative of it, under Section 2) in object code or executable form
|
||||
under the terms of Sections 1 and 2 above provided that you accompany
|
||||
it with the complete corresponding machine-readable source code, which
|
||||
must be distributed under the terms of Sections 1 and 2 above on a
|
||||
medium customarily used for software interchange.
|
||||
|
||||
If distribution of object code is made by offering access to copy
|
||||
from a designated place, then offering equivalent access to copy the
|
||||
source code from the same place satisfies the requirement to
|
||||
distribute the source code, even though third parties are not
|
||||
compelled to copy the source along with the object code.
|
||||
|
||||
5. A program that contains no derivative of any portion of the
|
||||
Library, but is designed to work with the Library by being compiled or
|
||||
linked with it, is called a "work that uses the Library". Such a
|
||||
work, in isolation, is not a derivative work of the Library, and
|
||||
therefore falls outside the scope of this License.
|
||||
|
||||
However, linking a "work that uses the Library" with the Library
|
||||
creates an executable that is a derivative of the Library (because it
|
||||
contains portions of the Library), rather than a "work that uses the
|
||||
library". The executable is therefore covered by this License.
|
||||
Section 6 states terms for distribution of such executables.
|
||||
|
||||
When a "work that uses the Library" uses material from a header file
|
||||
that is part of the Library, the object code for the work may be a
|
||||
derivative work of the Library even though the source code is not.
|
||||
Whether this is true is especially significant if the work can be
|
||||
linked without the Library, or if the work is itself a library. The
|
||||
threshold for this to be true is not precisely defined by law.
|
||||
|
||||
If such an object file uses only numerical parameters, data
|
||||
structure layouts and accessors, and small macros and small inline
|
||||
functions (ten lines or less in length), then the use of the object
|
||||
file is unrestricted, regardless of whether it is legally a derivative
|
||||
work. (Executables containing this object code plus portions of the
|
||||
Library will still fall under Section 6.)
|
||||
|
||||
Otherwise, if the work is a derivative of the Library, you may
|
||||
distribute the object code for the work under the terms of Section 6.
|
||||
Any executables containing that work also fall under Section 6,
|
||||
whether or not they are linked directly with the Library itself.
|
||||
|
||||
6. As an exception to the Sections above, you may also combine or
|
||||
link a "work that uses the Library" with the Library to produce a
|
||||
work containing portions of the Library, and distribute that work
|
||||
under terms of your choice, provided that the terms permit
|
||||
modification of the work for the customer's own use and reverse
|
||||
engineering for debugging such modifications.
|
||||
|
||||
You must give prominent notice with each copy of the work that the
|
||||
Library is used in it and that the Library and its use are covered by
|
||||
this License. You must supply a copy of this License. If the work
|
||||
during execution displays copyright notices, you must include the
|
||||
copyright notice for the Library among them, as well as a reference
|
||||
directing the user to the copy of this License. Also, you must do one
|
||||
of these things:
|
||||
|
||||
a) Accompany the work with the complete corresponding
|
||||
machine-readable source code for the Library including whatever
|
||||
changes were used in the work (which must be distributed under
|
||||
Sections 1 and 2 above); and, if the work is an executable linked
|
||||
with the Library, with the complete machine-readable "work that
|
||||
uses the Library", as object code and/or source code, so that the
|
||||
user can modify the Library and then relink to produce a modified
|
||||
executable containing the modified Library. (It is understood
|
||||
that the user who changes the contents of definitions files in the
|
||||
Library will not necessarily be able to recompile the application
|
||||
to use the modified definitions.)
|
||||
|
||||
b) Use a suitable shared library mechanism for linking with the
|
||||
Library. A suitable mechanism is one that (1) uses at run time a
|
||||
copy of the library already present on the user's computer system,
|
||||
rather than copying library functions into the executable, and (2)
|
||||
will operate properly with a modified version of the library, if
|
||||
the user installs one, as long as the modified version is
|
||||
interface-compatible with the version that the work was made with.
|
||||
|
||||
c) Accompany the work with a written offer, valid for at
|
||||
least three years, to give the same user the materials
|
||||
specified in Subsection 6a, above, for a charge no more
|
||||
than the cost of performing this distribution.
|
||||
|
||||
d) If distribution of the work is made by offering access to copy
|
||||
from a designated place, offer equivalent access to copy the above
|
||||
specified materials from the same place.
|
||||
|
||||
e) Verify that the user has already received a copy of these
|
||||
materials or that you have already sent this user a copy.
|
||||
|
||||
For an executable, the required form of the "work that uses the
|
||||
Library" must include any data and utility programs needed for
|
||||
reproducing the executable from it. However, as a special exception,
|
||||
the materials to be distributed need not include anything that is
|
||||
normally distributed (in either source or binary form) with the major
|
||||
components (compiler, kernel, and so on) of the operating system on
|
||||
which the executable runs, unless that component itself accompanies
|
||||
the executable.
|
||||
|
||||
It may happen that this requirement contradicts the license
|
||||
restrictions of other proprietary libraries that do not normally
|
||||
accompany the operating system. Such a contradiction means you cannot
|
||||
use both them and the Library together in an executable that you
|
||||
distribute.
|
||||
|
||||
7. You may place library facilities that are a work based on the
|
||||
Library side-by-side in a single library together with other library
|
||||
facilities not covered by this License, and distribute such a combined
|
||||
library, provided that the separate distribution of the work based on
|
||||
the Library and of the other library facilities is otherwise
|
||||
permitted, and provided that you do these two things:
|
||||
|
||||
a) Accompany the combined library with a copy of the same work
|
||||
based on the Library, uncombined with any other library
|
||||
facilities. This must be distributed under the terms of the
|
||||
Sections above.
|
||||
|
||||
b) Give prominent notice with the combined library of the fact
|
||||
that part of it is a work based on the Library, and explaining
|
||||
where to find the accompanying uncombined form of the same work.
|
||||
|
||||
8. You may not copy, modify, sublicense, link with, or distribute
|
||||
the Library except as expressly provided under this License. Any
|
||||
attempt otherwise to copy, modify, sublicense, link with, or
|
||||
distribute the Library is void, and will automatically terminate your
|
||||
rights under this License. However, parties who have received copies,
|
||||
or rights, from you under this License will not have their licenses
|
||||
terminated so long as such parties remain in full compliance.
|
||||
|
||||
9. You are not required to accept this License, since you have not
|
||||
signed it. However, nothing else grants you permission to modify or
|
||||
distribute the Library or its derivative works. These actions are
|
||||
prohibited by law if you do not accept this License. Therefore, by
|
||||
modifying or distributing the Library (or any work based on the
|
||||
Library), you indicate your acceptance of this License to do so, and
|
||||
all its terms and conditions for copying, distributing or modifying
|
||||
the Library or works based on it.
|
||||
|
||||
10. Each time you redistribute the Library (or any work based on the
|
||||
Library), the recipient automatically receives a license from the
|
||||
original licensor to copy, distribute, link with or modify the Library
|
||||
subject to these terms and conditions. You may not impose any further
|
||||
restrictions on the recipients' exercise of the rights granted herein.
|
||||
You are not responsible for enforcing compliance by third parties with
|
||||
this License.
|
||||
|
||||
11. If, as a consequence of a court judgment or allegation of patent
|
||||
infringement or for any other reason (not limited to patent issues),
|
||||
conditions are imposed on you (whether by court order, agreement or
|
||||
otherwise) that contradict the conditions of this License, they do not
|
||||
excuse you from the conditions of this License. If you cannot
|
||||
distribute so as to satisfy simultaneously your obligations under this
|
||||
License and any other pertinent obligations, then as a consequence you
|
||||
may not distribute the Library at all. For example, if a patent
|
||||
license would not permit royalty-free redistribution of the Library by
|
||||
all those who receive copies directly or indirectly through you, then
|
||||
the only way you could satisfy both it and this License would be to
|
||||
refrain entirely from distribution of the Library.
|
||||
|
||||
If any portion of this section is held invalid or unenforceable under any
|
||||
particular circumstance, the balance of the section is intended to apply,
|
||||
and the section as a whole is intended to apply in other circumstances.
|
||||
|
||||
It is not the purpose of this section to induce you to infringe any
|
||||
patents or other property right claims or to contest validity of any
|
||||
such claims; this section has the sole purpose of protecting the
|
||||
integrity of the free software distribution system which is
|
||||
implemented by public license practices. Many people have made
|
||||
generous contributions to the wide range of software distributed
|
||||
through that system in reliance on consistent application of that
|
||||
system; it is up to the author/donor to decide if he or she is willing
|
||||
to distribute software through any other system and a licensee cannot
|
||||
impose that choice.
|
||||
|
||||
This section is intended to make thoroughly clear what is believed to
|
||||
be a consequence of the rest of this License.
|
||||
|
||||
12. If the distribution and/or use of the Library is restricted in
|
||||
certain countries either by patents or by copyrighted interfaces, the
|
||||
original copyright holder who places the Library under this License may add
|
||||
an explicit geographical distribution limitation excluding those countries,
|
||||
so that distribution is permitted only in or among countries not thus
|
||||
excluded. In such case, this License incorporates the limitation as if
|
||||
written in the body of this License.
|
||||
|
||||
13. The Free Software Foundation may publish revised and/or new
|
||||
versions of the Lesser General Public License from time to time.
|
||||
Such new versions will be similar in spirit to the present version,
|
||||
but may differ in detail to address new problems or concerns.
|
||||
|
||||
Each version is given a distinguishing version number. If the Library
|
||||
specifies a version number of this License which applies to it and
|
||||
"any later version", you have the option of following the terms and
|
||||
conditions either of that version or of any later version published by
|
||||
the Free Software Foundation. If the Library does not specify a
|
||||
license version number, you may choose any version ever published by
|
||||
the Free Software Foundation.
|
||||
|
||||
14. If you wish to incorporate parts of the Library into other free
|
||||
programs whose distribution conditions are incompatible with these,
|
||||
write to the author to ask for permission. For software which is
|
||||
copyrighted by the Free Software Foundation, write to the Free
|
||||
Software Foundation; we sometimes make exceptions for this. Our
|
||||
decision will be guided by the two goals of preserving the free status
|
||||
of all derivatives of our free software and of promoting the sharing
|
||||
and reuse of software generally.
|
||||
|
||||
NO WARRANTY
|
||||
|
||||
15. BECAUSE THE LIBRARY IS LICENSED FREE OF CHARGE, THERE IS NO
|
||||
WARRANTY FOR THE LIBRARY, TO THE EXTENT PERMITTED BY APPLICABLE LAW.
|
||||
EXCEPT WHEN OTHERWISE STATED IN WRITING THE COPYRIGHT HOLDERS AND/OR
|
||||
OTHER PARTIES PROVIDE THE LIBRARY "AS IS" WITHOUT WARRANTY OF ANY
|
||||
KIND, EITHER EXPRESSED OR IMPLIED, INCLUDING, BUT NOT LIMITED TO, THE
|
||||
IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR
|
||||
PURPOSE. THE ENTIRE RISK AS TO THE QUALITY AND PERFORMANCE OF THE
|
||||
LIBRARY IS WITH YOU. SHOULD THE LIBRARY PROVE DEFECTIVE, YOU ASSUME
|
||||
THE COST OF ALL NECESSARY SERVICING, REPAIR OR CORRECTION.
|
||||
|
||||
16. IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN
|
||||
WRITING WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MAY MODIFY
|
||||
AND/OR REDISTRIBUTE THE LIBRARY AS PERMITTED ABOVE, BE LIABLE TO YOU
|
||||
FOR DAMAGES, INCLUDING ANY GENERAL, SPECIAL, INCIDENTAL OR
|
||||
CONSEQUENTIAL DAMAGES ARISING OUT OF THE USE OR INABILITY TO USE THE
|
||||
LIBRARY (INCLUDING BUT NOT LIMITED TO LOSS OF DATA OR DATA BEING
|
||||
RENDERED INACCURATE OR LOSSES SUSTAINED BY YOU OR THIRD PARTIES OR A
|
||||
FAILURE OF THE LIBRARY TO OPERATE WITH ANY OTHER SOFTWARE), EVEN IF
|
||||
SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE POSSIBILITY OF SUCH
|
||||
DAMAGES.
|
||||
|
||||
END OF TERMS AND CONDITIONS
|
||||
|
||||
How to Apply These Terms to Your New Libraries
|
||||
|
||||
If you develop a new library, and you want it to be of the greatest
|
||||
possible use to the public, we recommend making it free software that
|
||||
everyone can redistribute and change. You can do so by permitting
|
||||
redistribution under these terms (or, alternatively, under the terms of the
|
||||
ordinary General Public License).
|
||||
|
||||
To apply these terms, attach the following notices to the library. It is
|
||||
safest to attach them to the start of each source file to most effectively
|
||||
convey the exclusion of warranty; and each file should have at least the
|
||||
"copyright" line and a pointer to where the full notice is found.
|
||||
|
||||
<one line to give the library's name and a brief idea of what it does.>
|
||||
Copyright (C) <year> <name of author>
|
||||
|
||||
This library is free software; you can redistribute it and/or
|
||||
modify it under the terms of the GNU Lesser General Public
|
||||
License as published by the Free Software Foundation; either
|
||||
version 2.1 of the License, or (at your option) any later version.
|
||||
|
||||
This library is distributed in the hope that it will be useful,
|
||||
but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
|
||||
Lesser General Public License for more details.
|
||||
|
||||
You should have received a copy of the GNU Lesser General Public
|
||||
License along with this library; if not, write to the Free Software
|
||||
Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301
|
||||
USA
|
||||
|
||||
Also add information on how to contact you by electronic and paper mail.
|
||||
|
||||
You should also get your employer (if you work as a programmer) or your
|
||||
school, if any, to sign a "copyright disclaimer" for the library, if
|
||||
necessary. Here is a sample; alter the names:
|
||||
|
||||
Yoyodyne, Inc., hereby disclaims all copyright interest in the
|
||||
library `Frob' (a library for tweaking knobs) written by James Random
|
||||
Hacker.
|
||||
|
||||
<signature of Ty Coon>, 1 April 1990
|
||||
Ty Coon, President of Vice
|
||||
|
||||
That's all there is to it!
|
@ -0,0 +1,143 @@
|
||||
# awtk-widget-qr
|
||||
|
||||
qr 控件。用于显示二维码控件。
|
||||
|
||||

|
||||
|
||||
* 本项目使用 [libqrencode](https://github.com/fukuchi/libqrencode) 生成二维码。
|
||||
|
||||
* 本项目使用 [awtk-widget-generator](https://github.com/zlgopen/awtk-widget-generator) 生成代码框架。
|
||||
|
||||
## 准备
|
||||
|
||||
1. 获取 awtk 并编译
|
||||
|
||||
```
|
||||
git clone https://github.com/zlgopen/awtk.git
|
||||
cd awtk; scons; cd -
|
||||
```
|
||||
|
||||
2. 获取 awtk-widget-qr 并编译
|
||||
```
|
||||
git clone https://github.com/zlgopen/awtk-widget-qr.git
|
||||
cd awtk-widget-qr; scons
|
||||
```
|
||||
|
||||
## 运行
|
||||
|
||||
1. 生成示例代码的资源
|
||||
|
||||
```
|
||||
python scripts/update_res.py all
|
||||
```
|
||||
> 也可以使用 Designer 打开项目,之后点击 “打包” 按钮进行生成;
|
||||
> 如果资源发生修改,则需要重新生成资源。
|
||||
|
||||
如果 PIL 没有安装,执行上述脚本可能会出现如下错误:
|
||||
```cmd
|
||||
Traceback (most recent call last):
|
||||
...
|
||||
ModuleNotFoundError: No module named 'PIL'
|
||||
```
|
||||
请用 pip 安装:
|
||||
```cmd
|
||||
pip install Pillow
|
||||
```
|
||||
|
||||
2. 编译
|
||||
|
||||
* 编译PC版本
|
||||
|
||||
```
|
||||
scons
|
||||
```
|
||||
|
||||
* 编译LINUX FB版本
|
||||
|
||||
```
|
||||
scons LINUX_FB=true
|
||||
```
|
||||
|
||||
> 完整编译选项请参考[编译选项](https://github.com/zlgopen/awtk-widget-generator/blob/master/docs/build_options.md)
|
||||
|
||||
|
||||
3. 运行
|
||||
|
||||
```
|
||||
./bin/demo
|
||||
```
|
||||
|
||||
## 如何使用二维码控件
|
||||
|
||||
### 设置需要转成二维码的字符串
|
||||
|
||||
qr 控件 `value` 属性内容就是转成二维码的字符串内容。
|
||||
|
||||
在界面描述文件设置:
|
||||
|
||||
```xml
|
||||
<window theme="main" name="main">
|
||||
<qr name="qr" x="c" y="m" w="50%" h="50%" value="https://github.com/zlgopen/awtk"/>
|
||||
</window>
|
||||
```
|
||||
|
||||
或在代码中设置:
|
||||
|
||||
```c
|
||||
widget_t* win = window_open("main");
|
||||
widget_t* qr = widget_lookup(win, "qr", TRUE);
|
||||
qr_set_value(qr, "https://github.com/zlgopen/awtk");
|
||||
```
|
||||
|
||||
按照上述例子设置完成后,用手机扫该二维码就会打开[ https://github.com/zlgopen/awtk ](https://github.com/zlgopen/awtk)网址。
|
||||
|
||||
### 设置二维码中的颜色与图片
|
||||
|
||||
添加图片资源到项目中:
|
||||
|
||||

|
||||
|
||||
在样式文件中设置 qr 控件样式在对应状态设置 `fg_color` ,`bg_color`,`bg_image` 属性:
|
||||
|
||||
```xml
|
||||
<qr>
|
||||
<style name="default">
|
||||
<!-- fg_color 为二维码颜色,bg_color 为二维码背景色 -->
|
||||
<normal fg_color="black" bg_color="white" bg_image="message"/>
|
||||
|
||||
<!-- disable 状态用于模拟 被扫描 状态 -->
|
||||
<!-- 不设置 bg_image 属性,则该状态二维码中间没有图片 -->
|
||||
<disable fg_color="gray" bg_color="#f0f0f0"/>
|
||||
</style>
|
||||
</qr>
|
||||
```
|
||||
|
||||
从上述例子得到的效果为:
|
||||
|
||||
正常状态:
|
||||
|
||||

|
||||
|
||||
被扫描状态:
|
||||
|
||||

|
||||
|
||||
**注意**:图片大小不可以大于二维码的 `45%` ,否则图片将会被裁剪:
|
||||
|
||||
图片资源:
|
||||
|
||||

|
||||
|
||||
得到的二维码:
|
||||
|
||||

|
||||
|
||||
qr 控件的属性名及作用如下表所示:
|
||||
|
||||
| 属性名 | 作用 |
|
||||
| ------ | ---------------------- |
|
||||
| value | 要转换为二维码的字符串 |
|
||||
|
||||
## 文档
|
||||
|
||||
[完善自定义控件](https://github.com/zlgopen/awtk-widget-generator/blob/master/docs/improve_generated_widget.md)
|
@ -0,0 +1,8 @@
|
||||
import os
|
||||
import scripts.app_helper as app
|
||||
|
||||
helper = app.Helper(ARGUMENTS)
|
||||
helper.set_dll_def('src/qr.def').set_libs(['qr']).call(DefaultEnvironment)
|
||||
|
||||
SConscriptFiles = ['src/SConscript']
|
||||
SConscript(SConscriptFiles)
|
After Width: | Height: | Size: 2.0 KiB |
After Width: | Height: | Size: 9.8 KiB |
After Width: | Height: | Size: 25 KiB |
@ -0,0 +1,459 @@
|
||||
<window>
|
||||
<style name="default">
|
||||
<normal bg_color="#ffffff"/>
|
||||
</style>
|
||||
</window>
|
||||
|
||||
<dialog>
|
||||
<style name="default" border_color="#c2c2c2">
|
||||
<normal bg_color="#ffffff"/>
|
||||
</style>
|
||||
</dialog>
|
||||
|
||||
<popup>
|
||||
<style name="default" border_color="#c2c2c2">
|
||||
<normal bg_color="#ffffff"/>
|
||||
</style>
|
||||
</popup>
|
||||
|
||||
<overlay>
|
||||
<style name="default" border_color="#c2c2c2">
|
||||
<normal bg_color="#ffffff"/>
|
||||
</style>
|
||||
</overlay>
|
||||
|
||||
<system_bar>
|
||||
<style name="default" border="bottom" border_color="#c2c2c2">
|
||||
<normal bg_color="#ffffff"/>
|
||||
</style>
|
||||
</system_bar>
|
||||
|
||||
<system_bar_bottom>
|
||||
<style name="default" border="top" border_color="#c2c2c2">
|
||||
<normal bg_color="#ffffff"/>
|
||||
</style>
|
||||
</system_bar_bottom>
|
||||
|
||||
<keyboard>
|
||||
<style name="default" border_color="#c2c2c2">
|
||||
<normal bg_color="#e1e1e1"/>
|
||||
</style>
|
||||
</keyboard>
|
||||
|
||||
<button>
|
||||
<style name="default" round_radius="4">
|
||||
<normal text_color="#444444" bg_color="#f4f4f4" border_color="#c2c2c2"/>
|
||||
<pressed text_color="#ffffff" bg_color="#1971dd" border_color="#1971dd"/>
|
||||
<over text_color="#ffffff" bg_color="#338fff" border_color="#338fff"/>
|
||||
<focused text_color="#444444" bg_color="#f4f4f4" border_color="#338fff" />
|
||||
<disable text_color="#44444466" bg_color="#f4f4f466" border_color="#c2c2c266" />
|
||||
</style>
|
||||
|
||||
<style name="combobox_down" border_color="#c2c2c2" bg_color="#f2f2f2">
|
||||
<normal icon="arrow_down_n"/>
|
||||
<pressed icon="arrow_down_p"/>
|
||||
<over icon="arrow_down_o"/>
|
||||
<disable icon="arrow_down_d" border_color="#c2c2c266" bg_color="#f2f2f266"/>
|
||||
</style>
|
||||
|
||||
<style name="spinbox_down" border_color="#c2c2c2" bg_color="#f2f2f2">
|
||||
<normal icon="arrow_down_n"/>
|
||||
<pressed icon="arrow_down_p"/>
|
||||
<over icon="arrow_down_o"/>
|
||||
<disable icon="arrow_down_d" border_color="#c2c2c266" bg_color="#f2f2f266"/>
|
||||
</style>
|
||||
|
||||
<style name="spinbox_up" border_color="#c2c2c2" bg_color="#f2f2f2">
|
||||
<normal icon="arrow_up_n"/>
|
||||
<pressed icon="arrow_up_p"/>
|
||||
<over icon="arrow_up_o"/>
|
||||
<disable icon="arrow_up_d" border_color="#c2c2c266" bg_color="#f2f2f266"/>
|
||||
</style>
|
||||
|
||||
<style name="spinbox_left" border_color="#c2c2c2" bg_color="#f2f2f2">
|
||||
<normal icon="arrow_left_n"/>
|
||||
<pressed icon="arrow_left_p"/>
|
||||
<over icon="arrow_left_o"/>
|
||||
<disable icon="arrow_left_d" border_color="#c2c2c266" bg_color="#f2f2f266"/>
|
||||
</style>
|
||||
|
||||
<style name="spinbox_right" border_color="#c2c2c2" bg_color="#f2f2f2">
|
||||
<normal icon="arrow_right_n"/>
|
||||
<pressed icon="arrow_right_p"/>
|
||||
<over icon="arrow_right_o"/>
|
||||
<disable icon="arrow_right_d" border_color="#c2c2c266" bg_color="#f2f2f266"/>
|
||||
</style>
|
||||
|
||||
<style name="scroll_down" bg_color="#f2f2f2">
|
||||
<normal icon="arrow_down_n"/>
|
||||
<pressed icon="arrow_down_p"/>
|
||||
<over icon="arrow_down_o"/>
|
||||
<disable icon="arrow_down_d" border_color="#c2c2c266" bg_color="#f2f2f266"/>
|
||||
</style>
|
||||
|
||||
<style name="scroll_up" bg_color="#f2f2f2">
|
||||
<normal icon="arrow_up_n"/>
|
||||
<pressed icon="arrow_up_p"/>
|
||||
<over icon="arrow_up_o"/>
|
||||
<disable icon="arrow_up_d" bg_color="#f2f2f266"/>
|
||||
</style>
|
||||
|
||||
<style name="scroll_left" bg_color="#f2f2f2">
|
||||
<normal icon="arrow_left_n"/>
|
||||
<pressed icon="arrow_left_p"/>
|
||||
<over icon="arrow_left_o"/>
|
||||
<disable icon="arrow_left_d" bg_color="#f2f2f266"/>
|
||||
</style>
|
||||
|
||||
<style name="scroll_right" bg_color="#f2f2f2">
|
||||
<normal icon="arrow_right_n"/>
|
||||
<pressed icon="arrow_right_p"/>
|
||||
<over icon="arrow_right_o"/>
|
||||
<disable icon="arrow_right_d" bg_color="#f2f2f266"/>
|
||||
</style>
|
||||
|
||||
</button>
|
||||
|
||||
<edit selected_text_color="#010101" selected_bg_color="#b5d7fd">
|
||||
<style name="default" bg_color="#f7f7f7" text_color="#444444" text_align_h="left">
|
||||
<normal border_color="#c2c2c2"/>
|
||||
<focused border_color="#338fff"/>
|
||||
<disable bg_color="#f7f7f766" border_color="#c2c2c266" text_color="#44444466" />
|
||||
<error border_color="#ff0000" />
|
||||
<empty border_color="#c2c2c2" text_color="#959494"/>
|
||||
<empty_focus border_color="#c2c2c2" text_color="#959494"/>
|
||||
<over border_color="#338fff"/>
|
||||
</style>
|
||||
</edit>
|
||||
|
||||
|
||||
<spin_box selected_text_color="#010101" selected_bg_color="#b5d7fd">
|
||||
<style name="default" bg_color="#f7f7f7" text_color="#444444" text_align_h="left">
|
||||
<normal border_color="#c2c2c2"/>
|
||||
<focused border_color="#338fff"/>
|
||||
<disable bg_color="#f7f7f766" border_color="#c2c2c266" text_color="#44444466"/>
|
||||
<error border_color="#ff0000"/>
|
||||
<empty border_color="#c2c2c2" text_color="#959494"/>
|
||||
<empty_focus border_color="#c2c2c2" text_color="#959494"/>
|
||||
<over border_color="#338fff"/>
|
||||
<has_value has_value="1"/>
|
||||
</style>
|
||||
</spin_box>
|
||||
|
||||
<digit_clock>
|
||||
<style name="default">
|
||||
<normal text_color="#444444" />
|
||||
</style>
|
||||
</digit_clock>
|
||||
|
||||
<label>
|
||||
<style name="default">
|
||||
<normal text_color="#444444"/>
|
||||
<disable text_color="#44444466"/>
|
||||
</style>
|
||||
</label>
|
||||
|
||||
<progress_bar>
|
||||
<style name="default" round_radius="5">
|
||||
<normal text_color="#444444" bg_color="#d8d8d8" fg_color="#338fff" border_color="#d8d8d8"/>
|
||||
<disable text_color="#44444466" bg_color="#d8d8d866" fg_color="#338fff66" border_color="#d8d8d866"/>
|
||||
</style>
|
||||
</progress_bar>
|
||||
|
||||
<slider>
|
||||
<style name="default" round_radius="5">
|
||||
<normal bg_color="#d8d8d8" fg_color="#338fff" border_color="#bfbfbf"/>
|
||||
<pressed bg_color="#d8d8d8" fg_color="#338fff" border_color="#1456d6"/>
|
||||
<over bg_color="#d8d8d8" fg_color="#338fff" border_color="#54d8ff"/>
|
||||
<focused bg_color="#d8d8d8" fg_color="#338fff" border_color="#54d8ff"/>
|
||||
<disable bg_color="#d8d8d866" fg_color="#338fff66" border_color="#ececec"/>
|
||||
</style>
|
||||
</slider>
|
||||
|
||||
<check_button>
|
||||
<style name="default" icon_at="left" text_color="#444444">
|
||||
<normal icon="check_unchecked" />
|
||||
<pressed icon="check_unchecked" />
|
||||
<over icon="check_unchecked" />
|
||||
<focused icon="check_unchecked" />
|
||||
<disable icon="check_unchecked_d" text_color="#44444466"/>
|
||||
<normal_of_checked icon="check_checked" />
|
||||
<pressed_of_checked icon="check_checked" />
|
||||
<over_of_checked icon="check_checked" />
|
||||
<focused_of_checked icon="check_checked" />
|
||||
<disable_of_checked icon="check_checked_d" text_color="#44444466"/>
|
||||
</style>
|
||||
</check_button>
|
||||
|
||||
<radio_button>
|
||||
<style name="default" text_color="#444444" icon_at="left">
|
||||
<normal icon="radio_unchecked" />
|
||||
<pressed icon="radio_unchecked" />
|
||||
<over icon="radio_unchecked" />
|
||||
<focused icon="radio_unchecked" />
|
||||
<disable icon="radio_unchecked_d" text_color="#44444466"/>
|
||||
<normal_of_checked icon="radio_checked"/>
|
||||
<pressed_of_checked icon="radio_checked"/>
|
||||
<over_of_checked icon="radio_checked"/>
|
||||
<focused_of_checked icon="radio_checked" />
|
||||
<disable_of_checked icon="radio_checked_d" text_color="#44444466"/>
|
||||
</style>
|
||||
</radio_button>
|
||||
|
||||
<image>
|
||||
<style name="default" text_color="#444444">
|
||||
<normal />
|
||||
</style>
|
||||
</image>
|
||||
|
||||
<scroll_bar_m>
|
||||
<style name="default">
|
||||
<normal fg_color="#808080"/>
|
||||
<disable fg_color="#80808066"/>
|
||||
</style>
|
||||
</scroll_bar_m>
|
||||
|
||||
<scroll_bar_d>
|
||||
<style name="default" border_color="#bebebe">
|
||||
<normal bg_color="#f0f0f0"/>
|
||||
<over bg_color="#f0f0f0" />
|
||||
<pressed bg_color="#f0f0f0" />
|
||||
<disable bg_color="#f0f0f066" border_color="#bebebe66"/>
|
||||
</style>
|
||||
</scroll_bar_d>
|
||||
|
||||
<dragger>
|
||||
<style name="default" bg_color="#9e9e9e">
|
||||
<normal />
|
||||
<pressed />
|
||||
<over />
|
||||
</style>
|
||||
<style name="scroll_bar">
|
||||
<normal bg_color="#d0d0d0" />
|
||||
<pressed bg_color="#c0c0c0" />
|
||||
<over bg_color="#c0c0c0" />
|
||||
<disable bg_color="#c0c0c066" />
|
||||
</style>
|
||||
</dragger>
|
||||
|
||||
<list_item>
|
||||
<style name="default" border_color="#e9e9e9" text_color="#444444">
|
||||
<normal bg_color="#ffffff" />
|
||||
<pressed bg_color="#338fff" text_color="#ffffff" />
|
||||
<over bg_color="#ffffff" border_color="#338fff"/>
|
||||
<disable border_color="#e9e9e966" text_color="#44444466"/>
|
||||
</style>
|
||||
</list_item>
|
||||
|
||||
<tab_button>
|
||||
<style name="default" border_color="#c2c2c2" text_color="#444444">
|
||||
<normal bg_color="#f4f4f4" />
|
||||
<pressed bg_color="#cecdcd" />
|
||||
<over bg_color="#ffffff" text_color="#1971dd"/>
|
||||
<normal_of_active bg_color="#ffffff" border="top|left|right"/>
|
||||
<pressed_of_active bg_color="#ffffff" text_color="#1971dd" border="top|left|right"/>
|
||||
<over_of_active bg_color="#ffffff" text_color="#1971dd" border="top|left|right"/>
|
||||
<disable_of_active border_color="#c2c2c266" bg_color="#f4f4f466" text_color="#44444466" border="top|left|right"/>
|
||||
<disable border_color="#c2c2c266" bg_color="#f4f4f466" text_color="#44444466"/>
|
||||
</style>
|
||||
</tab_button>
|
||||
|
||||
<tab_button_group >
|
||||
<style name="default">
|
||||
<normal/>
|
||||
</style>
|
||||
|
||||
<style name="scrollable" border_color="#a0a0a0" border="left|right">
|
||||
<normal/>
|
||||
</style>
|
||||
</tab_button_group>
|
||||
|
||||
|
||||
<combo_box selected_text_color="#010101" selected_bg_color="#b5d7fd">
|
||||
<style name="default" bg_color="#f7f7f7" text_color="#444444" text_align_h="left" border_color="#c2c2c2">
|
||||
<normal border_color="#c2c2c2"/>
|
||||
<focused border_color="#338fff"/>
|
||||
<disable bg_color="#f7f7f766" border_color="#c2c2c266" text_color="#44444466"/>
|
||||
<error border_color="#ff0000"/>
|
||||
<empty border_color="#c2c2c2" text_color="#959494"/>
|
||||
<empty_focus border_color="#c2c2c2" text_color="#959494"/>
|
||||
<over border_color="#338fff"/>
|
||||
</style>
|
||||
</combo_box>
|
||||
|
||||
|
||||
<combo_box_ex selected_text_color="#010101" selected_bg_color="#b5d7fd">
|
||||
<style name="default" bg_color="#f7f7f7" text_color="#444444" text_align_h="left" border_color="#c2c2c2">
|
||||
<normal border_color="#c2c2c2"/>
|
||||
<focused border_color="#338fff"/>
|
||||
<disable bg_color="#f7f7f766" border_color="#c2c2c266" text_color="#44444466"/>
|
||||
<error border_color="#ff0000"/>
|
||||
<empty border_color="#c2c2c2" text_color="#959494"/>
|
||||
<empty_focus border_color="#c2c2c2" text_color="#959494"/>
|
||||
<over border_color="#338fff"/>
|
||||
</style>
|
||||
</combo_box_ex>
|
||||
|
||||
<combo_box_item>
|
||||
<style name="default" icon_at="left" text_color="#444444" bg_color="#ffffff">
|
||||
<normal />
|
||||
<pressed bg_color="#338fff" text_color="#ffffff" />
|
||||
<over bg_color="#1971dd" text_color="#ffffff" />
|
||||
<focused bg_color="#1296db" text_color="#ffffff" />
|
||||
<normal_of_checked bg_color="#338fff" text_color="#ffffff"/>
|
||||
<focused_of_checked bg_color="#338fff" text_color="#ffffff"/>
|
||||
<pressed_of_checked bg_color="#338fff" text_color="#ffffff" />
|
||||
<over_of_checked bg_color="#1971dd" text_color="#ffffff" />
|
||||
<disable_of_checked bg_color="#f4f4f466" text_color="#44444466" />
|
||||
<disable bg_color="#f4f4f466" text_color="#44444466"/>
|
||||
</style>
|
||||
</combo_box_item>
|
||||
|
||||
<text_selector>
|
||||
<style name="default" fg_color="#c2c2c2" text_color="#444444" text_align_h="center" bg_color="#ffffff">
|
||||
<normal mask_color="#404040" border_color="#c2c2c2"/>
|
||||
<disable mask_color="#c0c0c0" border_color="#c2c2c266" text_color="#44444466" />
|
||||
</style>
|
||||
</text_selector>
|
||||
|
||||
<switch>
|
||||
<style name="default" margin="2" round_radius="11" fg_color="#ffffff">
|
||||
<normal bg_color="#828282" selected_bg_color="#338fff"/>
|
||||
<disable bg_color="#82828266" selected_bg_color="#338fff66"/>
|
||||
</style>
|
||||
</switch>
|
||||
|
||||
<slide_indicator>
|
||||
<style name="default">
|
||||
<normal fg_color="#338fff40" selected_fg_color="#338fff"/>
|
||||
<disable fg_color="#338fff20" selected_fg_color="#338fff66"/>
|
||||
</style>
|
||||
</slide_indicator>
|
||||
|
||||
<slide_indicator_arc>
|
||||
<style name="default">
|
||||
<normal fg_color="#338fff40" selected_fg_color="#338fff"/>
|
||||
<disable fg_color="#338fff20" selected_fg_color="#338fff66"/>
|
||||
</style>
|
||||
</slide_indicator_arc>
|
||||
|
||||
|
||||
<progress_circle>
|
||||
<style name="default">
|
||||
<normal text_color="#444444" fg_color="#338fff"/>
|
||||
<disable text_color="#44444466" fg_color="#338fff66"/>
|
||||
</style>
|
||||
</progress_circle>
|
||||
|
||||
<svg>
|
||||
<style name="default" text_color="#444444">
|
||||
<normal/>
|
||||
</style>
|
||||
</svg>
|
||||
|
||||
<gif>
|
||||
<style name="default">
|
||||
<normal/>
|
||||
</style>
|
||||
</gif>
|
||||
|
||||
<slide_menu>
|
||||
<style name="default">
|
||||
<normal/>
|
||||
</style>
|
||||
</slide_menu>
|
||||
|
||||
<mledit selected_fg_color="#020202" selected_text_color="#010101" selected_bg_color="#b5d7fd">
|
||||
<style name="default" border_color="#a0a0a0" text_color="#444444" text_align_h="left">
|
||||
<normal bg_color="#ffffff" />
|
||||
<focused bg_color="#ffffff"/>
|
||||
<disable bg_color="gray" text_color="#44444466" />
|
||||
<error bg_color="#ffffff" text_color="red" />
|
||||
<empty bg_color="#ffffff" text_color="#a0a0a0" />
|
||||
<empty_focus bg_color="#ffffff" text_color="#a0a0a0"/>
|
||||
</style>
|
||||
</mledit>
|
||||
|
||||
<line_number>
|
||||
<style name="default" text_align_h="center">
|
||||
<normal text_color="#444444" bg_color="#d0d0d0"/>
|
||||
<disable text_color="#44444466" bg_color="#d0d0d066"/>
|
||||
</style>
|
||||
</line_number>
|
||||
|
||||
<hscroll_label>
|
||||
<style name="default" text_color="#444444">
|
||||
<normal />
|
||||
<disable text_color="#44444466"/>
|
||||
</style>
|
||||
</hscroll_label>
|
||||
|
||||
<color_tile>
|
||||
<style name="default">
|
||||
<normal border_color="#c2c2c2"/>
|
||||
<focused border_color="#338fff"/>
|
||||
<disable border_color="#c2c2c266"/>
|
||||
</style>
|
||||
</color_tile>
|
||||
|
||||
<view>
|
||||
<style name="default">
|
||||
<normal />
|
||||
</style>
|
||||
</view>
|
||||
|
||||
<tab_control>
|
||||
<style name="default">
|
||||
<normal />
|
||||
</style>
|
||||
</tab_control>
|
||||
|
||||
<scroll_view>
|
||||
<style name="default">
|
||||
<normal />
|
||||
</style>
|
||||
</scroll_view>
|
||||
|
||||
<list_view>
|
||||
<style name="default" border_color="#c2c2c2" bg_color="#f4f4f4">
|
||||
<normal />
|
||||
<disable border_color="#c2c2c266" bg_color="#f4f4f466"/>
|
||||
</style>
|
||||
</list_view>
|
||||
|
||||
<list_view_h>
|
||||
<style name="default" border_color="#c2c2c2" bg_color="#f4f4f4">
|
||||
<normal />
|
||||
<disable border_color="#c2c2c266" bg_color="#f4f4f466"/>
|
||||
</style>
|
||||
</list_view_h>
|
||||
|
||||
<pages>
|
||||
<style name="default" border_color="#c2c2c2">
|
||||
<normal />
|
||||
</style>
|
||||
</pages>
|
||||
|
||||
<slide_view>
|
||||
<style name="default">
|
||||
<normal />
|
||||
</style>
|
||||
</slide_view>
|
||||
|
||||
<color_picker>
|
||||
<style name="default">
|
||||
<normal />
|
||||
</style>
|
||||
</color_picker>
|
||||
|
||||
<color_component>
|
||||
<style name="default" border_color="#c2c2c2">
|
||||
<normal />
|
||||
</style>
|
||||
</color_component>
|
||||
|
||||
<candidates>
|
||||
<style name="default" text_color="#444444" bg_color="#fafafa">
|
||||
<normal />
|
||||
</style>
|
||||
</candidates>
|
@ -0,0 +1,6 @@
|
||||
<qr>
|
||||
<style name="default" >
|
||||
<normal fg_color="black" bg_color="white" bg_image="message"/>
|
||||
<disable fg_color="gray" bg_color="#f0f0f0"/>
|
||||
</style>
|
||||
</qr>
|
@ -0,0 +1,4 @@
|
||||
<window theme="main">
|
||||
<qr x="c" y="m" w="240" h="240" value="https://github.com/zlgopen/awtk"/>
|
||||
<button x="c" y="b:30" w="80" h="30" name="close" text="Close"/>
|
||||
</window>
|
@ -0,0 +1,6 @@
|
||||
### 2021/11/25
|
||||
* 去除没有使用到的宏和变量(感谢兆坤提供补丁)
|
||||
* 修复logo裁剪区域未还原导致的界面显示问题(感谢兆坤提供补丁)
|
||||
|
||||
### 2021/10/26
|
||||
* 中间支持LOGO(感谢兆坤提供补丁)
|
After Width: | Height: | Size: 31 KiB |
After Width: | Height: | Size: 26 KiB |
After Width: | Height: | Size: 9.4 KiB |
After Width: | Height: | Size: 7.9 KiB |
After Width: | Height: | Size: 71 KiB |
After Width: | Height: | Size: 1.4 KiB |
After Width: | Height: | Size: 1.2 KiB |
After Width: | Height: | Size: 58 KiB |
@ -0,0 +1,6 @@
|
||||
find src -name \*.c -exec clang-format -i {} \;
|
||||
find src -name \*.h -exec clang-format -i {} \;
|
||||
find src -name \*.cc -exec clang-format -i {} \;
|
||||
find src -name \*.cpp -exec clang-format -i {} \;
|
||||
find src -name \*.inc -exec clang-format -i {} \;
|
||||
|
@ -0,0 +1,3 @@
|
||||
|
||||
node ../awtk/tools/idl_gen/index.js idl/idl.json src/
|
||||
node ../awtk/tools/dll_def_gen/index.js idl/idl.json src/qr.def
|
@ -0,0 +1,154 @@
|
||||
[
|
||||
{
|
||||
"params": [],
|
||||
"annotation": {
|
||||
"global": true
|
||||
},
|
||||
"desc": "注册控件。",
|
||||
"name": "qr_register",
|
||||
"return": {
|
||||
"type": "ret_t",
|
||||
"desc": "返回RET_OK表示成功,否则表示失败。"
|
||||
},
|
||||
"type": "method",
|
||||
"header": "src/qr_register.h",
|
||||
"level": 1
|
||||
},
|
||||
{
|
||||
"params": [],
|
||||
"annotation": {
|
||||
"global": true
|
||||
},
|
||||
"desc": "获取支持的渲染模式。",
|
||||
"name": "qr_supported_render_mode",
|
||||
"return": {
|
||||
"type": "const char*",
|
||||
"desc": "返回渲染模式。"
|
||||
},
|
||||
"type": "method",
|
||||
"header": "src/qr_register.h",
|
||||
"level": 1
|
||||
},
|
||||
{
|
||||
"type": "class",
|
||||
"methods": [
|
||||
{
|
||||
"params": [
|
||||
{
|
||||
"type": "widget_t*",
|
||||
"name": "parent",
|
||||
"desc": "父控件"
|
||||
},
|
||||
{
|
||||
"type": "xy_t",
|
||||
"name": "x",
|
||||
"desc": "x坐标"
|
||||
},
|
||||
{
|
||||
"type": "xy_t",
|
||||
"name": "y",
|
||||
"desc": "y坐标"
|
||||
},
|
||||
{
|
||||
"type": "wh_t",
|
||||
"name": "w",
|
||||
"desc": "宽度"
|
||||
},
|
||||
{
|
||||
"type": "wh_t",
|
||||
"name": "h",
|
||||
"desc": "高度"
|
||||
}
|
||||
],
|
||||
"annotation": {
|
||||
"constructor": true,
|
||||
"scriptable": true
|
||||
},
|
||||
"desc": "创建qr对象",
|
||||
"name": "qr_create",
|
||||
"return": {
|
||||
"type": "widget_t*",
|
||||
"desc": "qr对象。"
|
||||
}
|
||||
},
|
||||
{
|
||||
"params": [
|
||||
{
|
||||
"type": "widget_t*",
|
||||
"name": "widget",
|
||||
"desc": "qr对象。"
|
||||
}
|
||||
],
|
||||
"annotation": {
|
||||
"cast": true,
|
||||
"scriptable": true
|
||||
},
|
||||
"desc": "转换为qr对象(供脚本语言使用)。",
|
||||
"name": "qr_cast",
|
||||
"return": {
|
||||
"type": "widget_t*",
|
||||
"desc": "qr对象。"
|
||||
}
|
||||
},
|
||||
{
|
||||
"params": [
|
||||
{
|
||||
"type": "widget_t*",
|
||||
"name": "widget",
|
||||
"desc": "widget对象。"
|
||||
},
|
||||
{
|
||||
"type": "const char*",
|
||||
"name": "value",
|
||||
"desc": "格式字符串。"
|
||||
}
|
||||
],
|
||||
"annotation": {
|
||||
"scriptable": true
|
||||
},
|
||||
"desc": "设置要转成二维码的字符串。",
|
||||
"name": "qr_set_value",
|
||||
"return": {
|
||||
"type": "ret_t",
|
||||
"desc": "返回RET_OK表示成功,否则表示失败。"
|
||||
}
|
||||
},
|
||||
{
|
||||
"params": [],
|
||||
"annotation": {},
|
||||
"desc": "获取 qr 虚表。",
|
||||
"name": "qr_get_widget_vtable",
|
||||
"return": {
|
||||
"type": "const widget_vtable_t*",
|
||||
"desc": "成功返回 qr 虚表。"
|
||||
}
|
||||
}
|
||||
],
|
||||
"events": [],
|
||||
"properties": [
|
||||
{
|
||||
"name": "value",
|
||||
"desc": "要转成二维码的字符串。值。",
|
||||
"type": "char*",
|
||||
"annotation": {
|
||||
"set_prop": true,
|
||||
"get_prop": true,
|
||||
"readable": true,
|
||||
"persitent": true,
|
||||
"design": true,
|
||||
"scriptable": true
|
||||
}
|
||||
}
|
||||
],
|
||||
"header": "qr/qr.h",
|
||||
"desc": "显示二维码的控件\nqr\\_t是[widget\\_t](widget_t.md)的子类控件,widget\\_t的函数均适用于qr\\_t控件。\n\n在xml中使用\"qr\"标签创建数值文本控件。如:\n\n```xml\n<!-- ui -->\n<qr x=\"c\" y=\"m\" w=\"240\" h=\"240\" value=\"https://github.com/zlgopen/awtk\"/>\n```\n在c代码中使用函数qr\\_create创建数值文本控件。如:\n\n```c\nwidget_t* qr = qr_create(win, 10, 10, 128, 128);\n```\n可用通过style来设置控件的显示风格,如字体的大小和颜色等等。如:\n\n```xml\n<!-- style -->\n<qr>\n<style name=\"default\" >\n<normal fg_color=\"black\" bg_color=\"white\" bg_image=\"message\"/>\n<disable fg_color=\"gray\" bg_color=\"#f0f0f0\"/>\n</style>\n</qr>\n```",
|
||||
"name": "qr_t",
|
||||
"parent": "widget_t",
|
||||
"annotation": {
|
||||
"scriptable": true,
|
||||
"design": true,
|
||||
"widget": true
|
||||
},
|
||||
"level": 2
|
||||
}
|
||||
]
|
@ -0,0 +1,46 @@
|
||||
{
|
||||
"name": "qr",
|
||||
"version": "1.0.1",
|
||||
"date": "2020-06-01",
|
||||
"team": "AWTK Develop Team",
|
||||
"author": "Li XianJing <xianjimli@hotmail.com>",
|
||||
"desc": "显示二维码的控件",
|
||||
"copyright": "Guangzhou ZHIYUAN Electronics Co.,Ltd.",
|
||||
"type": "PROJECT_CUSTOM_WIDGET",
|
||||
"entry": "main",
|
||||
"assets": {
|
||||
"activedTheme": "default",
|
||||
"outputDir": "res",
|
||||
"loadFrom": "any",
|
||||
"const": "resource_data",
|
||||
"screenDPR": "x1",
|
||||
"defaultLanguage": "zh",
|
||||
"defaultCountry": "CN",
|
||||
"themes": {
|
||||
"default": {
|
||||
"activedSystemBar": "system_bar",
|
||||
"activedBottomSystemBar": "system_bar_b",
|
||||
"packaged": true,
|
||||
"fonts": {
|
||||
"default": {
|
||||
"text": " !\"#$%&'()*+,-./0123456789:;<=>?@ABCDEFGHIJKLMNOPQRSTUVWXYZ[\\]^_`abcdefghijklmnopqrstuvwxyz{|}~,。?!确定取消"
|
||||
}
|
||||
},
|
||||
"lcd": {
|
||||
"width": "320",
|
||||
"height": "480",
|
||||
"colorDepth": "16bit",
|
||||
"colorFormat": "BGR(A)"
|
||||
}
|
||||
}
|
||||
}
|
||||
},
|
||||
"creator": {
|
||||
"name": "AWTK Designer",
|
||||
"version": "2.0.21"
|
||||
},
|
||||
"awtkRoot": "${AWTK_SDK_PATH}/awtk",
|
||||
"dependencies": {
|
||||
"awtk": ">=2112"
|
||||
}
|
||||
}
|
2
lib/awtk/awtk-examples/Meter.v2-Demo/3rd/awtk-widget-qr/scripts/.gitignore
vendored
Normal file
@ -0,0 +1,2 @@
|
||||
__pycache__
|
||||
*.pyc
|
@ -0,0 +1,7 @@
|
||||
import os
|
||||
import sys
|
||||
APP_SCRIPTS_ROOT = os.path.abspath(os.path.dirname(__file__))
|
||||
|
||||
print('APP_SCRIPTS_ROOT:' + APP_SCRIPTS_ROOT)
|
||||
|
||||
sys.path.insert(0, APP_SCRIPTS_ROOT)
|
@ -0,0 +1,7 @@
|
||||
import awtk_locator as locator
|
||||
|
||||
def Helper(ARGUMENTS):
|
||||
locator.init(ARGUMENTS)
|
||||
|
||||
from app_helper_base import AppHelperBase
|
||||
return AppHelperBase(ARGUMENTS)
|
@ -0,0 +1,62 @@
|
||||
import os
|
||||
import sys
|
||||
|
||||
AWTK_ROOT = ''
|
||||
|
||||
def getAwtkRoot():
|
||||
return AWTK_ROOT
|
||||
|
||||
def getAwtkSDKPath():
|
||||
env = os.environ
|
||||
if 'AWTK_SDK_PATH' in env:
|
||||
return env['AWTK_SDK_PATH']
|
||||
else:
|
||||
return ''
|
||||
|
||||
def getAwtkOrAwtkLinuxFbRoot(is_linux_fb):
|
||||
if is_linux_fb:
|
||||
return locateAWTK('awtk-linux-fb')
|
||||
else:
|
||||
return locateAWTK('awtk')
|
||||
|
||||
def locateAWTK(awtk):
|
||||
awtk_root = ''
|
||||
|
||||
if not os.path.exists(awtk_root):
|
||||
dirnames = ['../'+awtk, '../../'+awtk, '../../../'+awtk]
|
||||
for dirname in dirnames:
|
||||
if os.path.exists(dirname):
|
||||
awtk_root = dirname
|
||||
break
|
||||
|
||||
if not os.path.exists(awtk_root):
|
||||
awtk_sdk_path = getAwtkSDKPath();
|
||||
if os.path.exists(awtk_sdk_path):
|
||||
awtk_root = awtk_sdk_path + '/' + awtk
|
||||
|
||||
return os.path.abspath(awtk_root)
|
||||
|
||||
def init(ARGUMENTS = None):
|
||||
global AWTK_ROOT
|
||||
global LINUX_FB
|
||||
|
||||
if ARGUMENTS:
|
||||
AWTK_ROOT = ARGUMENTS.get('AWTK_ROOT', '')
|
||||
LINUX_FB = ARGUMENTS.get('LINUX_FB', '')
|
||||
else:
|
||||
LINUX_FB = ''
|
||||
|
||||
if not os.path.exists(AWTK_ROOT):
|
||||
AWTK_ROOT = getAwtkOrAwtkLinuxFbRoot(LINUX_FB != '')
|
||||
elif os.path.exists(LINUX_FB):
|
||||
print(' do not set LINUX_FB and AWTK_ROOT !!!')
|
||||
sys.exit()
|
||||
|
||||
if LINUX_FB:
|
||||
AWTK_SCRIPTS_ROOT = os.path.join(AWTK_ROOT, '../awtk/scripts')
|
||||
else:
|
||||
AWTK_SCRIPTS_ROOT = os.path.join(AWTK_ROOT, 'scripts')
|
||||
sys.path.insert(0, AWTK_SCRIPTS_ROOT)
|
||||
|
||||
print('AWTK_ROOT: ' + AWTK_ROOT)
|
||||
print('AWTK_SCRIPTS_ROOT: ' + AWTK_SCRIPTS_ROOT)
|
@ -0,0 +1,41 @@
|
||||
import sys
|
||||
import awtk_locator as locator
|
||||
|
||||
LONGSOPTS = ['awtk_root=', 'AWTK_ROOT=']
|
||||
def get_args(args, longsopts = []) :
|
||||
list_opts = []
|
||||
for arg in args:
|
||||
if arg.startswith('--') :
|
||||
tmp_opt = '';
|
||||
for opt in longsopts:
|
||||
if arg.find(opt) > 0 :
|
||||
tmp_opt = opt;
|
||||
break
|
||||
if tmp_opt != '' :
|
||||
list_opts.append(arg.split(tmp_opt)[1])
|
||||
continue
|
||||
else :
|
||||
print(arg + " not find command, command :")
|
||||
print(longsopts)
|
||||
sys.exit()
|
||||
return list_opts
|
||||
|
||||
|
||||
def update_res(ARGUMENTS, is_new_usage):
|
||||
locator.init(ARGUMENTS)
|
||||
|
||||
import update_res_app as updater
|
||||
if is_new_usage and not hasattr(updater, "getopt") :
|
||||
print(" must update awtk !!!")
|
||||
sys.exit()
|
||||
updater.run(locator.getAwtkRoot())
|
||||
|
||||
is_new_usage = False
|
||||
opts = get_args(sys.argv[1:], LONGSOPTS)
|
||||
ARGUMENTS = dict()
|
||||
if len(opts) > 0 :
|
||||
is_new_usage = True
|
||||
ARGUMENTS['AWTK_ROOT'] = opts[0]
|
||||
else :
|
||||
ARGUMENTS['AWTK_ROOT'] = ''
|
||||
update_res(ARGUMENTS, is_new_usage)
|
@ -0,0 +1,22 @@
|
||||
import os
|
||||
import sys
|
||||
import platform
|
||||
|
||||
OS_NAME = platform.system();
|
||||
LIB_DIR=os.environ['LIB_DIR'];
|
||||
BIN_DIR=os.environ['BIN_DIR'];
|
||||
|
||||
env=DefaultEnvironment().Clone()
|
||||
SOURCES=Glob('qr/*.cpp') + Glob('qr/*.c') + Glob('*.c')
|
||||
|
||||
EXPORT_DEF=''
|
||||
if OS_NAME == 'Windows' and os.environ['TOOLS_NAME'] == '':
|
||||
EXPORT_DEF = ' /DEF:"src/qr.def" '
|
||||
|
||||
if 'BUILD_SHARED' in os.environ and os.environ['BUILD_SHARED'] == 'True':
|
||||
LIBS=['awtk'];
|
||||
LINKFLAGS=env['LINKFLAGS'] + EXPORT_DEF
|
||||
env.SharedLibrary(os.path.join(BIN_DIR, 'qr'), SOURCES, LIBS=LIBS, LINKFLAGS=LINKFLAGS);
|
||||
else:
|
||||
env.Library(os.path.join(LIB_DIR, 'qr'), SOURCES);
|
||||
|
@ -0,0 +1,8 @@
|
||||
LIBRARY qr
|
||||
EXPORTS
|
||||
qr_register
|
||||
qr_supported_render_mode
|
||||
qr_create
|
||||
qr_cast
|
||||
qr_set_value
|
||||
qr_get_widget_vtable
|
@ -0,0 +1,229 @@
|
||||
/*
|
||||
* qrencode - QR Code encoder
|
||||
*
|
||||
* Binary sequence class.
|
||||
* Copyright (C) 2006-2017 Kentaro Fukuchi <kentaro@fukuchi.org>
|
||||
*
|
||||
* This library is free software; you can redistribute it and/or
|
||||
* modify it under the terms of the GNU Lesser General Public
|
||||
* License as published by the Free Software Foundation; either
|
||||
* version 2.1 of the License, or any later version.
|
||||
*
|
||||
* This library is distributed in the hope that it will be useful,
|
||||
* but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
|
||||
* Lesser General Public License for more details.
|
||||
*
|
||||
* You should have received a copy of the GNU Lesser General Public
|
||||
* License along with this library; if not, write to the Free Software
|
||||
* Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA
|
||||
*/
|
||||
|
||||
# include "config.h"
|
||||
#include <stdio.h>
|
||||
#include <stdlib.h>
|
||||
#include <string.h>
|
||||
|
||||
#include "bitstream.h"
|
||||
|
||||
#define DEFAULT_BUFSIZE (128)
|
||||
|
||||
BitStream *BitStream_new(void)
|
||||
{
|
||||
BitStream *bstream;
|
||||
|
||||
bstream = (BitStream *)TKMEM_ALLOC(sizeof(BitStream));
|
||||
if(bstream == NULL) return NULL;
|
||||
|
||||
bstream->length = 0;
|
||||
bstream->data = (unsigned char *)TKMEM_ALLOC(DEFAULT_BUFSIZE);
|
||||
if(bstream->data == NULL) {
|
||||
tk_free(bstream);
|
||||
return NULL;
|
||||
}
|
||||
bstream->datasize = DEFAULT_BUFSIZE;
|
||||
|
||||
return bstream;
|
||||
}
|
||||
|
||||
#ifdef WITH_TESTS
|
||||
BitStream *BitStream_newWithBits(size_t size, unsigned char *bits)
|
||||
{
|
||||
BitStream *bstream;
|
||||
|
||||
if(size == 0) return BitStream_new();
|
||||
|
||||
bstream = (BitStream *)TKMEM_ALLOC(sizeof(BitStream));
|
||||
if(bstream == NULL) return NULL;
|
||||
|
||||
bstream->data = (unsigned char *)TKMEM_ALLOC(size);
|
||||
if(bstream->data == NULL) {
|
||||
tk_free(bstream);
|
||||
return NULL;
|
||||
}
|
||||
|
||||
bstream->length = size;
|
||||
bstream->datasize = size;
|
||||
memcpy(bstream->data, bits, size);
|
||||
|
||||
return bstream;
|
||||
}
|
||||
#endif
|
||||
|
||||
static int BitStream_expand(BitStream *bstream)
|
||||
{
|
||||
unsigned char *data;
|
||||
|
||||
data = (unsigned char *)TKMEM_REALLOC(bstream->data, bstream->datasize * 2);
|
||||
if(data == NULL) {
|
||||
return -1;
|
||||
}
|
||||
|
||||
bstream->data = data;
|
||||
bstream->datasize *= 2;
|
||||
|
||||
return 0;
|
||||
}
|
||||
|
||||
static void BitStream_writeNum(unsigned char *dest, size_t bits, unsigned int num)
|
||||
{
|
||||
unsigned int mask;
|
||||
size_t i;
|
||||
unsigned char *p;
|
||||
|
||||
p = dest;
|
||||
mask = 1U << (bits - 1);
|
||||
for(i = 0; i < bits; i++) {
|
||||
if(num & mask) {
|
||||
*p = 1;
|
||||
} else {
|
||||
*p = 0;
|
||||
}
|
||||
p++;
|
||||
mask = mask >> 1;
|
||||
}
|
||||
}
|
||||
|
||||
static void BitStream_writeBytes(unsigned char *dest, size_t size, unsigned char *data)
|
||||
{
|
||||
unsigned char mask;
|
||||
size_t i, j;
|
||||
unsigned char *p;
|
||||
|
||||
p = dest;
|
||||
for(i = 0; i < size; i++) {
|
||||
mask = 0x80;
|
||||
for(j = 0; j < 8; j++) {
|
||||
if(data[i] & mask) {
|
||||
*p = 1;
|
||||
} else {
|
||||
*p = 0;
|
||||
}
|
||||
p++;
|
||||
mask = mask >> 1;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
int BitStream_append(BitStream *bstream, BitStream *arg)
|
||||
{
|
||||
int ret;
|
||||
|
||||
if(arg == NULL) {
|
||||
return -1;
|
||||
}
|
||||
if(arg->length == 0) {
|
||||
return 0;
|
||||
}
|
||||
|
||||
while(bstream->length + arg->length > bstream->datasize) {
|
||||
ret = BitStream_expand(bstream);
|
||||
if(ret < 0) return ret;
|
||||
}
|
||||
|
||||
memcpy(bstream->data + bstream->length, arg->data, arg->length);
|
||||
bstream->length += arg->length;
|
||||
|
||||
return 0;
|
||||
}
|
||||
|
||||
int BitStream_appendNum(BitStream *bstream, size_t bits, unsigned int num)
|
||||
{
|
||||
int ret;
|
||||
|
||||
if(bits == 0) return 0;
|
||||
|
||||
while(bstream->datasize - bstream->length < bits) {
|
||||
ret = BitStream_expand(bstream);
|
||||
if(ret < 0) return ret;
|
||||
}
|
||||
BitStream_writeNum(bstream->data + bstream->length, bits, num);
|
||||
bstream->length += bits;
|
||||
|
||||
return 0;
|
||||
}
|
||||
|
||||
int BitStream_appendBytes(BitStream *bstream, size_t size, unsigned char *data)
|
||||
{
|
||||
int ret;
|
||||
|
||||
if(size == 0) return 0;
|
||||
|
||||
while(bstream->datasize - bstream->length < size * 8) {
|
||||
ret = BitStream_expand(bstream);
|
||||
if(ret < 0) return ret;
|
||||
}
|
||||
BitStream_writeBytes(bstream->data + bstream->length, size, data);
|
||||
bstream->length += size * 8;
|
||||
|
||||
return 0;
|
||||
}
|
||||
|
||||
unsigned char *BitStream_toByte(BitStream *bstream)
|
||||
{
|
||||
size_t i, j, size, bytes, oddbits;
|
||||
unsigned char *data, v;
|
||||
unsigned char *p;
|
||||
|
||||
size = BitStream_size(bstream);
|
||||
if(size == 0) {
|
||||
return NULL;
|
||||
}
|
||||
data = (unsigned char *)TKMEM_ALLOC((size + 7) / 8);
|
||||
if(data == NULL) {
|
||||
return NULL;
|
||||
}
|
||||
|
||||
bytes = size / 8;
|
||||
|
||||
p = bstream->data;
|
||||
for(i = 0; i < bytes; i++) {
|
||||
v = 0;
|
||||
for(j = 0; j < 8; j++) {
|
||||
v = (unsigned char)(v << 1);
|
||||
v |= *p;
|
||||
p++;
|
||||
}
|
||||
data[i] = v;
|
||||
}
|
||||
oddbits = size & 7;
|
||||
if(oddbits > 0) {
|
||||
v = 0;
|
||||
for(j = 0; j < oddbits; j++) {
|
||||
v = (unsigned char)(v << 1);
|
||||
v |= *p;
|
||||
p++;
|
||||
}
|
||||
data[bytes] = (unsigned char)(v << (8 - oddbits));
|
||||
}
|
||||
|
||||
return data;
|
||||
}
|
||||
|
||||
void BitStream_free(BitStream *bstream)
|
||||
{
|
||||
if(bstream != NULL) {
|
||||
tk_free(bstream->data);
|
||||
tk_free(bstream);
|
||||
}
|
||||
}
|
@ -0,0 +1,43 @@
|
||||
/*
|
||||
* qrencode - QR Code encoder
|
||||
*
|
||||
* Binary sequence class.
|
||||
* Copyright (C) 2006-2017 Kentaro Fukuchi <kentaro@fukuchi.org>
|
||||
*
|
||||
* This library is free software; you can redistribute it and/or
|
||||
* modify it under the terms of the GNU Lesser General Public
|
||||
* License as published by the Free Software Foundation; either
|
||||
* version 2.1 of the License, or any later version.
|
||||
*
|
||||
* This library is distributed in the hope that it will be useful,
|
||||
* but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
|
||||
* Lesser General Public License for more details.
|
||||
*
|
||||
* You should have received a copy of the GNU Lesser General Public
|
||||
* License along with this library; if not, write to the Free Software
|
||||
* Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA
|
||||
*/
|
||||
|
||||
#ifndef BITSTREAM_H
|
||||
#define BITSTREAM_H
|
||||
|
||||
typedef struct {
|
||||
size_t length;
|
||||
size_t datasize;
|
||||
unsigned char *data;
|
||||
} BitStream;
|
||||
|
||||
extern BitStream *BitStream_new(void);
|
||||
#ifdef WITH_TESTS
|
||||
extern BitStream *BitStream_newWithBits(size_t size, unsigned char *bits);
|
||||
#endif
|
||||
extern int BitStream_append(BitStream *bstream, BitStream *arg);
|
||||
extern int BitStream_appendNum(BitStream *bstream, size_t bits, unsigned int num);
|
||||
extern int BitStream_appendBytes(BitStream *bstream, size_t size, unsigned char *data);
|
||||
#define BitStream_size(__bstream__) (__bstream__->length)
|
||||
#define BitStream_reset(__bstream__) (__bstream__->length = 0)
|
||||
extern unsigned char *BitStream_toByte(BitStream *bstream);
|
||||
extern void BitStream_free(BitStream *bstream);
|
||||
|
||||
#endif /* BITSTREAM_H */
|
@ -0,0 +1,13 @@
|
||||
#ifndef QRENCODER_CONFIG_H
|
||||
#define QRENCODER_CONFIG_H
|
||||
|
||||
#include "awtk.h"
|
||||
#include "tkc/mem.h"
|
||||
|
||||
#define STATIC_IN_RELEASE static
|
||||
#define MAJOR_VERSION 4
|
||||
#define MINOR_VERSION 1
|
||||
#define MICRO_VERSION 0
|
||||
#define VERSION "1.0"
|
||||
|
||||
#endif/*QRENCODER_CONFIG_H*/
|
@ -0,0 +1,354 @@
|
||||
/*
|
||||
* qrencode - QR Code encoder
|
||||
*
|
||||
* Masking.
|
||||
* Copyright (C) 2006-2017 Kentaro Fukuchi <kentaro@fukuchi.org>
|
||||
*
|
||||
* This library is free software; you can redistribute it and/or
|
||||
* modify it under the terms of the GNU Lesser General Public
|
||||
* License as published by the Free Software Foundation; either
|
||||
* version 2.1 of the License, or any later version.
|
||||
*
|
||||
* This library is distributed in the hope that it will be useful,
|
||||
* but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
|
||||
* Lesser General Public License for more details.
|
||||
*
|
||||
* You should have received a copy of the GNU Lesser General Public
|
||||
* License along with this library; if not, write to the Free Software
|
||||
* Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA
|
||||
*/
|
||||
|
||||
# include "config.h"
|
||||
#include <stdlib.h>
|
||||
#include <string.h>
|
||||
#include <limits.h>
|
||||
#include <errno.h>
|
||||
|
||||
#include "qrencode.h"
|
||||
#include "qrspec.h"
|
||||
#include "mask.h"
|
||||
|
||||
STATIC_IN_RELEASE int Mask_writeFormatInformation(int width, unsigned char *frame, int mask, QRecLevel level)
|
||||
{
|
||||
unsigned int format;
|
||||
unsigned char v;
|
||||
int i;
|
||||
int blacks = 0;
|
||||
|
||||
format = QRspec_getFormatInfo(mask, level);
|
||||
|
||||
for(i = 0; i < 8; i++) {
|
||||
if(format & 1) {
|
||||
blacks += 2;
|
||||
v = 0x85;
|
||||
} else {
|
||||
v = 0x84;
|
||||
}
|
||||
frame[width * 8 + width - 1 - i] = v;
|
||||
if(i < 6) {
|
||||
frame[width * i + 8] = v;
|
||||
} else {
|
||||
frame[width * (i + 1) + 8] = v;
|
||||
}
|
||||
format= format >> 1;
|
||||
}
|
||||
for(i = 0; i < 7; i++) {
|
||||
if(format & 1) {
|
||||
blacks += 2;
|
||||
v = 0x85;
|
||||
} else {
|
||||
v = 0x84;
|
||||
}
|
||||
frame[width * (width - 7 + i) + 8] = v;
|
||||
if(i == 0) {
|
||||
frame[width * 8 + 7] = v;
|
||||
} else {
|
||||
frame[width * 8 + 6 - i] = v;
|
||||
}
|
||||
format= format >> 1;
|
||||
}
|
||||
|
||||
return blacks;
|
||||
}
|
||||
|
||||
/**
|
||||
* Demerit coefficients.
|
||||
* See Section 8.8.2, pp.45, JIS X0510:2004.
|
||||
*/
|
||||
#define N1 (3)
|
||||
#define N2 (3)
|
||||
#define N3 (40)
|
||||
#define N4 (10)
|
||||
|
||||
#define MASKMAKER(__exp__) \
|
||||
int x, y;\
|
||||
int b = 0;\
|
||||
\
|
||||
for(y = 0; y < width; y++) {\
|
||||
for(x = 0; x < width; x++) {\
|
||||
if(*s & 0x80) {\
|
||||
*d = *s;\
|
||||
} else {\
|
||||
*d = *s ^ ((__exp__) == 0);\
|
||||
}\
|
||||
b += (int)(*d & 1);\
|
||||
s++; d++;\
|
||||
}\
|
||||
}\
|
||||
return b;
|
||||
|
||||
static int Mask_mask0(int width, const unsigned char *s, unsigned char *d)
|
||||
{
|
||||
MASKMAKER((x+y)&1)
|
||||
}
|
||||
|
||||
static int Mask_mask1(int width, const unsigned char *s, unsigned char *d)
|
||||
{
|
||||
MASKMAKER(y&1)
|
||||
}
|
||||
|
||||
static int Mask_mask2(int width, const unsigned char *s, unsigned char *d)
|
||||
{
|
||||
MASKMAKER(x%3)
|
||||
}
|
||||
|
||||
static int Mask_mask3(int width, const unsigned char *s, unsigned char *d)
|
||||
{
|
||||
MASKMAKER((x+y)%3)
|
||||
}
|
||||
|
||||
static int Mask_mask4(int width, const unsigned char *s, unsigned char *d)
|
||||
{
|
||||
MASKMAKER(((y/2)+(x/3))&1)
|
||||
}
|
||||
|
||||
static int Mask_mask5(int width, const unsigned char *s, unsigned char *d)
|
||||
{
|
||||
MASKMAKER(((x*y)&1)+(x*y)%3)
|
||||
}
|
||||
|
||||
static int Mask_mask6(int width, const unsigned char *s, unsigned char *d)
|
||||
{
|
||||
MASKMAKER((((x*y)&1)+(x*y)%3)&1)
|
||||
}
|
||||
|
||||
static int Mask_mask7(int width, const unsigned char *s, unsigned char *d)
|
||||
{
|
||||
MASKMAKER((((x*y)%3)+((x+y)&1))&1)
|
||||
}
|
||||
|
||||
#define maskNum (8)
|
||||
typedef int MaskMaker(int, const unsigned char *, unsigned char *);
|
||||
static MaskMaker *maskMakers[maskNum] = {
|
||||
Mask_mask0, Mask_mask1, Mask_mask2, Mask_mask3,
|
||||
Mask_mask4, Mask_mask5, Mask_mask6, Mask_mask7
|
||||
};
|
||||
|
||||
#ifdef WITH_TESTS
|
||||
unsigned char *Mask_makeMaskedFrame(int width, unsigned char *frame, int mask)
|
||||
{
|
||||
unsigned char *masked;
|
||||
|
||||
masked = (unsigned char *)TKMEM_ALLOC((size_t)(width * width));
|
||||
if(masked == NULL) return NULL;
|
||||
|
||||
maskMakers[mask](width, frame, masked);
|
||||
|
||||
return masked;
|
||||
}
|
||||
#endif
|
||||
|
||||
unsigned char *Mask_makeMask(int width, unsigned char *frame, int mask, QRecLevel level)
|
||||
{
|
||||
unsigned char *masked;
|
||||
|
||||
if(mask < 0 || mask >= maskNum) {
|
||||
return NULL;
|
||||
}
|
||||
|
||||
masked = (unsigned char *)TKMEM_ALLOC((size_t)(width * width));
|
||||
if(masked == NULL) return NULL;
|
||||
|
||||
maskMakers[mask](width, frame, masked);
|
||||
Mask_writeFormatInformation(width, masked, mask, level);
|
||||
|
||||
return masked;
|
||||
}
|
||||
|
||||
|
||||
//static int n1;
|
||||
//static int n2;
|
||||
//static int n3;
|
||||
//static int n4;
|
||||
|
||||
STATIC_IN_RELEASE int Mask_calcN1N3(int length, int *runLength)
|
||||
{
|
||||
int i;
|
||||
int demerit = 0;
|
||||
int fact;
|
||||
|
||||
for(i = 0; i < length; i++) {
|
||||
if(runLength[i] >= 5) {
|
||||
demerit += N1 + (runLength[i] - 5);
|
||||
//n1 += N1 + (runLength[i] - 5);
|
||||
}
|
||||
if((i & 1)) {
|
||||
if(i >= 3 && i < length-2 && (runLength[i] % 3) == 0) {
|
||||
fact = runLength[i] / 3;
|
||||
if(runLength[i-2] == fact &&
|
||||
runLength[i-1] == fact &&
|
||||
runLength[i+1] == fact &&
|
||||
runLength[i+2] == fact) {
|
||||
if(i == 3 || runLength[i-3] >= 4 * fact) {
|
||||
demerit += N3;
|
||||
//n3 += N3;
|
||||
} else if(i+4 >= length || runLength[i+3] >= 4 * fact) {
|
||||
demerit += N3;
|
||||
//n3 += N3;
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
return demerit;
|
||||
}
|
||||
|
||||
STATIC_IN_RELEASE int Mask_calcN2(int width, unsigned char *frame)
|
||||
{
|
||||
int x, y;
|
||||
unsigned char *p;
|
||||
unsigned char b22, w22;
|
||||
int demerit = 0;
|
||||
|
||||
p = frame + width + 1;
|
||||
for(y = 1; y < width; y++) {
|
||||
for(x = 1; x < width; x++) {
|
||||
b22 = p[0] & p[-1] & p[-width] & p [-width-1];
|
||||
w22 = p[0] | p[-1] | p[-width] | p [-width-1];
|
||||
if((b22 | (w22 ^ 1))&1) {
|
||||
demerit += N2;
|
||||
}
|
||||
p++;
|
||||
}
|
||||
p++;
|
||||
}
|
||||
|
||||
return demerit;
|
||||
}
|
||||
|
||||
STATIC_IN_RELEASE int Mask_calcRunLengthH(int width, unsigned char *frame, int *runLength)
|
||||
{
|
||||
int head;
|
||||
int i;
|
||||
unsigned char prev;
|
||||
|
||||
if(frame[0] & 1) {
|
||||
runLength[0] = -1;
|
||||
head = 1;
|
||||
} else {
|
||||
head = 0;
|
||||
}
|
||||
runLength[head] = 1;
|
||||
prev = frame[0];
|
||||
|
||||
for(i = 1; i < width; i++) {
|
||||
if((frame[i] ^ prev) & 1) {
|
||||
head++;
|
||||
runLength[head] = 1;
|
||||
prev = frame[i];
|
||||
} else {
|
||||
runLength[head]++;
|
||||
}
|
||||
}
|
||||
|
||||
return head + 1;
|
||||
}
|
||||
|
||||
STATIC_IN_RELEASE int Mask_calcRunLengthV(int width, unsigned char *frame, int *runLength)
|
||||
{
|
||||
int head;
|
||||
int i;
|
||||
unsigned char prev;
|
||||
|
||||
if(frame[0] & 1) {
|
||||
runLength[0] = -1;
|
||||
head = 1;
|
||||
} else {
|
||||
head = 0;
|
||||
}
|
||||
runLength[head] = 1;
|
||||
prev = frame[0];
|
||||
|
||||
for(i = 1; i < width; i++) {
|
||||
if((frame[i * width] ^ prev) & 1) {
|
||||
head++;
|
||||
runLength[head] = 1;
|
||||
prev = frame[i * width];
|
||||
} else {
|
||||
runLength[head]++;
|
||||
}
|
||||
}
|
||||
|
||||
return head + 1;
|
||||
}
|
||||
|
||||
STATIC_IN_RELEASE int Mask_evaluateSymbol(int width, unsigned char *frame)
|
||||
{
|
||||
int x, y;
|
||||
int demerit = 0;
|
||||
int runLength[QRSPEC_WIDTH_MAX + 1];
|
||||
int length;
|
||||
|
||||
demerit += Mask_calcN2(width, frame);
|
||||
|
||||
for(y = 0; y < width; y++) {
|
||||
length = Mask_calcRunLengthH(width, frame + y * width, runLength);
|
||||
demerit += Mask_calcN1N3(length, runLength);
|
||||
}
|
||||
|
||||
for(x = 0; x < width; x++) {
|
||||
length = Mask_calcRunLengthV(width, frame + x, runLength);
|
||||
demerit += Mask_calcN1N3(length, runLength);
|
||||
}
|
||||
|
||||
return demerit;
|
||||
}
|
||||
|
||||
unsigned char *Mask_mask(int width, unsigned char *frame, QRecLevel level)
|
||||
{
|
||||
int i;
|
||||
unsigned char *mask, *bestMask;
|
||||
int minDemerit = INT_MAX;
|
||||
int blacks;
|
||||
int bratio;
|
||||
int demerit;
|
||||
int w2 = width * width;
|
||||
|
||||
mask = (unsigned char *)TKMEM_ALLOC((size_t)w2);
|
||||
if(mask == NULL) return NULL;
|
||||
bestMask = (unsigned char *)TKMEM_ALLOC((size_t)w2);
|
||||
if(bestMask == NULL) {
|
||||
tk_free(mask);
|
||||
return NULL;
|
||||
}
|
||||
|
||||
for(i = 0; i < maskNum; i++) {
|
||||
// n1 = n2 = n3 = n4 = 0;
|
||||
demerit = 0;
|
||||
blacks = maskMakers[i](width, frame, mask);
|
||||
blacks += Mask_writeFormatInformation(width, mask, i, level);
|
||||
bratio = (200 * blacks + w2) / w2 / 2; /* (int)(100*blacks/w2+0.5) */
|
||||
demerit = (abs(bratio - 50) / 5) * N4;
|
||||
// n4 = demerit;
|
||||
demerit += Mask_evaluateSymbol(width, mask);
|
||||
// printf("(%d,%d,%d,%d)=%d\n", n1, n2, n3 ,n4, demerit);
|
||||
if(demerit < minDemerit) {
|
||||
minDemerit = demerit;
|
||||
memcpy(bestMask, mask, (size_t)w2);
|
||||
}
|
||||
}
|
||||
tk_free(mask);
|
||||
return bestMask;
|
||||
}
|
@ -0,0 +1,38 @@
|
||||
/*
|
||||
* qrencode - QR Code encoder
|
||||
*
|
||||
* Masking.
|
||||
* Copyright (C) 2006-2017 Kentaro Fukuchi <kentaro@fukuchi.org>
|
||||
*
|
||||
* This library is free software; you can redistribute it and/or
|
||||
* modify it under the terms of the GNU Lesser General Public
|
||||
* License as published by the Free Software Foundation; either
|
||||
* version 2.1 of the License, or any later version.
|
||||
*
|
||||
* This library is distributed in the hope that it will be useful,
|
||||
* but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
|
||||
* Lesser General Public License for more details.
|
||||
*
|
||||
* You should have received a copy of the GNU Lesser General Public
|
||||
* License along with this library; if not, write to the Free Software
|
||||
* Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA
|
||||
*/
|
||||
|
||||
#ifndef MASK_H
|
||||
#define MASK_H
|
||||
|
||||
extern unsigned char *Mask_makeMask(int width, unsigned char *frame, int mask, QRecLevel level);
|
||||
extern unsigned char *Mask_mask(int width, unsigned char *frame, QRecLevel level);
|
||||
|
||||
#ifdef WITH_TESTS
|
||||
extern int Mask_calcN2(int width, unsigned char *frame);
|
||||
extern int Mask_calcN1N3(int length, int *runLength);
|
||||
extern int Mask_calcRunLengthH(int width, unsigned char *frame, int *runLength);
|
||||
extern int Mask_calcRunLengthV(int width, unsigned char *frame, int *runLength);
|
||||
extern int Mask_evaluateSymbol(int width, unsigned char *frame);
|
||||
extern int Mask_writeFormatInformation(int width, unsigned char *frame, int mask, QRecLevel level);
|
||||
extern unsigned char *Mask_makeMaskedFrame(int width, unsigned char *frame, int mask);
|
||||
#endif
|
||||
|
||||
#endif /* MASK_H */
|
@ -0,0 +1,174 @@
|
||||
/*
|
||||
* qrencode - QR Code encoder
|
||||
*
|
||||
* Masking for Micro QR Code.
|
||||
* Copyright (C) 2006-2017 Kentaro Fukuchi <kentaro@fukuchi.org>
|
||||
*
|
||||
* This library is free software; you can redistribute it and/or
|
||||
* modify it under the terms of the GNU Lesser General Public
|
||||
* License as published by the Free Software Foundation; either
|
||||
* version 2.1 of the License, or any later version.
|
||||
*
|
||||
* This library is distributed in the hope that it will be useful,
|
||||
* but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
|
||||
* Lesser General Public License for more details.
|
||||
*
|
||||
* You should have received a copy of the GNU Lesser General Public
|
||||
* License along with this library; if not, write to the Free Software
|
||||
* Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA
|
||||
*/
|
||||
|
||||
# include "config.h"
|
||||
#include <stdlib.h>
|
||||
#include <string.h>
|
||||
#include <limits.h>
|
||||
#include <errno.h>
|
||||
|
||||
#include "qrencode.h"
|
||||
#include "mqrspec.h"
|
||||
#include "mmask.h"
|
||||
|
||||
STATIC_IN_RELEASE void MMask_writeFormatInformation(int version, int width, unsigned char *frame, int mask, QRecLevel level)
|
||||
{
|
||||
unsigned int format;
|
||||
unsigned char v;
|
||||
int i;
|
||||
|
||||
format = MQRspec_getFormatInfo(mask, version, level);
|
||||
|
||||
for(i = 0; i < 8; i++) {
|
||||
v = 0x84 | (format & 1);
|
||||
frame[width * (i + 1) + 8] = v;
|
||||
format = format >> 1;
|
||||
}
|
||||
for(i = 0; i < 7; i++) {
|
||||
v = 0x84 | (format & 1);
|
||||
frame[width * 8 + 7 - i] = v;
|
||||
format = format >> 1;
|
||||
}
|
||||
}
|
||||
|
||||
#define MASKMAKER(__exp__) \
|
||||
int x, y;\
|
||||
\
|
||||
for(y = 0; y < width; y++) {\
|
||||
for(x = 0; x < width; x++) {\
|
||||
if(*s & 0x80) {\
|
||||
*d = *s;\
|
||||
} else {\
|
||||
*d = *s ^ ((__exp__) == 0);\
|
||||
}\
|
||||
s++; d++;\
|
||||
}\
|
||||
}
|
||||
|
||||
static void Mask_mask0(int width, const unsigned char *s, unsigned char *d)
|
||||
{
|
||||
MASKMAKER(y&1)
|
||||
}
|
||||
|
||||
static void Mask_mask1(int width, const unsigned char *s, unsigned char *d)
|
||||
{
|
||||
MASKMAKER(((y/2)+(x/3))&1)
|
||||
}
|
||||
|
||||
static void Mask_mask2(int width, const unsigned char *s, unsigned char *d)
|
||||
{
|
||||
MASKMAKER((((x*y)&1)+(x*y)%3)&1)
|
||||
}
|
||||
|
||||
static void Mask_mask3(int width, const unsigned char *s, unsigned char *d)
|
||||
{
|
||||
MASKMAKER((((x+y)&1)+((x*y)%3))&1)
|
||||
}
|
||||
|
||||
#define maskNum (4)
|
||||
typedef void MaskMaker(int, const unsigned char *, unsigned char *);
|
||||
static MaskMaker *maskMakers[maskNum] = {
|
||||
Mask_mask0, Mask_mask1, Mask_mask2, Mask_mask3
|
||||
};
|
||||
|
||||
#ifdef WITH_TESTS
|
||||
unsigned char *MMask_makeMaskedFrame(int width, unsigned char *frame, int mask)
|
||||
{
|
||||
unsigned char *masked;
|
||||
|
||||
masked = (unsigned char *)TKMEM_ALLOC((size_t)(width * width));
|
||||
if(masked == NULL) return NULL;
|
||||
|
||||
maskMakers[mask](width, frame, masked);
|
||||
|
||||
return masked;
|
||||
}
|
||||
#endif
|
||||
|
||||
unsigned char *MMask_makeMask(int version, unsigned char *frame, int mask, QRecLevel level)
|
||||
{
|
||||
unsigned char *masked;
|
||||
int width;
|
||||
|
||||
if(mask < 0 || mask >= maskNum) {
|
||||
return NULL;
|
||||
}
|
||||
|
||||
width = MQRspec_getWidth(version);
|
||||
masked = (unsigned char *)TKMEM_ALLOC((size_t)(width * width));
|
||||
if(masked == NULL) return NULL;
|
||||
|
||||
maskMakers[mask](width, frame, masked);
|
||||
MMask_writeFormatInformation(version, width, masked, mask, level);
|
||||
|
||||
return masked;
|
||||
}
|
||||
|
||||
STATIC_IN_RELEASE int MMask_evaluateSymbol(int width, unsigned char *frame)
|
||||
{
|
||||
int x, y;
|
||||
unsigned char *p;
|
||||
int sum1 = 0, sum2 = 0;
|
||||
|
||||
p = frame + width * (width - 1);
|
||||
for(x = 1; x < width; x++) {
|
||||
sum1 += (p[x] & 1);
|
||||
}
|
||||
|
||||
p = frame + width * 2 - 1;
|
||||
for(y = 1; y < width; y++) {
|
||||
sum2 += (*p & 1);
|
||||
p += width;
|
||||
}
|
||||
|
||||
return (sum1 <= sum2)?(sum1 * 16 + sum2):(sum2 * 16 + sum1);
|
||||
}
|
||||
|
||||
unsigned char *MMask_mask(int version, unsigned char *frame, QRecLevel level)
|
||||
{
|
||||
int i;
|
||||
unsigned char *mask, *bestMask;
|
||||
int maxScore = 0;
|
||||
int score;
|
||||
int width;
|
||||
|
||||
width = MQRspec_getWidth(version);
|
||||
|
||||
mask = (unsigned char *)TKMEM_ALLOC((size_t)(width * width));
|
||||
if(mask == NULL) return NULL;
|
||||
bestMask = NULL;
|
||||
|
||||
for(i = 0; i < maskNum; i++) {
|
||||
score = 0;
|
||||
maskMakers[i](width, frame, mask);
|
||||
MMask_writeFormatInformation(version, width, mask, i, level);
|
||||
score = MMask_evaluateSymbol(width, mask);
|
||||
if(score > maxScore) {
|
||||
maxScore = score;
|
||||
tk_free(bestMask);
|
||||
bestMask = mask;
|
||||
mask = (unsigned char *)TKMEM_ALLOC((size_t)(width * width));
|
||||
if(mask == NULL) break;
|
||||
}
|
||||
}
|
||||
tk_free(mask);
|
||||
return bestMask;
|
||||
}
|
@ -0,0 +1,34 @@
|
||||
/*
|
||||
* qrencode - QR Code encoder
|
||||
*
|
||||
* Masking for Micro QR Code.
|
||||
* Copyright (C) 2006-2017 Kentaro Fukuchi <kentaro@fukuchi.org>
|
||||
*
|
||||
* This library is free software; you can redistribute it and/or
|
||||
* modify it under the terms of the GNU Lesser General Public
|
||||
* License as published by the Free Software Foundation; either
|
||||
* version 2.1 of the License, or any later version.
|
||||
*
|
||||
* This library is distributed in the hope that it will be useful,
|
||||
* but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
|
||||
* Lesser General Public License for more details.
|
||||
*
|
||||
* You should have received a copy of the GNU Lesser General Public
|
||||
* License along with this library; if not, write to the Free Software
|
||||
* Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA
|
||||
*/
|
||||
|
||||
#ifndef MMASK_H
|
||||
#define MMASK_H
|
||||
|
||||
extern unsigned char *MMask_makeMask(int version, unsigned char *frame, int mask, QRecLevel level);
|
||||
extern unsigned char *MMask_mask(int version, unsigned char *frame, QRecLevel level);
|
||||
|
||||
#ifdef WITH_TESTS
|
||||
extern int MMask_evaluateSymbol(int width, unsigned char *frame);
|
||||
extern void MMask_writeFormatInformation(int version, int width, unsigned char *frame, int mask, QRecLevel level);
|
||||
extern unsigned char *MMask_makeMaskedFrame(int width, unsigned char *frame, int mask);
|
||||
#endif
|
||||
|
||||
#endif /* MMASK_H */
|
@ -0,0 +1,230 @@
|
||||
/*
|
||||
* qrencode - QR Code encoder
|
||||
*
|
||||
* Micro QR Code specification in convenient format.
|
||||
* Copyright (C) 2006-2017 Kentaro Fukuchi <kentaro@fukuchi.org>
|
||||
*
|
||||
* The following data / specifications are taken from
|
||||
* "Two dimensional symbol -- QR-code -- Basic Specification" (JIS X0510:2004)
|
||||
* or
|
||||
* "Automatic identification and data capture techniques --
|
||||
* QR Code 2005 bar code symbology specification" (ISO/IEC 18004:2006)
|
||||
*
|
||||
* This library is free software; you can redistribute it and/or
|
||||
* modify it under the terms of the GNU Lesser General Public
|
||||
* License as published by the Free Software Foundation; either
|
||||
* version 2.1 of the License, or any later version.
|
||||
*
|
||||
* This library is distributed in the hope that it will be useful,
|
||||
* but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
|
||||
* Lesser General Public License for more details.
|
||||
*
|
||||
* You should have received a copy of the GNU Lesser General Public
|
||||
* License along with this library; if not, write to the Free Software
|
||||
* Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA
|
||||
*/
|
||||
|
||||
# include "config.h"
|
||||
#include <stdio.h>
|
||||
#include <stdlib.h>
|
||||
#include <string.h>
|
||||
#include <errno.h>
|
||||
|
||||
#include "mqrspec.h"
|
||||
|
||||
/******************************************************************************
|
||||
* Version and capacity
|
||||
*****************************************************************************/
|
||||
|
||||
typedef struct {
|
||||
int width; ///< Edge length of the symbol
|
||||
int ec[4]; ///< Number of ECC code (bytes)
|
||||
} MQRspec_Capacity;
|
||||
|
||||
/**
|
||||
* Table of the capacity of symbols
|
||||
* See Table 1 (pp.106) and Table 8 (pp.113) of Appendix 1, JIS X0510:2004.
|
||||
*/
|
||||
static const MQRspec_Capacity mqrspecCapacity[MQRSPEC_VERSION_MAX + 1] = {
|
||||
{ 0, {0, 0, 0, 0}},
|
||||
{ 11, {2, 0, 0, 0}},
|
||||
{ 13, {5, 6, 0, 0}},
|
||||
{ 15, {6, 8, 0, 0}},
|
||||
{ 17, {8, 10, 14, 0}}
|
||||
};
|
||||
|
||||
int MQRspec_getDataLengthBit(int version, QRecLevel level)
|
||||
{
|
||||
int w;
|
||||
int ecc;
|
||||
|
||||
w = mqrspecCapacity[version].width - 1;
|
||||
ecc = mqrspecCapacity[version].ec[level];
|
||||
if(ecc == 0) return 0;
|
||||
return w * w - 64 - ecc * 8;
|
||||
}
|
||||
|
||||
int MQRspec_getDataLength(int version, QRecLevel level)
|
||||
{
|
||||
return (MQRspec_getDataLengthBit(version, level) + 4) / 8;
|
||||
}
|
||||
|
||||
int MQRspec_getECCLength(int version, QRecLevel level)
|
||||
{
|
||||
return mqrspecCapacity[version].ec[level];
|
||||
}
|
||||
|
||||
int MQRspec_getWidth(int version)
|
||||
{
|
||||
return mqrspecCapacity[version].width;
|
||||
}
|
||||
|
||||
/******************************************************************************
|
||||
* Length indicator
|
||||
*****************************************************************************/
|
||||
|
||||
/**
|
||||
* See Table 3 (pp.107) of Appendix 1, JIS X0510:2004.
|
||||
*/
|
||||
static const int lengthTableBits[4][4] = {
|
||||
{ 3, 4, 5, 6},
|
||||
{ 0, 3, 4, 5},
|
||||
{ 0, 0, 4, 5},
|
||||
{ 0, 0, 3, 4}
|
||||
};
|
||||
|
||||
int MQRspec_lengthIndicator(QRencodeMode mode, int version)
|
||||
{
|
||||
return lengthTableBits[mode][version - 1];
|
||||
}
|
||||
|
||||
int MQRspec_maximumWords(QRencodeMode mode, int version)
|
||||
{
|
||||
int bits;
|
||||
int words;
|
||||
|
||||
bits = lengthTableBits[mode][version - 1];
|
||||
words = (1 << bits) - 1;
|
||||
if(mode == QR_MODE_KANJI) {
|
||||
words *= 2; // the number of bytes is required
|
||||
}
|
||||
|
||||
return words;
|
||||
}
|
||||
|
||||
/******************************************************************************
|
||||
* Format information
|
||||
*****************************************************************************/
|
||||
|
||||
/* See calcFormatInfo in tests/test_mqrspec.c */
|
||||
static const unsigned int formatInfo[4][8] = {
|
||||
{0x4445, 0x55ae, 0x6793, 0x7678, 0x06de, 0x1735, 0x2508, 0x34e3},
|
||||
{0x4172, 0x5099, 0x62a4, 0x734f, 0x03e9, 0x1202, 0x203f, 0x31d4},
|
||||
{0x4e2b, 0x5fc0, 0x6dfd, 0x7c16, 0x0cb0, 0x1d5b, 0x2f66, 0x3e8d},
|
||||
{0x4b1c, 0x5af7, 0x68ca, 0x7921, 0x0987, 0x186c, 0x2a51, 0x3bba}
|
||||
};
|
||||
|
||||
/* See Table 10 of Appendix 1. (pp.115) */
|
||||
static const int typeTable[MQRSPEC_VERSION_MAX + 1][3] = {
|
||||
{-1, -1, -1},
|
||||
{ 0, -1, -1},
|
||||
{ 1, 2, -1},
|
||||
{ 3, 4, -1},
|
||||
{ 5, 6, 7}
|
||||
};
|
||||
|
||||
unsigned int MQRspec_getFormatInfo(int mask, int version, QRecLevel level)
|
||||
{
|
||||
int type;
|
||||
|
||||
if(mask < 0 || mask > 3) return 0;
|
||||
if(version <= 0 || version > MQRSPEC_VERSION_MAX) return 0;
|
||||
if(level == QR_ECLEVEL_H) return 0;
|
||||
type = typeTable[version][level];
|
||||
if(type < 0) return 0;
|
||||
|
||||
return formatInfo[mask][type];
|
||||
}
|
||||
|
||||
/******************************************************************************
|
||||
* Frame
|
||||
*****************************************************************************/
|
||||
|
||||
/**
|
||||
* Put a finder pattern.
|
||||
* @param frame
|
||||
* @param width
|
||||
* @param ox,oy upper-left coordinate of the pattern
|
||||
*/
|
||||
static void putFinderPattern(unsigned char *frame, int width, int ox, int oy)
|
||||
{
|
||||
static const unsigned char finder[] = {
|
||||
0xc1, 0xc1, 0xc1, 0xc1, 0xc1, 0xc1, 0xc1,
|
||||
0xc1, 0xc0, 0xc0, 0xc0, 0xc0, 0xc0, 0xc1,
|
||||
0xc1, 0xc0, 0xc1, 0xc1, 0xc1, 0xc0, 0xc1,
|
||||
0xc1, 0xc0, 0xc1, 0xc1, 0xc1, 0xc0, 0xc1,
|
||||
0xc1, 0xc0, 0xc1, 0xc1, 0xc1, 0xc0, 0xc1,
|
||||
0xc1, 0xc0, 0xc0, 0xc0, 0xc0, 0xc0, 0xc1,
|
||||
0xc1, 0xc1, 0xc1, 0xc1, 0xc1, 0xc1, 0xc1,
|
||||
};
|
||||
int x, y;
|
||||
const unsigned char *s;
|
||||
|
||||
frame += oy * width + ox;
|
||||
s = finder;
|
||||
for(y = 0; y < 7; y++) {
|
||||
for(x = 0; x < 7; x++) {
|
||||
frame[x] = s[x];
|
||||
}
|
||||
frame += width;
|
||||
s += 7;
|
||||
}
|
||||
}
|
||||
|
||||
static unsigned char *MQRspec_createFrame(int version)
|
||||
{
|
||||
unsigned char *frame, *p, *q;
|
||||
int width;
|
||||
int x, y;
|
||||
|
||||
width = mqrspecCapacity[version].width;
|
||||
frame = (unsigned char *)TKMEM_ALLOC((size_t)(width * width));
|
||||
if(frame == NULL) return NULL;
|
||||
|
||||
memset(frame, 0, (size_t)(width * width));
|
||||
/* Finder pattern */
|
||||
putFinderPattern(frame, width, 0, 0);
|
||||
/* Separator */
|
||||
p = frame;
|
||||
for(y = 0; y < 7; y++) {
|
||||
p[7] = 0xc0;
|
||||
p += width;
|
||||
}
|
||||
memset(frame + width * 7, 0xc0, 8);
|
||||
/* Mask format information area */
|
||||
memset(frame + width * 8 + 1, 0x84, 8);
|
||||
p = frame + width + 8;
|
||||
for(y = 0; y < 7; y++) {
|
||||
*p = 0x84;
|
||||
p += width;
|
||||
}
|
||||
/* Timing pattern */
|
||||
p = frame + 8;
|
||||
q = frame + width * 8;
|
||||
for(x = 1; x < width-7; x++) {
|
||||
*p = 0x90 | (x & 1);
|
||||
*q = 0x90 | (x & 1);
|
||||
p++;
|
||||
q += width;
|
||||
}
|
||||
|
||||
return frame;
|
||||
}
|
||||
|
||||
unsigned char *MQRspec_newFrame(int version)
|
||||
{
|
||||
if(version < 1 || version > MQRSPEC_VERSION_MAX) return NULL;
|
||||
|
||||
return MQRspec_createFrame(version);
|
||||
}
|
@ -0,0 +1,150 @@
|
||||
/*
|
||||
* qrencode - QR Code encoder
|
||||
*
|
||||
* Micro QR Code specification in convenient format.
|
||||
* Copyright (C) 2006-2017 Kentaro Fukuchi <kentaro@fukuchi.org>
|
||||
*
|
||||
* This library is free software; you can redistribute it and/or
|
||||
* modify it under the terms of the GNU Lesser General Public
|
||||
* License as published by the Free Software Foundation; either
|
||||
* version 2.1 of the License, or any later version.
|
||||
*
|
||||
* This library is distributed in the hope that it will be useful,
|
||||
* but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
|
||||
* Lesser General Public License for more details.
|
||||
*
|
||||
* You should have received a copy of the GNU Lesser General Public
|
||||
* License along with this library; if not, write to the Free Software
|
||||
* Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA
|
||||
*/
|
||||
|
||||
#ifndef MQRSPEC_H
|
||||
#define MQRSPEC_H
|
||||
|
||||
#include "qrencode.h"
|
||||
|
||||
/******************************************************************************
|
||||
* Version and capacity
|
||||
*****************************************************************************/
|
||||
|
||||
/**
|
||||
* Maximum width of a symbol
|
||||
*/
|
||||
#define MQRSPEC_WIDTH_MAX 17
|
||||
|
||||
/**
|
||||
* Return maximum data code length (bits) for the version.
|
||||
* @param version version of the symbol
|
||||
* @param level error correction level
|
||||
* @return maximum size (bits)
|
||||
*/
|
||||
extern int MQRspec_getDataLengthBit(int version, QRecLevel level);
|
||||
|
||||
/**
|
||||
* Return maximum data code length (bytes) for the version.
|
||||
* @param version version of the symbol
|
||||
* @param level error correction level
|
||||
* @return maximum size (bytes)
|
||||
*/
|
||||
extern int MQRspec_getDataLength(int version, QRecLevel level);
|
||||
|
||||
/**
|
||||
* Return maximum error correction code length (bytes) for the version.
|
||||
* @param version version of the symbol
|
||||
* @param level error correction level
|
||||
* @return ECC size (bytes)
|
||||
*/
|
||||
extern int MQRspec_getECCLength(int version, QRecLevel level);
|
||||
|
||||
/**
|
||||
* Return a version number that satisfies the input code length.
|
||||
* @param size input code length (byte)
|
||||
* @param level error correction level
|
||||
* @return version number
|
||||
*/
|
||||
extern int MQRspec_getMinimumVersion(int size, QRecLevel level);
|
||||
|
||||
/**
|
||||
* Return the width of the symbol for the version.
|
||||
* @param version version of the symbol
|
||||
* @return width
|
||||
*/
|
||||
extern int MQRspec_getWidth(int version);
|
||||
|
||||
/**
|
||||
* Return the numer of remainder bits.
|
||||
* @param version version of the symbol
|
||||
* @return number of remainder bits
|
||||
*/
|
||||
extern int MQRspec_getRemainder(int version);
|
||||
|
||||
/******************************************************************************
|
||||
* Length indicator
|
||||
*****************************************************************************/
|
||||
|
||||
/**
|
||||
* Return the size of length indicator for the mode and version.
|
||||
* @param mode encode mode
|
||||
* @param version vesion of the symbol
|
||||
* @return the size of the appropriate length indicator (bits).
|
||||
*/
|
||||
extern int MQRspec_lengthIndicator(QRencodeMode mode, int version);
|
||||
|
||||
/**
|
||||
* Return the maximum length for the mode and version.
|
||||
* @param mode encode mode
|
||||
* @param version vesion of the symbol
|
||||
* @return the maximum length (bytes)
|
||||
*/
|
||||
extern int MQRspec_maximumWords(QRencodeMode mode, int version);
|
||||
|
||||
/******************************************************************************
|
||||
* Version information pattern
|
||||
*****************************************************************************/
|
||||
|
||||
/**
|
||||
* Return BCH encoded version information pattern that is used for the symbol
|
||||
* of version 7 or greater. Use lower 18 bits.
|
||||
* @param version vesion of the symbol
|
||||
* @return BCH encoded version information pattern
|
||||
*/
|
||||
extern unsigned int MQRspec_getVersionPattern(int version);
|
||||
|
||||
/******************************************************************************
|
||||
* Format information
|
||||
*****************************************************************************/
|
||||
|
||||
/**
|
||||
* Return BCH encoded format information pattern.
|
||||
* @param mask mask number
|
||||
* @param version version of the symbol
|
||||
* @param level error correction level
|
||||
* @return BCH encoded format information pattern
|
||||
*/
|
||||
extern unsigned int MQRspec_getFormatInfo(int mask, int version, QRecLevel level);
|
||||
|
||||
/******************************************************************************
|
||||
* Frame
|
||||
*****************************************************************************/
|
||||
|
||||
/**
|
||||
* Return a copy of initialized frame.
|
||||
* @param version version of the symbol
|
||||
* @return Array of unsigned char. You can free it by free().
|
||||
*/
|
||||
extern unsigned char *MQRspec_newFrame(int version);
|
||||
|
||||
/******************************************************************************
|
||||
* Mode indicator
|
||||
*****************************************************************************/
|
||||
|
||||
/**
|
||||
* Mode indicator. See Table 2 in Appendix 1 of JIS X0510:2004, pp.107.
|
||||
*/
|
||||
#define MQRSPEC_MODEID_NUM 0
|
||||
#define MQRSPEC_MODEID_AN 1
|
||||
#define MQRSPEC_MODEID_8 2
|
||||
#define MQRSPEC_MODEID_KANJI 3
|
||||
|
||||
#endif /* MQRSPEC_H */
|
@ -0,0 +1,214 @@
|
||||
/**
|
||||
* File: qr.c
|
||||
* Author: AWTK Develop Team
|
||||
* Brief: 显示二维码的控件
|
||||
*
|
||||
* Copyright (c) 2020 - 2020 Guangzhou ZHIYUAN Electronics Co.,Ltd.
|
||||
*
|
||||
* This program is distributed in the hope that it will be useful,
|
||||
* but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
* License file for more details.
|
||||
*
|
||||
*/
|
||||
|
||||
/**
|
||||
* History:
|
||||
* ================================================================
|
||||
* 2020-06-01 Li XianJing <xianjimli@hotmail.com> created
|
||||
*
|
||||
*/
|
||||
|
||||
#include "tkc/mem.h"
|
||||
#include "tkc/utils.h"
|
||||
#include "base/widget_vtable.h"
|
||||
#include "base/window_manager.h"
|
||||
|
||||
#include "qr.h"
|
||||
|
||||
#define IMAGE_QR_MAX_RATIO 0.45f /* 贴图的面积和二维码的面积最大比例 */
|
||||
|
||||
static ret_t qr_ensure_qrcode(widget_t* widget);
|
||||
|
||||
ret_t qr_set_value(widget_t* widget, const char* value) {
|
||||
qr_t* qr = QR(widget);
|
||||
return_value_if_fail(qr != NULL, RET_BAD_PARAMS);
|
||||
|
||||
if (tk_str_eq(qr->value, value)) { return RET_OK; }
|
||||
qr->value = tk_str_copy(qr->value, value);
|
||||
|
||||
if (qr->qrcode != NULL) {
|
||||
QRcode_free(qr->qrcode);
|
||||
qr->qrcode = NULL;
|
||||
}
|
||||
|
||||
ret_t ret = qr_ensure_qrcode(widget);
|
||||
return (ret == RET_OK) ? widget_invalidate(widget, NULL) : RET_FAIL;
|
||||
}
|
||||
|
||||
static ret_t qr_get_prop(widget_t* widget, const char* name, value_t* v) {
|
||||
qr_t* qr = QR(widget);
|
||||
return_value_if_fail(qr != NULL && name != NULL && v != NULL, RET_BAD_PARAMS);
|
||||
|
||||
if (tk_str_eq(WIDGET_PROP_VALUE, name) || tk_str_eq(WIDGET_PROP_TEXT, name)) {
|
||||
value_set_str(v, qr->value);
|
||||
return RET_OK;
|
||||
}
|
||||
|
||||
return RET_NOT_FOUND;
|
||||
}
|
||||
|
||||
static ret_t qr_set_prop(widget_t* widget, const char* name, const value_t* v) {
|
||||
qr_t* qr = QR(widget);
|
||||
return_value_if_fail(widget != NULL && name != NULL && v != NULL, RET_BAD_PARAMS);
|
||||
|
||||
if (tk_str_eq(WIDGET_PROP_VALUE, name) || tk_str_eq(WIDGET_PROP_TEXT, name)) {
|
||||
qr_set_value(widget, value_str(v));
|
||||
|
||||
if (qr->qrcode != NULL) {
|
||||
QRcode_free(qr->qrcode);
|
||||
qr->qrcode = NULL;
|
||||
}
|
||||
|
||||
return RET_OK;
|
||||
}
|
||||
|
||||
return RET_NOT_FOUND;
|
||||
}
|
||||
|
||||
static ret_t qr_on_destroy(widget_t* widget) {
|
||||
qr_t* qr = QR(widget);
|
||||
return_value_if_fail(widget != NULL && qr != NULL, RET_BAD_PARAMS);
|
||||
|
||||
TKMEM_FREE(qr->value);
|
||||
if (qr->qrcode != NULL) {
|
||||
QRcode_free(qr->qrcode);
|
||||
qr->qrcode = NULL;
|
||||
}
|
||||
|
||||
return RET_OK;
|
||||
}
|
||||
|
||||
#define MIN_SIZE 21
|
||||
|
||||
static ret_t qr_ensure_qrcode(widget_t* widget) {
|
||||
qr_t* qr = QR(widget);
|
||||
int32_t size = tk_min(widget->w, widget->h) - 5;
|
||||
|
||||
if (size < MIN_SIZE) {
|
||||
return RET_FAIL;
|
||||
}
|
||||
|
||||
if (qr->qrcode != NULL) {
|
||||
return RET_OK;
|
||||
}
|
||||
|
||||
qr->qrcode = QRcode_encodeString(qr->value, 3, QR_ECLEVEL_H, QR_MODE_8, 1);
|
||||
|
||||
if (qr->qrcode != NULL) {
|
||||
return RET_OK;
|
||||
}
|
||||
|
||||
return RET_FAIL;
|
||||
}
|
||||
|
||||
static ret_t qr_paint_logo(widget_t* widget, canvas_t* c) {
|
||||
vgcanvas_t* vg = canvas_get_vgcanvas(c);
|
||||
const char* logo_name = NULL;
|
||||
bitmap_t logo = {0};
|
||||
return_value_if_fail(widget != NULL && vg != NULL, RET_BAD_PARAMS);
|
||||
|
||||
logo_name = style_get_str(widget->astyle, STYLE_ID_BG_IMAGE, NULL);
|
||||
|
||||
if (logo_name != NULL && widget_load_image(widget, logo_name, &logo) == RET_OK) {
|
||||
vgcanvas_translate(vg, c->ox + (widget->w - logo.w) / 2.0f,
|
||||
c->oy + (widget->h - logo.h) / 2.0f);
|
||||
vgcanvas_draw_image(vg, &logo, 0, 0, logo.w, logo.h, 0, 0, logo.w, logo.h);
|
||||
}
|
||||
return RET_OK;
|
||||
}
|
||||
|
||||
static ret_t qr_on_paint_self(widget_t* widget, canvas_t* c) {
|
||||
qr_t* qr = QR(widget);
|
||||
style_t* style = widget->astyle;
|
||||
|
||||
if (style != NULL) {
|
||||
color_t trans = color_init(0, 0, 0, 0);
|
||||
uint32_t margin = style_get_int(style, STYLE_ID_MARGIN, 2);
|
||||
color_t bg = style_get_color(style, STYLE_ID_BG_COLOR, trans);
|
||||
color_t fg = style_get_color(style, STYLE_ID_FG_COLOR, trans);
|
||||
|
||||
if (qr_ensure_qrcode(widget) == RET_OK) {
|
||||
rect_t r = { 0, 0, widget->w, widget->h };
|
||||
uint32_t w = 0;
|
||||
uint32_t h = 0;
|
||||
uint32_t i = 0;
|
||||
uint32_t j = 0;
|
||||
uint8_t* p = qr->qrcode->data;
|
||||
uint32_t size = qr->qrcode->width;
|
||||
uint32_t pix_size = (tk_min(widget->w, widget->h) - 2 * margin) / size;
|
||||
uint32_t x = (widget->w - pix_size * size) / 2;
|
||||
uint32_t y = (widget->h - pix_size * size) / 2;
|
||||
rect_t r_clip = rect_init(widget->x + ((1 - IMAGE_QR_MAX_RATIO) / 2.0f) * widget->w,
|
||||
widget->y + ((1 - IMAGE_QR_MAX_RATIO) / 2.0f) * widget->h,
|
||||
IMAGE_QR_MAX_RATIO * widget->w, IMAGE_QR_MAX_RATIO * widget->h);
|
||||
|
||||
return_value_if_fail(pix_size > 1, RET_BAD_PARAMS);
|
||||
|
||||
for (j = 0; j < size; j++) {
|
||||
x = (widget->w - pix_size * size) / 2;
|
||||
for (i = 0; i < size; i++) {
|
||||
if (*p & 0x01) {
|
||||
canvas_set_fill_color(c, fg);
|
||||
} else {
|
||||
canvas_set_fill_color(c, bg);
|
||||
}
|
||||
canvas_fill_rect(c, x, y, pix_size, pix_size);
|
||||
p++;
|
||||
x += pix_size;
|
||||
}
|
||||
y += pix_size;
|
||||
}
|
||||
|
||||
widget_paint_with_clip(widget, &r_clip, c, qr_paint_logo);
|
||||
}
|
||||
}
|
||||
|
||||
return RET_OK;
|
||||
}
|
||||
|
||||
static ret_t qr_on_event(widget_t* widget, event_t* e) {
|
||||
qr_t* qr = QR(widget);
|
||||
return_value_if_fail(widget != NULL && qr != NULL, RET_BAD_PARAMS);
|
||||
|
||||
(void)qr;
|
||||
|
||||
return RET_OK;
|
||||
}
|
||||
|
||||
const char* s_qr_properties[] = {WIDGET_PROP_VALUE, NULL};
|
||||
|
||||
TK_DECL_VTABLE(qr) = {.size = sizeof(qr_t),
|
||||
.type = WIDGET_TYPE_QR,
|
||||
.clone_properties = s_qr_properties,
|
||||
.persistent_properties = s_qr_properties,
|
||||
.parent = TK_PARENT_VTABLE(widget),
|
||||
.create = qr_create,
|
||||
.on_paint_self = qr_on_paint_self,
|
||||
.set_prop = qr_set_prop,
|
||||
.get_prop = qr_get_prop,
|
||||
.on_event = qr_on_event,
|
||||
.on_destroy = qr_on_destroy};
|
||||
|
||||
widget_t* qr_create(widget_t* parent, xy_t x, xy_t y, wh_t w, wh_t h) {
|
||||
widget_t* widget = widget_create(parent, TK_REF_VTABLE(qr), x, y, w, h);
|
||||
qr_t* qr = QR(widget);
|
||||
return_value_if_fail(qr != NULL, NULL);
|
||||
return widget;
|
||||
}
|
||||
|
||||
widget_t* qr_cast(widget_t* widget) {
|
||||
return_value_if_fail(WIDGET_IS_INSTANCE_OF(widget, qr), NULL);
|
||||
|
||||
return widget;
|
||||
}
|
@ -0,0 +1,115 @@
|
||||
/**
|
||||
* File: qr.h
|
||||
* Author: AWTK Develop Team
|
||||
* Brief: 显示二维码的控件
|
||||
*
|
||||
* Copyright (c) 2020 - 2020 Guangzhou ZHIYUAN Electronics Co.,Ltd.
|
||||
*
|
||||
* This program is distributed in the hope that it will be useful,
|
||||
* but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
* License file for more details.
|
||||
*
|
||||
*/
|
||||
|
||||
/**
|
||||
* History:
|
||||
* ================================================================
|
||||
* 2020-06-01 Li XianJing <xianjimli@hotmail.com> created
|
||||
*
|
||||
*/
|
||||
|
||||
#ifndef TK_QR_H
|
||||
#define TK_QR_H
|
||||
#include "qrencode.h"
|
||||
#include "base/widget.h"
|
||||
|
||||
BEGIN_C_DECLS
|
||||
/**
|
||||
* @class qr_t
|
||||
* @parent widget_t
|
||||
* @annotation ["scriptable","design","widget"]
|
||||
* 显示二维码的控件
|
||||
* qr\_t是[widget\_t](widget_t.md)的子类控件,widget\_t的函数均适用于qr\_t控件。
|
||||
*
|
||||
* 在xml中使用"qr"标签创建数值文本控件。如:
|
||||
*
|
||||
* ```xml
|
||||
* <!-- ui -->
|
||||
* <qr x="c" y="m" w="240" h="240" value="https://github.com/zlgopen/awtk"/>
|
||||
* ```
|
||||
* 在c代码中使用函数qr\_create创建数值文本控件。如:
|
||||
*
|
||||
* ```c
|
||||
* widget_t* qr = qr_create(win, 10, 10, 128, 128);
|
||||
* ```
|
||||
* 可用通过style来设置控件的显示风格,如字体的大小和颜色等等。如:
|
||||
*
|
||||
* ```xml
|
||||
* <!-- style -->
|
||||
* <qr>
|
||||
* <style name="default" >
|
||||
* <normal fg_color="black" bg_color="white" bg_image="message"/>
|
||||
* <disable fg_color="gray" bg_color="#f0f0f0"/>
|
||||
* </style>
|
||||
* </qr>
|
||||
* ```
|
||||
*/
|
||||
typedef struct _qr_t {
|
||||
widget_t widget;
|
||||
|
||||
/**
|
||||
* @property {char*} value
|
||||
* @annotation ["set_prop","get_prop","readable","persitent","design","scriptable"]
|
||||
* 要转成二维码的字符串。值。
|
||||
*/
|
||||
char* value;
|
||||
|
||||
/*private*/
|
||||
QRcode* qrcode;
|
||||
} qr_t;
|
||||
|
||||
/**
|
||||
* @method qr_create
|
||||
* @annotation ["constructor", "scriptable"]
|
||||
* 创建qr对象
|
||||
* @param {widget_t*} parent 父控件
|
||||
* @param {xy_t} x x坐标
|
||||
* @param {xy_t} y y坐标
|
||||
* @param {wh_t} w 宽度
|
||||
* @param {wh_t} h 高度
|
||||
*
|
||||
* @return {widget_t*} qr对象。
|
||||
*/
|
||||
widget_t* qr_create(widget_t* parent, xy_t x, xy_t y, wh_t w, wh_t h);
|
||||
|
||||
/**
|
||||
* @method qr_cast
|
||||
* 转换为qr对象(供脚本语言使用)。
|
||||
* @annotation ["cast", "scriptable"]
|
||||
* @param {widget_t*} widget qr对象。
|
||||
*
|
||||
* @return {widget_t*} qr对象。
|
||||
*/
|
||||
widget_t* qr_cast(widget_t* widget);
|
||||
|
||||
/**
|
||||
* @method qr_set_value
|
||||
* 设置要转成二维码的字符串。
|
||||
* @annotation ["scriptable"]
|
||||
* @param {widget_t*} widget widget对象。
|
||||
* @param {const char*} value 格式字符串。
|
||||
*
|
||||
* @return {ret_t} 返回RET_OK表示成功,否则表示失败。
|
||||
*/
|
||||
ret_t qr_set_value(widget_t* widget, const char* value);
|
||||
|
||||
#define WIDGET_TYPE_QR "qr"
|
||||
#define QR(widget) ((qr_t*)(qr_cast(WIDGET(widget))))
|
||||
|
||||
/*public for subclass and runtime type check*/
|
||||
TK_EXTERN_VTABLE(qr);
|
||||
|
||||
END_C_DECLS
|
||||
|
||||
#endif /*TK_QR_H*/
|
@ -0,0 +1,891 @@
|
||||
/*
|
||||
* qrencode - QR Code encoder
|
||||
*
|
||||
* Copyright (C) 2006-2017 Kentaro Fukuchi <kentaro@fukuchi.org>
|
||||
*
|
||||
* This library is free software; you can redistribute it and/or
|
||||
* modify it under the terms of the GNU Lesser General Public
|
||||
* License as published by the Free Software Foundation; either
|
||||
* version 2.1 of the License, or any later version.
|
||||
*
|
||||
* This library is distributed in the hope that it will be useful,
|
||||
* but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
|
||||
* Lesser General Public License for more details.
|
||||
*
|
||||
* You should have received a copy of the GNU Lesser General Public
|
||||
* License along with this library; if not, write to the Free Software
|
||||
* Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA
|
||||
*/
|
||||
|
||||
# include "config.h"
|
||||
#include <stdio.h>
|
||||
#include <stdlib.h>
|
||||
#include <string.h>
|
||||
#include <errno.h>
|
||||
|
||||
#include "qrencode.h"
|
||||
#include "qrspec.h"
|
||||
#include "mqrspec.h"
|
||||
#include "bitstream.h"
|
||||
#include "qrinput.h"
|
||||
#include "rsecc.h"
|
||||
#include "split.h"
|
||||
#include "mask.h"
|
||||
#include "mmask.h"
|
||||
|
||||
/******************************************************************************
|
||||
* Raw code
|
||||
*****************************************************************************/
|
||||
|
||||
typedef struct {
|
||||
int dataLength;
|
||||
int eccLength;
|
||||
unsigned char *data;
|
||||
unsigned char *ecc;
|
||||
} RSblock;
|
||||
|
||||
typedef struct {
|
||||
int version;
|
||||
int dataLength;
|
||||
int eccLength;
|
||||
unsigned char *datacode;
|
||||
unsigned char *ecccode;
|
||||
int b1;
|
||||
int blocks;
|
||||
RSblock *rsblock;
|
||||
int count;
|
||||
} QRRawCode;
|
||||
|
||||
static void RSblock_initBlock(RSblock *block, int dl, unsigned char *data, int el, unsigned char *ecc)
|
||||
{
|
||||
block->dataLength = dl;
|
||||
block->data = data;
|
||||
block->eccLength = el;
|
||||
block->ecc = ecc;
|
||||
|
||||
RSECC_encode((size_t)dl, (size_t)el, data, ecc);
|
||||
}
|
||||
|
||||
static int RSblock_init(RSblock *blocks, int spec[5], unsigned char *data, unsigned char *ecc)
|
||||
{
|
||||
int i;
|
||||
RSblock *block;
|
||||
unsigned char *dp, *ep;
|
||||
int el, dl;
|
||||
|
||||
dl = QRspec_rsDataCodes1(spec);
|
||||
el = QRspec_rsEccCodes1(spec);
|
||||
|
||||
block = blocks;
|
||||
dp = data;
|
||||
ep = ecc;
|
||||
for(i = 0; i < QRspec_rsBlockNum1(spec); i++) {
|
||||
RSblock_initBlock(block, dl, dp, el, ep);
|
||||
dp += dl;
|
||||
ep += el;
|
||||
block++;
|
||||
}
|
||||
|
||||
if(QRspec_rsBlockNum2(spec) == 0) return 0;
|
||||
|
||||
dl = QRspec_rsDataCodes2(spec);
|
||||
el = QRspec_rsEccCodes2(spec);
|
||||
for(i = 0; i < QRspec_rsBlockNum2(spec); i++) {
|
||||
RSblock_initBlock(block, dl, dp, el, ep);
|
||||
dp += dl;
|
||||
ep += el;
|
||||
block++;
|
||||
}
|
||||
|
||||
return 0;
|
||||
}
|
||||
|
||||
STATIC_IN_RELEASE void QRraw_free(QRRawCode *raw);
|
||||
STATIC_IN_RELEASE QRRawCode *QRraw_new(QRinput *input)
|
||||
{
|
||||
QRRawCode *raw;
|
||||
int spec[5], ret;
|
||||
|
||||
raw = (QRRawCode *)TKMEM_ALLOC(sizeof(QRRawCode));
|
||||
if(raw == NULL) return NULL;
|
||||
|
||||
raw->datacode = QRinput_getByteStream(input);
|
||||
if(raw->datacode == NULL) {
|
||||
tk_free(raw);
|
||||
return NULL;
|
||||
}
|
||||
|
||||
QRspec_getEccSpec(input->version, input->level, spec);
|
||||
|
||||
raw->version = input->version;
|
||||
raw->b1 = QRspec_rsBlockNum1(spec);
|
||||
raw->dataLength = QRspec_rsDataLength(spec);
|
||||
raw->eccLength = QRspec_rsEccLength(spec);
|
||||
raw->ecccode = (unsigned char *)TKMEM_ALLOC((size_t)raw->eccLength);
|
||||
if(raw->ecccode == NULL) {
|
||||
tk_free(raw->datacode);
|
||||
tk_free(raw);
|
||||
return NULL;
|
||||
}
|
||||
|
||||
raw->blocks = QRspec_rsBlockNum(spec);
|
||||
raw->rsblock = (RSblock *)TKMEM_CALLOC((size_t)(raw->blocks), sizeof(RSblock));
|
||||
if(raw->rsblock == NULL) {
|
||||
QRraw_free(raw);
|
||||
return NULL;
|
||||
}
|
||||
ret = RSblock_init(raw->rsblock, spec, raw->datacode, raw->ecccode);
|
||||
if(ret < 0) {
|
||||
QRraw_free(raw);
|
||||
return NULL;
|
||||
}
|
||||
|
||||
raw->count = 0;
|
||||
|
||||
return raw;
|
||||
}
|
||||
|
||||
/**
|
||||
* Return a code (byte).
|
||||
* This function can be called iteratively.
|
||||
* @param raw raw code.
|
||||
* @return code
|
||||
*/
|
||||
STATIC_IN_RELEASE unsigned char QRraw_getCode(QRRawCode *raw)
|
||||
{
|
||||
int col, row;
|
||||
unsigned char ret;
|
||||
|
||||
if(raw->count < raw->dataLength) {
|
||||
row = raw->count % raw->blocks;
|
||||
col = raw->count / raw->blocks;
|
||||
if(col >= raw->rsblock[0].dataLength) {
|
||||
row += raw->b1;
|
||||
}
|
||||
ret = raw->rsblock[row].data[col];
|
||||
} else if(raw->count < raw->dataLength + raw->eccLength) {
|
||||
row = (raw->count - raw->dataLength) % raw->blocks;
|
||||
col = (raw->count - raw->dataLength) / raw->blocks;
|
||||
ret = raw->rsblock[row].ecc[col];
|
||||
} else {
|
||||
return 0;
|
||||
}
|
||||
raw->count++;
|
||||
return ret;
|
||||
}
|
||||
|
||||
STATIC_IN_RELEASE void QRraw_free(QRRawCode *raw)
|
||||
{
|
||||
if(raw != NULL) {
|
||||
tk_free(raw->datacode);
|
||||
tk_free(raw->ecccode);
|
||||
tk_free(raw->rsblock);
|
||||
tk_free(raw);
|
||||
}
|
||||
}
|
||||
|
||||
/******************************************************************************
|
||||
* Raw code for Micro QR Code
|
||||
*****************************************************************************/
|
||||
|
||||
typedef struct {
|
||||
int version;
|
||||
int dataLength;
|
||||
int eccLength;
|
||||
unsigned char *datacode;
|
||||
unsigned char *ecccode;
|
||||
RSblock *rsblock;
|
||||
int oddbits;
|
||||
int count;
|
||||
} MQRRawCode;
|
||||
|
||||
STATIC_IN_RELEASE void MQRraw_free(MQRRawCode *raw);
|
||||
STATIC_IN_RELEASE MQRRawCode *MQRraw_new(QRinput *input)
|
||||
{
|
||||
MQRRawCode *raw;
|
||||
|
||||
raw = (MQRRawCode *)TKMEM_ALLOC(sizeof(MQRRawCode));
|
||||
if(raw == NULL) return NULL;
|
||||
|
||||
raw->version = input->version;
|
||||
raw->dataLength = MQRspec_getDataLength(input->version, input->level);
|
||||
raw->eccLength = MQRspec_getECCLength(input->version, input->level);
|
||||
raw->oddbits = raw->dataLength * 8 - MQRspec_getDataLengthBit(input->version, input->level);
|
||||
raw->datacode = QRinput_getByteStream(input);
|
||||
if(raw->datacode == NULL) {
|
||||
tk_free(raw);
|
||||
return NULL;
|
||||
}
|
||||
raw->ecccode = (unsigned char *)TKMEM_ALLOC((size_t)raw->eccLength);
|
||||
if(raw->ecccode == NULL) {
|
||||
tk_free(raw->datacode);
|
||||
tk_free(raw);
|
||||
return NULL;
|
||||
}
|
||||
|
||||
raw->rsblock = (RSblock *)TKMEM_CALLOC(1, sizeof(RSblock));
|
||||
if(raw->rsblock == NULL) {
|
||||
MQRraw_free(raw);
|
||||
return NULL;
|
||||
}
|
||||
|
||||
RSblock_initBlock(raw->rsblock, raw->dataLength, raw->datacode, raw->eccLength, raw->ecccode);
|
||||
|
||||
raw->count = 0;
|
||||
|
||||
return raw;
|
||||
}
|
||||
|
||||
/**
|
||||
* Return a code (byte).
|
||||
* This function can be called iteratively.
|
||||
* @param raw raw code.
|
||||
* @return code
|
||||
*/
|
||||
STATIC_IN_RELEASE unsigned char MQRraw_getCode(MQRRawCode *raw)
|
||||
{
|
||||
unsigned char ret;
|
||||
|
||||
if(raw->count < raw->dataLength) {
|
||||
ret = raw->datacode[raw->count];
|
||||
} else if(raw->count < raw->dataLength + raw->eccLength) {
|
||||
ret = raw->ecccode[raw->count - raw->dataLength];
|
||||
} else {
|
||||
return 0;
|
||||
}
|
||||
raw->count++;
|
||||
return ret;
|
||||
}
|
||||
|
||||
STATIC_IN_RELEASE void MQRraw_free(MQRRawCode *raw)
|
||||
{
|
||||
if(raw != NULL) {
|
||||
tk_free(raw->datacode);
|
||||
tk_free(raw->ecccode);
|
||||
tk_free(raw->rsblock);
|
||||
tk_free(raw);
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
/******************************************************************************
|
||||
* Frame filling
|
||||
*****************************************************************************/
|
||||
|
||||
typedef struct {
|
||||
int width;
|
||||
unsigned char *frame;
|
||||
int x, y;
|
||||
int dir;
|
||||
int bit;
|
||||
int mqr;
|
||||
} FrameFiller;
|
||||
|
||||
static void FrameFiller_set(FrameFiller *filler, int width, unsigned char *frame, int mqr)
|
||||
{
|
||||
filler->width = width;
|
||||
filler->frame = frame;
|
||||
filler->x = width - 1;
|
||||
filler->y = width - 1;
|
||||
filler->dir = -1;
|
||||
filler->bit = -1;
|
||||
filler->mqr = mqr;
|
||||
}
|
||||
|
||||
static unsigned char *FrameFiller_next(FrameFiller *filler)
|
||||
{
|
||||
unsigned char *p;
|
||||
int x, y, w;
|
||||
|
||||
if(filler->bit == -1) {
|
||||
filler->bit = 0;
|
||||
return filler->frame + filler->y * filler->width + filler->x;
|
||||
}
|
||||
|
||||
x = filler->x;
|
||||
y = filler->y;
|
||||
p = filler->frame;
|
||||
w = filler->width;
|
||||
|
||||
if(filler->bit == 0) {
|
||||
x--;
|
||||
filler->bit++;
|
||||
} else {
|
||||
x++;
|
||||
y += filler->dir;
|
||||
filler->bit--;
|
||||
}
|
||||
|
||||
if(filler->dir < 0) {
|
||||
if(y < 0) {
|
||||
y = 0;
|
||||
x -= 2;
|
||||
filler->dir = 1;
|
||||
if(!filler->mqr && x == 6) {
|
||||
x--;
|
||||
y = 9;
|
||||
}
|
||||
}
|
||||
} else if(y == w) {
|
||||
y = w - 1;
|
||||
x -= 2;
|
||||
filler->dir = -1;
|
||||
if(!filler->mqr && x == 6) {
|
||||
x--;
|
||||
y -= 8;
|
||||
}
|
||||
}
|
||||
if(x < 0 || y < 0) return NULL;
|
||||
|
||||
filler->x = x;
|
||||
filler->y = y;
|
||||
|
||||
if(p[y * w + x] & 0x80) {
|
||||
// This tail recursion could be optimized.
|
||||
return FrameFiller_next(filler);
|
||||
}
|
||||
return &p[y * w + x];
|
||||
}
|
||||
|
||||
#ifdef WITH_TESTS
|
||||
unsigned char *FrameFiller_test(int version)
|
||||
{
|
||||
int width;
|
||||
unsigned char *frame, *p;
|
||||
int i, length;
|
||||
FrameFiller filler;
|
||||
|
||||
width = QRspec_getWidth(version);
|
||||
frame = QRspec_newFrame(version);
|
||||
if(frame == NULL) return NULL;
|
||||
FrameFiller_set(&filler, width, frame, 0);
|
||||
length = QRspec_getDataLength(version, QR_ECLEVEL_L) * 8
|
||||
+ QRspec_getECCLength(version, QR_ECLEVEL_L) * 8
|
||||
+ QRspec_getRemainder(version);
|
||||
for(i = 0; i < length; i++) {
|
||||
p = FrameFiller_next(&filler);
|
||||
if(p == NULL) {
|
||||
tk_free(frame);
|
||||
return NULL;
|
||||
}
|
||||
*p = (unsigned char)(i & 0x7f) | 0x80;
|
||||
}
|
||||
return frame;
|
||||
}
|
||||
|
||||
unsigned char *FrameFiller_testMQR(int version)
|
||||
{
|
||||
int width;
|
||||
unsigned char *frame, *p;
|
||||
int i, length;
|
||||
FrameFiller filler;
|
||||
|
||||
width = MQRspec_getWidth(version);
|
||||
frame = MQRspec_newFrame(version);
|
||||
if(frame == NULL) return NULL;
|
||||
FrameFiller_set(&filler, width, frame, 1);
|
||||
length = MQRspec_getDataLengthBit(version, QR_ECLEVEL_L)
|
||||
+ MQRspec_getECCLength(version, QR_ECLEVEL_L) * 8;
|
||||
for(i = 0; i < length; i++) {
|
||||
p = FrameFiller_next(&filler);
|
||||
if(p == NULL) {
|
||||
fprintf(stderr, "Frame filler run over the frame!\n");
|
||||
return frame;
|
||||
}
|
||||
*p = (unsigned char)(i & 0x7f) | 0x80;
|
||||
}
|
||||
return frame;
|
||||
}
|
||||
#endif
|
||||
|
||||
|
||||
/******************************************************************************
|
||||
* QR-code encoding
|
||||
*****************************************************************************/
|
||||
|
||||
STATIC_IN_RELEASE QRcode *QRcode_new(int version, int width, unsigned char *data)
|
||||
{
|
||||
QRcode *qrcode;
|
||||
|
||||
qrcode = (QRcode *)TKMEM_ALLOC(sizeof(QRcode));
|
||||
if(qrcode == NULL) return NULL;
|
||||
|
||||
qrcode->version = version;
|
||||
qrcode->width = width;
|
||||
qrcode->data = data;
|
||||
|
||||
return qrcode;
|
||||
}
|
||||
|
||||
void QRcode_free(QRcode *qrcode)
|
||||
{
|
||||
if(qrcode != NULL) {
|
||||
tk_free(qrcode->data);
|
||||
tk_free(qrcode);
|
||||
}
|
||||
}
|
||||
|
||||
STATIC_IN_RELEASE QRcode *QRcode_encodeMask(QRinput *input, int mask)
|
||||
{
|
||||
int width, version;
|
||||
QRRawCode *raw;
|
||||
unsigned char *frame, *masked, *p, code, bit;
|
||||
int i, j;
|
||||
QRcode *qrcode = NULL;
|
||||
FrameFiller filler;
|
||||
|
||||
if(input->mqr) {
|
||||
return NULL;
|
||||
}
|
||||
if(input->version < 0 || input->version > QRSPEC_VERSION_MAX) {
|
||||
return NULL;
|
||||
}
|
||||
if(input->level > QR_ECLEVEL_H) {
|
||||
return NULL;
|
||||
}
|
||||
|
||||
raw = QRraw_new(input);
|
||||
if(raw == NULL) return NULL;
|
||||
|
||||
version = raw->version;
|
||||
width = QRspec_getWidth(version);
|
||||
frame = QRspec_newFrame(version);
|
||||
if(frame == NULL) {
|
||||
QRraw_free(raw);
|
||||
return NULL;
|
||||
}
|
||||
FrameFiller_set(&filler, width, frame, 0);
|
||||
|
||||
/* interleaved data and ecc codes */
|
||||
for(i = 0; i < raw->dataLength; i++) {
|
||||
code = QRraw_getCode(raw);
|
||||
bit = 0x80;
|
||||
for(j = 0; j < 8; j++) {
|
||||
p = FrameFiller_next(&filler);
|
||||
if(p == NULL) goto EXIT;
|
||||
*p = ((bit & code) != 0);
|
||||
bit = bit >> 1;
|
||||
}
|
||||
}
|
||||
for(i = 0; i < raw->eccLength; i++) {
|
||||
code = QRraw_getCode(raw);
|
||||
bit = 0x80;
|
||||
for(j = 0; j < 8; j++) {
|
||||
p = FrameFiller_next(&filler);
|
||||
if(p == NULL) goto EXIT;
|
||||
*p = 0x02 | ((bit & code) != 0);
|
||||
bit = bit >> 1;
|
||||
}
|
||||
}
|
||||
QRraw_free(raw);
|
||||
raw = NULL;
|
||||
/* remainder bits */
|
||||
j = QRspec_getRemainder(version);
|
||||
for(i = 0; i < j; i++) {
|
||||
p = FrameFiller_next(&filler);
|
||||
if(p == NULL) goto EXIT;
|
||||
*p = 0x02;
|
||||
}
|
||||
|
||||
/* masking */
|
||||
if(mask == -2) { // just for debug purpose
|
||||
masked = (unsigned char *)TKMEM_ALLOC((size_t)(width * width));
|
||||
memcpy(masked, frame, (size_t)(width * width));
|
||||
} else if(mask < 0) {
|
||||
masked = Mask_mask(width, frame, input->level);
|
||||
} else {
|
||||
masked = Mask_makeMask(width, frame, mask, input->level);
|
||||
}
|
||||
if(masked == NULL) {
|
||||
goto EXIT;
|
||||
}
|
||||
qrcode = QRcode_new(version, width, masked);
|
||||
if(qrcode == NULL) {
|
||||
tk_free(masked);
|
||||
}
|
||||
|
||||
EXIT:
|
||||
QRraw_free(raw);
|
||||
tk_free(frame);
|
||||
return qrcode;
|
||||
}
|
||||
|
||||
STATIC_IN_RELEASE QRcode *QRcode_encodeMaskMQR(QRinput *input, int mask)
|
||||
{
|
||||
int width, version;
|
||||
MQRRawCode *raw;
|
||||
unsigned char *frame, *masked, *p, code, bit;
|
||||
int i, j, length;
|
||||
QRcode *qrcode = NULL;
|
||||
FrameFiller filler;
|
||||
|
||||
if(!input->mqr) {
|
||||
return NULL;
|
||||
}
|
||||
if(input->version <= 0 || input->version > MQRSPEC_VERSION_MAX) {
|
||||
return NULL;
|
||||
}
|
||||
if(input->level > QR_ECLEVEL_Q) {
|
||||
return NULL;
|
||||
}
|
||||
|
||||
raw = MQRraw_new(input);
|
||||
if(raw == NULL) return NULL;
|
||||
|
||||
version = raw->version;
|
||||
width = MQRspec_getWidth(version);
|
||||
frame = MQRspec_newFrame(version);
|
||||
if(frame == NULL) {
|
||||
MQRraw_free(raw);
|
||||
return NULL;
|
||||
}
|
||||
FrameFiller_set(&filler, width, frame, 1);
|
||||
|
||||
/* interleaved data and ecc codes */
|
||||
for(i = 0; i < raw->dataLength; i++) {
|
||||
code = MQRraw_getCode(raw);
|
||||
bit = 0x80;
|
||||
if(raw->oddbits && i == raw->dataLength - 1) {
|
||||
length = raw->oddbits;
|
||||
} else {
|
||||
length = 8;
|
||||
}
|
||||
for(j = 0; j < length; j++) {
|
||||
p = FrameFiller_next(&filler);
|
||||
if(p == NULL) goto EXIT;
|
||||
*p = ((bit & code) != 0);
|
||||
bit = bit >> 1;
|
||||
}
|
||||
}
|
||||
for(i = 0; i < raw->eccLength; i++) {
|
||||
code = MQRraw_getCode(raw);
|
||||
bit = 0x80;
|
||||
length = 8;
|
||||
for(j = 0; j < length; j++) {
|
||||
p = FrameFiller_next(&filler);
|
||||
if(p == NULL) goto EXIT;
|
||||
*p = 0x02 | ((bit & code) != 0);
|
||||
bit = bit >> 1;
|
||||
}
|
||||
}
|
||||
MQRraw_free(raw);
|
||||
raw = NULL;
|
||||
|
||||
/* masking */
|
||||
if(mask == -2) { // just for debug purpose
|
||||
masked = (unsigned char *)TKMEM_ALLOC((size_t)(width * width));
|
||||
memcpy(masked, frame, (size_t)(width * width));
|
||||
} else if(mask < 0) {
|
||||
masked = MMask_mask(version, frame, input->level);
|
||||
} else {
|
||||
masked = MMask_makeMask(version, frame, mask, input->level);
|
||||
}
|
||||
if(masked == NULL) {
|
||||
goto EXIT;
|
||||
}
|
||||
|
||||
qrcode = QRcode_new(version, width, masked);
|
||||
if(qrcode == NULL) {
|
||||
tk_free(masked);
|
||||
}
|
||||
|
||||
EXIT:
|
||||
MQRraw_free(raw);
|
||||
tk_free(frame);
|
||||
return qrcode;
|
||||
}
|
||||
|
||||
QRcode *QRcode_encodeInput(QRinput *input)
|
||||
{
|
||||
if(input->mqr) {
|
||||
return QRcode_encodeMaskMQR(input, -1);
|
||||
} else {
|
||||
return QRcode_encodeMask(input, -1);
|
||||
}
|
||||
}
|
||||
|
||||
static QRcode *QRcode_encodeStringReal(const char *string, int version, QRecLevel level, int mqr, QRencodeMode hint, int casesensitive)
|
||||
{
|
||||
QRinput *input;
|
||||
QRcode *code;
|
||||
int ret;
|
||||
|
||||
if(string == NULL) {
|
||||
return NULL;
|
||||
}
|
||||
if(hint != QR_MODE_8 && hint != QR_MODE_KANJI) {
|
||||
return NULL;
|
||||
}
|
||||
|
||||
if(mqr) {
|
||||
input = QRinput_newMQR(version, level);
|
||||
} else {
|
||||
input = QRinput_new2(version, level);
|
||||
}
|
||||
if(input == NULL) return NULL;
|
||||
|
||||
ret = Split_splitStringToQRinput(string, input, hint, casesensitive);
|
||||
if(ret < 0) {
|
||||
QRinput_free(input);
|
||||
return NULL;
|
||||
}
|
||||
code = QRcode_encodeInput(input);
|
||||
QRinput_free(input);
|
||||
|
||||
return code;
|
||||
}
|
||||
|
||||
QRcode *QRcode_encodeString(const char *string, int version, QRecLevel level, QRencodeMode hint, int casesensitive)
|
||||
{
|
||||
return QRcode_encodeStringReal(string, version, level, 0, hint, casesensitive);
|
||||
}
|
||||
|
||||
QRcode *QRcode_encodeStringMQR(const char *string, int version, QRecLevel level, QRencodeMode hint, int casesensitive)
|
||||
{
|
||||
return QRcode_encodeStringReal(string, version, level, 1, hint, casesensitive);
|
||||
}
|
||||
|
||||
static QRcode *QRcode_encodeDataReal(const unsigned char *data, int length, int version, QRecLevel level, int mqr)
|
||||
{
|
||||
QRinput *input;
|
||||
QRcode *code;
|
||||
int ret;
|
||||
|
||||
if(data == NULL || length == 0) {
|
||||
return NULL;
|
||||
}
|
||||
|
||||
if(mqr) {
|
||||
input = QRinput_newMQR(version, level);
|
||||
} else {
|
||||
input = QRinput_new2(version, level);
|
||||
}
|
||||
if(input == NULL) return NULL;
|
||||
|
||||
ret = QRinput_append(input, QR_MODE_8, length, data);
|
||||
if(ret < 0) {
|
||||
QRinput_free(input);
|
||||
return NULL;
|
||||
}
|
||||
code = QRcode_encodeInput(input);
|
||||
QRinput_free(input);
|
||||
|
||||
return code;
|
||||
}
|
||||
|
||||
QRcode *QRcode_encodeData(int size, const unsigned char *data, int version, QRecLevel level)
|
||||
{
|
||||
return QRcode_encodeDataReal(data, size, version, level, 0);
|
||||
}
|
||||
|
||||
QRcode *QRcode_encodeString8bit(const char *string, int version, QRecLevel level)
|
||||
{
|
||||
if(string == NULL) {
|
||||
return NULL;
|
||||
}
|
||||
return QRcode_encodeDataReal((unsigned char *)string, (int)strlen(string), version, level, 0);
|
||||
}
|
||||
|
||||
QRcode *QRcode_encodeDataMQR(int size, const unsigned char *data, int version, QRecLevel level)
|
||||
{
|
||||
return QRcode_encodeDataReal(data, size, version, level, 1);
|
||||
}
|
||||
|
||||
QRcode *QRcode_encodeString8bitMQR(const char *string, int version, QRecLevel level)
|
||||
{
|
||||
if(string == NULL) {
|
||||
return NULL;
|
||||
}
|
||||
return QRcode_encodeDataReal((unsigned char *)string, (int)strlen(string), version, level, 1);
|
||||
}
|
||||
|
||||
|
||||
/******************************************************************************
|
||||
* Structured QR-code encoding
|
||||
*****************************************************************************/
|
||||
|
||||
static QRcode_List *QRcode_List_newEntry(void)
|
||||
{
|
||||
QRcode_List *entry;
|
||||
|
||||
entry = (QRcode_List *)TKMEM_ALLOC(sizeof(QRcode_List));
|
||||
if(entry == NULL) return NULL;
|
||||
|
||||
entry->next = NULL;
|
||||
entry->code = NULL;
|
||||
|
||||
return entry;
|
||||
}
|
||||
|
||||
static void QRcode_List_freeEntry(QRcode_List *entry)
|
||||
{
|
||||
if(entry != NULL) {
|
||||
QRcode_free(entry->code);
|
||||
tk_free(entry);
|
||||
}
|
||||
}
|
||||
|
||||
void QRcode_List_free(QRcode_List *qrlist)
|
||||
{
|
||||
QRcode_List *list = qrlist, *next;
|
||||
|
||||
while(list != NULL) {
|
||||
next = list->next;
|
||||
QRcode_List_freeEntry(list);
|
||||
list = next;
|
||||
}
|
||||
}
|
||||
|
||||
int QRcode_List_size(QRcode_List *qrlist)
|
||||
{
|
||||
QRcode_List *list = qrlist;
|
||||
int size = 0;
|
||||
|
||||
while(list != NULL) {
|
||||
size++;
|
||||
list = list->next;
|
||||
}
|
||||
|
||||
return size;
|
||||
}
|
||||
|
||||
#if 0
|
||||
static unsigned char QRcode_parity(const char *str, int size)
|
||||
{
|
||||
unsigned char parity = 0;
|
||||
int i;
|
||||
|
||||
for(i = 0; i < size; i++) {
|
||||
parity ^= str[i];
|
||||
}
|
||||
|
||||
return parity;
|
||||
}
|
||||
#endif
|
||||
|
||||
QRcode_List *QRcode_encodeInputStructured(QRinput_Struct *s)
|
||||
{
|
||||
QRcode_List *head = NULL;
|
||||
QRcode_List *tail = NULL;
|
||||
QRcode_List *entry;
|
||||
QRinput_InputList *list = s->head;
|
||||
|
||||
while(list != NULL) {
|
||||
if(head == NULL) {
|
||||
entry = QRcode_List_newEntry();
|
||||
if(entry == NULL) goto ABORT;
|
||||
head = entry;
|
||||
tail = head;
|
||||
} else {
|
||||
entry = QRcode_List_newEntry();
|
||||
if(entry == NULL) goto ABORT;
|
||||
tail->next = entry;
|
||||
tail = tail->next;
|
||||
}
|
||||
tail->code = QRcode_encodeInput(list->input);
|
||||
if(tail->code == NULL) {
|
||||
goto ABORT;
|
||||
}
|
||||
list = list->next;
|
||||
}
|
||||
|
||||
return head;
|
||||
ABORT:
|
||||
QRcode_List_free(head);
|
||||
return NULL;
|
||||
}
|
||||
|
||||
static QRcode_List *QRcode_encodeInputToStructured(QRinput *input)
|
||||
{
|
||||
QRinput_Struct *s;
|
||||
QRcode_List *codes;
|
||||
|
||||
s = QRinput_splitQRinputToStruct(input);
|
||||
if(s == NULL) return NULL;
|
||||
|
||||
codes = QRcode_encodeInputStructured(s);
|
||||
QRinput_Struct_free(s);
|
||||
|
||||
return codes;
|
||||
}
|
||||
|
||||
static QRcode_List *QRcode_encodeDataStructuredReal(
|
||||
int size, const unsigned char *data,
|
||||
int version, QRecLevel level,
|
||||
int eightbit, QRencodeMode hint, int casesensitive)
|
||||
{
|
||||
QRinput *input;
|
||||
QRcode_List *codes;
|
||||
int ret;
|
||||
|
||||
if(version <= 0) {
|
||||
return NULL;
|
||||
}
|
||||
if(!eightbit && (hint != QR_MODE_8 && hint != QR_MODE_KANJI)) {
|
||||
return NULL;
|
||||
}
|
||||
|
||||
input = QRinput_new2(version, level);
|
||||
if(input == NULL) return NULL;
|
||||
|
||||
if(eightbit) {
|
||||
ret = QRinput_append(input, QR_MODE_8, size, data);
|
||||
} else {
|
||||
ret = Split_splitStringToQRinput((char *)data, input, hint, casesensitive);
|
||||
}
|
||||
if(ret < 0) {
|
||||
QRinput_free(input);
|
||||
return NULL;
|
||||
}
|
||||
codes = QRcode_encodeInputToStructured(input);
|
||||
QRinput_free(input);
|
||||
|
||||
return codes;
|
||||
}
|
||||
|
||||
QRcode_List *QRcode_encodeDataStructured(int size, const unsigned char *data, int version, QRecLevel level) {
|
||||
return QRcode_encodeDataStructuredReal(size, data, version, level, 1, QR_MODE_NUL, 0);
|
||||
}
|
||||
|
||||
QRcode_List *QRcode_encodeString8bitStructured(const char *string, int version, QRecLevel level) {
|
||||
if(string == NULL) {
|
||||
return NULL;
|
||||
}
|
||||
return QRcode_encodeDataStructured((int)strlen(string), (unsigned char *)string, version, level);
|
||||
}
|
||||
|
||||
QRcode_List *QRcode_encodeStringStructured(const char *string, int version, QRecLevel level, QRencodeMode hint, int casesensitive)
|
||||
{
|
||||
if(string == NULL) {
|
||||
return NULL;
|
||||
}
|
||||
return QRcode_encodeDataStructuredReal((int)strlen(string), (unsigned char *)string, version, level, 0, hint, casesensitive);
|
||||
}
|
||||
|
||||
/******************************************************************************
|
||||
* System utilities
|
||||
*****************************************************************************/
|
||||
|
||||
void QRcode_APIVersion(int *major_version, int *minor_version, int *micro_version)
|
||||
{
|
||||
if(major_version != NULL) {
|
||||
*major_version = MAJOR_VERSION;
|
||||
}
|
||||
if(minor_version != NULL) {
|
||||
*minor_version = MINOR_VERSION;
|
||||
}
|
||||
if(micro_version != NULL) {
|
||||
*micro_version = MICRO_VERSION;
|
||||
}
|
||||
}
|
||||
|
||||
char *QRcode_APIVersionString(void)
|
||||
{
|
||||
return VERSION;
|
||||
}
|
||||
|
||||
void QRcode_clearCache(void)
|
||||
{
|
||||
return;
|
||||
}
|
@ -0,0 +1,568 @@
|
||||
/**
|
||||
* qrencode - QR Code encoder
|
||||
*
|
||||
* Copyright (C) 2006-2017 Kentaro Fukuchi <kentaro@fukuchi.org>
|
||||
*
|
||||
* This library is free software; you can redistribute it and/or
|
||||
* modify it under the terms of the GNU Lesser General Public
|
||||
* License as published by the Free Software Foundation; either
|
||||
* version 2.1 of the License, or any later version.
|
||||
*
|
||||
* This library is distributed in the hope that it will be useful,
|
||||
* but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
|
||||
* Lesser General Public License for more details.
|
||||
*
|
||||
* You should have received a copy of the GNU Lesser General Public
|
||||
* License along with this library; if not, write to the Free Software
|
||||
* Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA
|
||||
*/
|
||||
|
||||
/** \mainpage
|
||||
* Libqrencode is a library for encoding data in a QR Code symbol, a kind of 2D
|
||||
* symbology.
|
||||
*
|
||||
* \section encoding Encoding
|
||||
*
|
||||
* There are two methods to encode data: <b>encoding a string/data</b> or
|
||||
* <b>encoding a structured data</b>.
|
||||
*
|
||||
* \subsection encoding-string Encoding a string/data
|
||||
* You can encode a string by calling QRcode_encodeString().
|
||||
* The given string is parsed automatically and encoded. If you want to encode
|
||||
* data that can be represented as a C string style (NUL terminated), you can
|
||||
* simply use this way.
|
||||
*
|
||||
* If the input data contains Kanji (Shift-JIS) characters and you want to
|
||||
* encode them as Kanji in QR Code, you should give QR_MODE_KANJI as a hint.
|
||||
* Otherwise, all of non-alphanumeric characters are encoded as 8 bit data.
|
||||
* If you want to encode a whole string in 8 bit mode, you can use
|
||||
* QRcode_encodeString8bit() instead.
|
||||
*
|
||||
* Please note that a C string can not contain NUL characters. If your data
|
||||
* contains NUL, you must use QRcode_encodeData().
|
||||
*
|
||||
* \subsection encoding-input Encoding a structured data
|
||||
* You can construct a structured input data manually. If the structure of the
|
||||
* input data is known, you can use this way.
|
||||
* At first, create a ::QRinput object by QRinput_new(). Then add input data
|
||||
* to the QRinput object by QRinput_append(). Finally call QRcode_encodeInput()
|
||||
* to encode the QRinput data.
|
||||
* You can reuse the QRinput data again to encode it in other symbols with
|
||||
* different parameters.
|
||||
*
|
||||
* \section result Result
|
||||
* The encoded symbol is resulted as a ::QRcode object. It will contain
|
||||
* its version number, width of the symbol and an array represents the symbol.
|
||||
* See ::QRcode for the details. You can free the object by QRcode_free().
|
||||
*
|
||||
* Please note that the version of the result may be larger than specified.
|
||||
* In such cases, the input data would be too large to be encoded in a
|
||||
* symbol of the specified version.
|
||||
*
|
||||
* \section structured Structured append
|
||||
* Libqrencode can generate "Structured-appended" symbols that enables to split
|
||||
* a large data set into mulitple QR codes. A QR code reader concatenates
|
||||
* multiple QR code symbols into a string.
|
||||
* Just like QRcode_encodeString(), you can use QRcode_encodeStringStructured()
|
||||
* to generate structured-appended symbols. This functions returns an instance
|
||||
* of ::QRcode_List. The returned list is a singly-linked list of QRcode: you
|
||||
* can retrieve each QR code in this way:
|
||||
*
|
||||
* \code
|
||||
* QRcode_List *qrcodes;
|
||||
* QRcode_List *entry;
|
||||
* QRcode *qrcode;
|
||||
*
|
||||
* qrcodes = QRcode_encodeStringStructured(...);
|
||||
* entry = qrcodes;
|
||||
* while(entry != NULL) {
|
||||
* qrcode = entry->code;
|
||||
* // do something
|
||||
* entry = entry->next;
|
||||
* }
|
||||
* QRcode_List_free(entry);
|
||||
* \endcode
|
||||
*
|
||||
* Instead of using auto-parsing functions, you can construct your own
|
||||
* structured input. At first, instantiate an object of ::QRinput_Struct
|
||||
* by calling QRinput_Struct_new(). This object can hold multiple ::QRinput,
|
||||
* and one QR code is generated for a ::QRinput.
|
||||
* QRinput_Struct_appendInput() appends a ::QRinput to a ::QRinput_Struct
|
||||
* object. In order to generate structured-appended symbols, it is required to
|
||||
* embed headers to each symbol. You can use
|
||||
* QRinput_Struct_insertStructuredAppendHeaders() to insert appropriate
|
||||
* headers to each symbol. You should call this function just once before
|
||||
* encoding symbols.
|
||||
*/
|
||||
|
||||
#ifndef QRENCODE_H
|
||||
#define QRENCODE_H
|
||||
|
||||
#if defined(__cplusplus)
|
||||
extern "C" {
|
||||
#endif
|
||||
|
||||
/**
|
||||
* Encoding mode.
|
||||
*/
|
||||
typedef enum {
|
||||
QR_MODE_NUL = -1, ///< Terminator (NUL character). Internal use only
|
||||
QR_MODE_NUM = 0, ///< Numeric mode
|
||||
QR_MODE_AN, ///< Alphabet-numeric mode
|
||||
QR_MODE_8, ///< 8-bit data mode
|
||||
QR_MODE_KANJI, ///< Kanji (shift-jis) mode
|
||||
QR_MODE_STRUCTURE, ///< Internal use only
|
||||
QR_MODE_ECI, ///< ECI mode
|
||||
QR_MODE_FNC1FIRST, ///< FNC1, first position
|
||||
QR_MODE_FNC1SECOND, ///< FNC1, second position
|
||||
} QRencodeMode;
|
||||
|
||||
/**
|
||||
* Level of error correction.
|
||||
*/
|
||||
typedef enum {
|
||||
QR_ECLEVEL_L = 0, ///< lowest
|
||||
QR_ECLEVEL_M,
|
||||
QR_ECLEVEL_Q,
|
||||
QR_ECLEVEL_H ///< highest
|
||||
} QRecLevel;
|
||||
|
||||
/**
|
||||
* Maximum version (size) of QR-code symbol.
|
||||
*/
|
||||
#define QRSPEC_VERSION_MAX 40
|
||||
|
||||
/**
|
||||
* Maximum version (size) of QR-code symbol.
|
||||
*/
|
||||
#define MQRSPEC_VERSION_MAX 4
|
||||
|
||||
|
||||
/******************************************************************************
|
||||
* Input data (qrinput.c)
|
||||
*****************************************************************************/
|
||||
|
||||
/**
|
||||
* Singly linked list to contain input strings. An instance of this class
|
||||
* contains its version and error correction level too. It is required to
|
||||
* set them by QRinput_setVersion() and QRinput_setErrorCorrectionLevel(),
|
||||
* or use QRinput_new2() to instantiate an object.
|
||||
*/
|
||||
typedef struct _QRinput QRinput;
|
||||
|
||||
/**
|
||||
* Instantiate an input data object. The version is set to 0 (auto-select)
|
||||
* and the error correction level is set to QR_ECLEVEL_L.
|
||||
* @return an input object (initialized). On error, NULL is returned and errno
|
||||
* is set to indicate the error.
|
||||
* @throw ENOMEM unable to allocate memory.
|
||||
*/
|
||||
extern QRinput *QRinput_new(void);
|
||||
|
||||
/**
|
||||
* Instantiate an input data object.
|
||||
* @param version version number.
|
||||
* @param level Error correction level.
|
||||
* @return an input object (initialized). On error, NULL is returned and errno
|
||||
* is set to indicate the error.
|
||||
* @throw ENOMEM unable to allocate memory for input objects.
|
||||
* @throw EINVAL invalid arguments.
|
||||
*/
|
||||
extern QRinput *QRinput_new2(int version, QRecLevel level);
|
||||
|
||||
/**
|
||||
* Instantiate an input data object. Object's Micro QR Code flag is set.
|
||||
* Unlike with full-sized QR Code, version number must be specified (>0).
|
||||
* @param version version number (1--4).
|
||||
* @param level Error correction level.
|
||||
* @return an input object (initialized). On error, NULL is returned and errno
|
||||
* is set to indicate the error.
|
||||
* @throw ENOMEM unable to allocate memory for input objects.
|
||||
* @throw EINVAL invalid arguments.
|
||||
*/
|
||||
extern QRinput *QRinput_newMQR(int version, QRecLevel level);
|
||||
|
||||
/**
|
||||
* Append data to an input object.
|
||||
* The data is copied and appended to the input object.
|
||||
* @param input input object.
|
||||
* @param mode encoding mode.
|
||||
* @param size size of data (byte).
|
||||
* @param data a pointer to the memory area of the input data.
|
||||
* @retval 0 success.
|
||||
* @retval -1 an error occurred and errno is set to indeicate the error.
|
||||
* See Execptions for the details.
|
||||
* @throw ENOMEM unable to allocate memory.
|
||||
* @throw EINVAL input data is invalid.
|
||||
*
|
||||
*/
|
||||
extern int QRinput_append(QRinput *input, QRencodeMode mode, int size, const unsigned char *data);
|
||||
|
||||
/**
|
||||
* Append ECI header.
|
||||
* @param input input object.
|
||||
* @param ecinum ECI indicator number (0 - 999999)
|
||||
* @retval 0 success.
|
||||
* @retval -1 an error occurred and errno is set to indeicate the error.
|
||||
* See Execptions for the details.
|
||||
* @throw ENOMEM unable to allocate memory.
|
||||
* @throw EINVAL input data is invalid.
|
||||
*
|
||||
*/
|
||||
extern int QRinput_appendECIheader(QRinput *input, unsigned int ecinum);
|
||||
|
||||
/**
|
||||
* Get current version.
|
||||
* @param input input object.
|
||||
* @return current version.
|
||||
*/
|
||||
extern int QRinput_getVersion(QRinput *input);
|
||||
|
||||
/**
|
||||
* Set version of the QR code that is to be encoded.
|
||||
* This function cannot be applied to Micro QR Code.
|
||||
* @param input input object.
|
||||
* @param version version number (0 = auto)
|
||||
* @retval 0 success.
|
||||
* @retval -1 invalid argument.
|
||||
*/
|
||||
extern int QRinput_setVersion(QRinput *input, int version);
|
||||
|
||||
/**
|
||||
* Get current error correction level.
|
||||
* @param input input object.
|
||||
* @return Current error correcntion level.
|
||||
*/
|
||||
extern QRecLevel QRinput_getErrorCorrectionLevel(QRinput *input);
|
||||
|
||||
/**
|
||||
* Set error correction level of the QR code that is to be encoded.
|
||||
* This function cannot be applied to Micro QR Code.
|
||||
* @param input input object.
|
||||
* @param level Error correction level.
|
||||
* @retval 0 success.
|
||||
* @retval -1 invalid argument.
|
||||
*/
|
||||
extern int QRinput_setErrorCorrectionLevel(QRinput *input, QRecLevel level);
|
||||
|
||||
/**
|
||||
* Set version and error correction level of the QR code at once.
|
||||
* This function is recommened for Micro QR Code.
|
||||
* @param input input object.
|
||||
* @param version version number (0 = auto)
|
||||
* @param level Error correction level.
|
||||
* @retval 0 success.
|
||||
* @retval -1 invalid argument.
|
||||
*/
|
||||
extern int QRinput_setVersionAndErrorCorrectionLevel(QRinput *input, int version, QRecLevel level);
|
||||
|
||||
/**
|
||||
* Free the input object.
|
||||
* All of data chunks in the input object are freed too.
|
||||
* @param input input object.
|
||||
*/
|
||||
extern void QRinput_free(QRinput *input);
|
||||
|
||||
/**
|
||||
* Validate the input data.
|
||||
* @param mode encoding mode.
|
||||
* @param size size of data (byte).
|
||||
* @param data a pointer to the memory area of the input data.
|
||||
* @retval 0 success.
|
||||
* @retval -1 invalid arguments.
|
||||
*/
|
||||
extern int QRinput_check(QRencodeMode mode, int size, const unsigned char *data);
|
||||
|
||||
/**
|
||||
* Set of QRinput for structured symbols.
|
||||
*/
|
||||
typedef struct _QRinput_Struct QRinput_Struct;
|
||||
|
||||
/**
|
||||
* Instantiate a set of input data object.
|
||||
* @return an instance of QRinput_Struct. On error, NULL is returned and errno
|
||||
* is set to indicate the error.
|
||||
* @throw ENOMEM unable to allocate memory.
|
||||
*/
|
||||
extern QRinput_Struct *QRinput_Struct_new(void);
|
||||
|
||||
/**
|
||||
* Set parity of structured symbols.
|
||||
* @param s structured input object.
|
||||
* @param parity parity of s.
|
||||
*/
|
||||
extern void QRinput_Struct_setParity(QRinput_Struct *s, unsigned char parity);
|
||||
|
||||
/**
|
||||
* Append a QRinput object to the set. QRinput created by QRinput_newMQR()
|
||||
* will be rejected.
|
||||
* @warning never append the same QRinput object twice or more.
|
||||
* @param s structured input object.
|
||||
* @param input an input object.
|
||||
* @retval >0 number of input objects in the structure.
|
||||
* @retval -1 an error occurred. See Exceptions for the details.
|
||||
* @throw ENOMEM unable to allocate memory.
|
||||
* @throw EINVAL invalid arguments.
|
||||
*/
|
||||
extern int QRinput_Struct_appendInput(QRinput_Struct *s, QRinput *input);
|
||||
|
||||
/**
|
||||
* Free all of QRinput in the set.
|
||||
* @param s a structured input object.
|
||||
*/
|
||||
extern void QRinput_Struct_free(QRinput_Struct *s);
|
||||
|
||||
/**
|
||||
* Split a QRinput to QRinput_Struct. It calculates a parity, set it, then
|
||||
* insert structured-append headers. QRinput created by QRinput_newMQR() will
|
||||
* be rejected.
|
||||
* @param input input object. Version number and error correction level must be
|
||||
* set.
|
||||
* @return a set of input data. On error, NULL is returned, and errno is set
|
||||
* to indicate the error. See Exceptions for the details.
|
||||
* @throw ERANGE input data is too large.
|
||||
* @throw EINVAL invalid input data.
|
||||
* @throw ENOMEM unable to allocate memory.
|
||||
*/
|
||||
extern QRinput_Struct *QRinput_splitQRinputToStruct(QRinput *input);
|
||||
|
||||
/**
|
||||
* Insert structured-append headers to the input structure. It calculates
|
||||
* a parity and set it if the parity is not set yet.
|
||||
* @param s input structure
|
||||
* @retval 0 success.
|
||||
* @retval -1 an error occurred and errno is set to indeicate the error.
|
||||
* See Execptions for the details.
|
||||
* @throw EINVAL invalid input object.
|
||||
* @throw ENOMEM unable to allocate memory.
|
||||
*/
|
||||
extern int QRinput_Struct_insertStructuredAppendHeaders(QRinput_Struct *s);
|
||||
|
||||
/**
|
||||
* Set FNC1-1st position flag.
|
||||
*/
|
||||
extern int QRinput_setFNC1First(QRinput *input);
|
||||
|
||||
/**
|
||||
* Set FNC1-2nd position flag and application identifier.
|
||||
*/
|
||||
extern int QRinput_setFNC1Second(QRinput *input, unsigned char appid);
|
||||
|
||||
/******************************************************************************
|
||||
* QRcode output (qrencode.c)
|
||||
*****************************************************************************/
|
||||
|
||||
/**
|
||||
* QRcode class.
|
||||
* Symbol data is represented as an array contains width*width uchars.
|
||||
* Each uchar represents a module (dot). If the less significant bit of
|
||||
* the uchar is 1, the corresponding module is black. The other bits are
|
||||
* meaningless for usual applications, but here its specification is described.
|
||||
*
|
||||
* @verbatim
|
||||
MSB 76543210 LSB
|
||||
|||||||`- 1=black/0=white
|
||||
||||||`-- 1=ecc/0=data code area
|
||||
|||||`--- format information
|
||||
||||`---- version information
|
||||
|||`----- timing pattern
|
||||
||`------ alignment pattern
|
||||
|`------- finder pattern and separator
|
||||
`-------- non-data modules (format, timing, etc.)
|
||||
@endverbatim
|
||||
*/
|
||||
typedef struct {
|
||||
int version; ///< version of the symbol
|
||||
int width; ///< width of the symbol
|
||||
unsigned char *data; ///< symbol data
|
||||
} QRcode;
|
||||
|
||||
/**
|
||||
* Singly-linked list of QRcode. Used to represent a structured symbols.
|
||||
* A list is terminated with NULL.
|
||||
*/
|
||||
typedef struct _QRcode_List {
|
||||
QRcode *code;
|
||||
struct _QRcode_List *next;
|
||||
} QRcode_List;
|
||||
|
||||
/**
|
||||
* Create a symbol from the input data.
|
||||
* @warning This function is THREAD UNSAFE when pthread is disabled.
|
||||
* @param input input data.
|
||||
* @return an instance of QRcode class. The version of the result QRcode may
|
||||
* be larger than the designated version. On error, NULL is returned,
|
||||
* and errno is set to indicate the error. See Exceptions for the
|
||||
* details.
|
||||
* @throw EINVAL invalid input object.
|
||||
* @throw ENOMEM unable to allocate memory for input objects.
|
||||
*/
|
||||
extern QRcode *QRcode_encodeInput(QRinput *input);
|
||||
|
||||
/**
|
||||
* Create a symbol from the string. The library automatically parses the input
|
||||
* string and encodes in a QR Code symbol.
|
||||
* @warning This function is THREAD UNSAFE when pthread is disabled.
|
||||
* @param string input string. It must be NUL terminated.
|
||||
* @param version version of the symbol. If 0, the library chooses the minimum
|
||||
* version for the given input data.
|
||||
* @param level error correction level.
|
||||
* @param hint tell the library how Japanese Kanji characters should be
|
||||
* encoded. If QR_MODE_KANJI is given, the library assumes that the
|
||||
* given string contains Shift-JIS characters and encodes them in
|
||||
* Kanji-mode. If QR_MODE_8 is given, all of non-alphanumerical
|
||||
* characters will be encoded as is. If you want to embed UTF-8
|
||||
* string, choose this. Other mode will cause EINVAL error.
|
||||
* @param casesensitive case-sensitive(1) or not(0).
|
||||
* @return an instance of QRcode class. The version of the result QRcode may
|
||||
* be larger than the designated version. On error, NULL is returned,
|
||||
* and errno is set to indicate the error. See Exceptions for the
|
||||
* details.
|
||||
* @throw EINVAL invalid input object.
|
||||
* @throw ENOMEM unable to allocate memory for input objects.
|
||||
* @throw ERANGE input data is too large.
|
||||
*/
|
||||
extern QRcode *QRcode_encodeString(const char *string, int version, QRecLevel level, QRencodeMode hint, int casesensitive);
|
||||
|
||||
/**
|
||||
* Same to QRcode_encodeString(), but encode whole data in 8-bit mode.
|
||||
* @warning This function is THREAD UNSAFE when pthread is disabled.
|
||||
*/
|
||||
extern QRcode *QRcode_encodeString8bit(const char *string, int version, QRecLevel level);
|
||||
|
||||
/**
|
||||
* Micro QR Code version of QRcode_encodeString().
|
||||
* @warning This function is THREAD UNSAFE when pthread is disabled.
|
||||
*/
|
||||
extern QRcode *QRcode_encodeStringMQR(const char *string, int version, QRecLevel level, QRencodeMode hint, int casesensitive);
|
||||
|
||||
/**
|
||||
* Micro QR Code version of QRcode_encodeString8bit().
|
||||
* @warning This function is THREAD UNSAFE when pthread is disabled.
|
||||
*/
|
||||
extern QRcode *QRcode_encodeString8bitMQR(const char *string, int version, QRecLevel level);
|
||||
|
||||
/**
|
||||
* Encode byte stream (may include '\0') in 8-bit mode.
|
||||
* @warning This function is THREAD UNSAFE when pthread is disabled.
|
||||
* @param size size of the input data.
|
||||
* @param data input data.
|
||||
* @param version version of the symbol. If 0, the library chooses the minimum
|
||||
* version for the given input data.
|
||||
* @param level error correction level.
|
||||
* @throw EINVAL invalid input object.
|
||||
* @throw ENOMEM unable to allocate memory for input objects.
|
||||
* @throw ERANGE input data is too large.
|
||||
*/
|
||||
extern QRcode *QRcode_encodeData(int size, const unsigned char *data, int version, QRecLevel level);
|
||||
|
||||
/**
|
||||
* Micro QR Code version of QRcode_encodeData().
|
||||
* @warning This function is THREAD UNSAFE when pthread is disabled.
|
||||
*/
|
||||
extern QRcode *QRcode_encodeDataMQR(int size, const unsigned char *data, int version, QRecLevel level);
|
||||
|
||||
/**
|
||||
* Free the instance of QRcode class.
|
||||
* @param qrcode an instance of QRcode class.
|
||||
*/
|
||||
extern void QRcode_free(QRcode *qrcode);
|
||||
|
||||
/**
|
||||
* Create structured symbols from the input data.
|
||||
* @warning This function is THREAD UNSAFE when pthread is disabled.
|
||||
* @param s input data, structured.
|
||||
* @return a singly-linked list of QRcode.
|
||||
*/
|
||||
extern QRcode_List *QRcode_encodeInputStructured(QRinput_Struct *s);
|
||||
|
||||
/**
|
||||
* Create structured symbols from the string. The library automatically parses
|
||||
* the input string and encodes in a QR Code symbol.
|
||||
* @warning This function is THREAD UNSAFE when pthread is disabled.
|
||||
* @param string input string. It must be NUL terminated.
|
||||
* @param version version of the symbol.
|
||||
* @param level error correction level.
|
||||
* @param hint tell the library how Japanese Kanji characters should be
|
||||
* encoded. If QR_MODE_KANJI is given, the library assumes that the
|
||||
* given string contains Shift-JIS characters and encodes them in
|
||||
* Kanji-mode. If QR_MODE_8 is given, all of non-alphanumerical
|
||||
* characters will be encoded as is. If you want to embed UTF-8
|
||||
* string, choose this. Other mode will cause EINVAL error.
|
||||
* @param casesensitive case-sensitive(1) or not(0).
|
||||
* @return a singly-linked list of QRcode. On error, NULL is returned, and
|
||||
* errno is set to indicate the error. See Exceptions for the details.
|
||||
* @throw EINVAL invalid input object.
|
||||
* @throw ENOMEM unable to allocate memory for input objects.
|
||||
*/
|
||||
extern QRcode_List *QRcode_encodeStringStructured(const char *string, int version, QRecLevel level, QRencodeMode hint, int casesensitive);
|
||||
|
||||
/**
|
||||
* Same to QRcode_encodeStringStructured(), but encode whole data in 8-bit mode.
|
||||
* @warning This function is THREAD UNSAFE when pthread is disabled.
|
||||
*/
|
||||
extern QRcode_List *QRcode_encodeString8bitStructured(const char *string, int version, QRecLevel level);
|
||||
|
||||
/**
|
||||
* Create structured symbols from byte stream (may include '\0'). Wholde data
|
||||
* are encoded in 8-bit mode.
|
||||
* @warning This function is THREAD UNSAFE when pthread is disabled.
|
||||
* @param size size of the input data.
|
||||
* @param data input dat.
|
||||
* @param version version of the symbol.
|
||||
* @param level error correction level.
|
||||
* @return a singly-linked list of QRcode. On error, NULL is returned, and
|
||||
* errno is set to indicate the error. See Exceptions for the details.
|
||||
* @throw EINVAL invalid input object.
|
||||
* @throw ENOMEM unable to allocate memory for input objects.
|
||||
*/
|
||||
extern QRcode_List *QRcode_encodeDataStructured(int size, const unsigned char *data, int version, QRecLevel level);
|
||||
|
||||
/**
|
||||
* Return the number of symbols included in a QRcode_List.
|
||||
* @param qrlist a head entry of a QRcode_List.
|
||||
* @return number of symbols in the list.
|
||||
*/
|
||||
extern int QRcode_List_size(QRcode_List *qrlist);
|
||||
|
||||
/**
|
||||
* Free the QRcode_List.
|
||||
* @param qrlist a head entry of a QRcode_List.
|
||||
*/
|
||||
extern void QRcode_List_free(QRcode_List *qrlist);
|
||||
|
||||
|
||||
/******************************************************************************
|
||||
* System utilities
|
||||
*****************************************************************************/
|
||||
|
||||
/**
|
||||
* Return a string that identifies the library version.
|
||||
* @param major_version major version number
|
||||
* @param minor_version minor version number
|
||||
* @param micro_version micro version number
|
||||
*/
|
||||
extern void QRcode_APIVersion(int *major_version, int *minor_version, int *micro_version);
|
||||
|
||||
/**
|
||||
* Return a string that identifies the library version.
|
||||
* @return a string identifies the library version. The string is held by the
|
||||
* library. Do NOT free it.
|
||||
*/
|
||||
extern char *QRcode_APIVersionString(void);
|
||||
|
||||
/**
|
||||
* @deprecated
|
||||
*/
|
||||
#ifndef _MSC_VER
|
||||
extern void QRcode_clearCache(void) __attribute__ ((deprecated));
|
||||
#else
|
||||
extern void QRcode_clearCache(void);
|
||||
#endif
|
||||
|
||||
#if defined(__cplusplus)
|
||||
}
|
||||
#endif
|
||||
|
||||
#endif /* QRENCODE_H */
|
@ -0,0 +1,88 @@
|
||||
/**
|
||||
* qrencode - QR Code encoder
|
||||
*
|
||||
* Header for test use
|
||||
* Copyright (C) 2006-2017 Kentaro Fukuchi <kentaro@fukuchi.org>
|
||||
*
|
||||
* This library is free software; you can redistribute it and/or
|
||||
* modify it under the terms of the GNU Lesser General Public
|
||||
* License as published by the Free Software Foundation; either
|
||||
* version 2.1 of the License, or any later version.
|
||||
*
|
||||
* This library is distributed in the hope that it will be useful,
|
||||
* but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
|
||||
* Lesser General Public License for more details.
|
||||
*
|
||||
* You should have received a copy of the GNU Lesser General Public
|
||||
* License along with this library; if not, write to the Free Software
|
||||
* Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA
|
||||
*/
|
||||
|
||||
#ifndef QRENCODE_INNER_H
|
||||
#define QRENCODE_INNER_H
|
||||
|
||||
/**
|
||||
* This header file includes definitions for test use.
|
||||
*/
|
||||
|
||||
/******************************************************************************
|
||||
* Raw code
|
||||
*****************************************************************************/
|
||||
|
||||
typedef struct {
|
||||
int dataLength;
|
||||
int eccLength;
|
||||
unsigned char *data;
|
||||
unsigned char *ecc;
|
||||
} RSblock;
|
||||
|
||||
typedef struct {
|
||||
int version;
|
||||
int dataLength;
|
||||
int eccLength;
|
||||
unsigned char *datacode;
|
||||
unsigned char *ecccode;
|
||||
int b1;
|
||||
int blocks;
|
||||
RSblock *rsblock;
|
||||
int count;
|
||||
} QRRawCode;
|
||||
|
||||
extern QRRawCode *QRraw_new(QRinput *input);
|
||||
extern unsigned char QRraw_getCode(QRRawCode *raw);
|
||||
extern void QRraw_free(QRRawCode *raw);
|
||||
|
||||
/******************************************************************************
|
||||
* Raw code for Micro QR Code
|
||||
*****************************************************************************/
|
||||
|
||||
typedef struct {
|
||||
int version;
|
||||
int dataLength;
|
||||
int eccLength;
|
||||
unsigned char *datacode;
|
||||
unsigned char *ecccode;
|
||||
RSblock *rsblock;
|
||||
int oddbits;
|
||||
int count;
|
||||
} MQRRawCode;
|
||||
|
||||
extern MQRRawCode *MQRraw_new(QRinput *input);
|
||||
extern unsigned char MQRraw_getCode(MQRRawCode *raw);
|
||||
extern void MQRraw_free(MQRRawCode *raw);
|
||||
|
||||
/******************************************************************************
|
||||
* Frame filling
|
||||
*****************************************************************************/
|
||||
extern unsigned char *FrameFiller_test(int version);
|
||||
extern unsigned char *FrameFiller_testMQR(int version);
|
||||
|
||||
/******************************************************************************
|
||||
* QR-code encoding
|
||||
*****************************************************************************/
|
||||
extern QRcode *QRcode_encodeMask(QRinput *input, int mask);
|
||||
extern QRcode *QRcode_encodeMaskMQR(QRinput *input, int mask);
|
||||
extern QRcode *QRcode_new(int version, int width, unsigned char *data);
|
||||
|
||||
#endif /* QRENCODE_INNER_H */
|
@ -0,0 +1,123 @@
|
||||
/*
|
||||
* qrencode - QR Code encoder
|
||||
*
|
||||
* Input data chunk class
|
||||
* Copyright (C) 2006-2017 Kentaro Fukuchi <kentaro@fukuchi.org>
|
||||
*
|
||||
* This library is free software; you can redistribute it and/or
|
||||
* modify it under the terms of the GNU Lesser General Public
|
||||
* License as published by the Free Software Foundation; either
|
||||
* version 2.1 of the License, or any later version.
|
||||
*
|
||||
* This library is distributed in the hope that it will be useful,
|
||||
* but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
|
||||
* Lesser General Public License for more details.
|
||||
*
|
||||
* You should have received a copy of the GNU Lesser General Public
|
||||
* License along with this library; if not, write to the Free Software
|
||||
* Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA
|
||||
*/
|
||||
|
||||
#ifndef QRINPUT_H
|
||||
#define QRINPUT_H
|
||||
|
||||
#include "qrencode.h"
|
||||
#include "bitstream.h"
|
||||
|
||||
int QRinput_isSplittableMode(QRencodeMode mode);
|
||||
|
||||
/******************************************************************************
|
||||
* Entry of input data
|
||||
*****************************************************************************/
|
||||
typedef struct _QRinput_List QRinput_List;
|
||||
|
||||
struct _QRinput_List {
|
||||
QRencodeMode mode;
|
||||
int size; ///< Size of data chunk (byte).
|
||||
unsigned char *data; ///< Data chunk.
|
||||
BitStream *bstream;
|
||||
QRinput_List *next;
|
||||
};
|
||||
|
||||
/******************************************************************************
|
||||
* Input Data
|
||||
*****************************************************************************/
|
||||
struct _QRinput {
|
||||
int version;
|
||||
QRecLevel level;
|
||||
QRinput_List *head;
|
||||
QRinput_List *tail;
|
||||
int mqr;
|
||||
int fnc1;
|
||||
unsigned char appid;
|
||||
};
|
||||
|
||||
/******************************************************************************
|
||||
* Structured append input data
|
||||
*****************************************************************************/
|
||||
typedef struct _QRinput_InputList QRinput_InputList;
|
||||
|
||||
struct _QRinput_InputList {
|
||||
QRinput *input;
|
||||
QRinput_InputList *next;
|
||||
};
|
||||
|
||||
struct _QRinput_Struct {
|
||||
int size; ///< number of structured symbols
|
||||
int parity;
|
||||
QRinput_InputList *head;
|
||||
QRinput_InputList *tail;
|
||||
};
|
||||
|
||||
/**
|
||||
* Pack all bit streams padding bits into a byte array.
|
||||
* @param input input data.
|
||||
* @return padded merged byte stream
|
||||
*/
|
||||
extern unsigned char *QRinput_getByteStream(QRinput *input);
|
||||
|
||||
|
||||
extern int QRinput_estimateBitsModeNum(int size);
|
||||
extern int QRinput_estimateBitsModeAn(int size);
|
||||
extern int QRinput_estimateBitsMode8(int size);
|
||||
extern int QRinput_estimateBitsModeKanji(int size);
|
||||
|
||||
extern QRinput *QRinput_dup(QRinput *input);
|
||||
|
||||
extern const signed char QRinput_anTable[128];
|
||||
|
||||
/**
|
||||
* Look up the alphabet-numeric convesion table (see JIS X0510:2004, pp.19).
|
||||
* @param __c__ character
|
||||
* @return value
|
||||
*/
|
||||
#define QRinput_lookAnTable(__c__) \
|
||||
((__c__ & 0x80)?-1:QRinput_anTable[(int)__c__])
|
||||
|
||||
/**
|
||||
* Length of a standard mode indicator in bits.
|
||||
*/
|
||||
|
||||
#define MODE_INDICATOR_SIZE 4
|
||||
|
||||
/**
|
||||
* Length of a segment of structured-append header.
|
||||
*/
|
||||
#define STRUCTURE_HEADER_SIZE 20
|
||||
|
||||
/**
|
||||
* Maximum number of symbols in a set of structured-appended symbols.
|
||||
*/
|
||||
#define MAX_STRUCTURED_SYMBOLS 16
|
||||
|
||||
#ifdef WITH_TESTS
|
||||
extern int QRinput_mergeBitStream(QRinput *input, BitStream *bstream);
|
||||
extern int QRinput_getBitStream(QRinput *input, BitStream *bstream);
|
||||
extern int QRinput_estimateBitStreamSize(QRinput *input, int version);
|
||||
extern int QRinput_splitEntry(QRinput_List *entry, int bytes);
|
||||
extern int QRinput_lengthOfCode(QRencodeMode mode, int version, int bits);
|
||||
extern int QRinput_insertStructuredAppendHeader(QRinput *input, int size, int index, unsigned char parity);
|
||||
#endif
|
||||
|
||||
#endif /* QRINPUT_H */
|
@ -0,0 +1,512 @@
|
||||
/*
|
||||
* qrencode - QR Code encoder
|
||||
*
|
||||
* QR Code specification in convenient format.
|
||||
* Copyright (C) 2006-2017 Kentaro Fukuchi <kentaro@fukuchi.org>
|
||||
*
|
||||
* The following data / specifications are taken from
|
||||
* "Two dimensional symbol -- QR-code -- Basic Specification" (JIS X0510:2004)
|
||||
* or
|
||||
* "Automatic identification and data capture techniques --
|
||||
* QR Code 2005 bar code symbology specification" (ISO/IEC 18004:2006)
|
||||
*
|
||||
* This library is free software; you can redistribute it and/or
|
||||
* modify it under the terms of the GNU Lesser General Public
|
||||
* License as published by the Free Software Foundation; either
|
||||
* version 2.1 of the License, or any later version.
|
||||
*
|
||||
* This library is distributed in the hope that it will be useful,
|
||||
* but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
|
||||
* Lesser General Public License for more details.
|
||||
*
|
||||
* You should have received a copy of the GNU Lesser General Public
|
||||
* License along with this library; if not, write to the Free Software
|
||||
* Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA
|
||||
*/
|
||||
|
||||
# include "config.h"
|
||||
#include <stdio.h>
|
||||
#include <stdlib.h>
|
||||
#include <string.h>
|
||||
#include <errno.h>
|
||||
|
||||
#include "qrspec.h"
|
||||
#include "qrinput.h"
|
||||
|
||||
/******************************************************************************
|
||||
* Version and capacity
|
||||
*****************************************************************************/
|
||||
|
||||
typedef struct {
|
||||
int width; //< Edge length of the symbol
|
||||
int words; //< Data capacity (bytes)
|
||||
int remainder; //< Remainder bit (bits)
|
||||
int ec[4]; //< Number of ECC code (bytes)
|
||||
} QRspec_Capacity;
|
||||
|
||||
/**
|
||||
* Table of the capacity of symbols
|
||||
* See Table 1 (pp.13) and Table 12-16 (pp.30-36), JIS X0510:2004.
|
||||
*/
|
||||
static const QRspec_Capacity qrspecCapacity[QRSPEC_VERSION_MAX + 1] = {
|
||||
{ 0, 0, 0, { 0, 0, 0, 0}},
|
||||
{ 21, 26, 0, { 7, 10, 13, 17}}, // 1
|
||||
{ 25, 44, 7, { 10, 16, 22, 28}},
|
||||
{ 29, 70, 7, { 15, 26, 36, 44}},
|
||||
{ 33, 100, 7, { 20, 36, 52, 64}},
|
||||
{ 37, 134, 7, { 26, 48, 72, 88}}, // 5
|
||||
{ 41, 172, 7, { 36, 64, 96, 112}},
|
||||
{ 45, 196, 0, { 40, 72, 108, 130}},
|
||||
{ 49, 242, 0, { 48, 88, 132, 156}},
|
||||
{ 53, 292, 0, { 60, 110, 160, 192}},
|
||||
{ 57, 346, 0, { 72, 130, 192, 224}}, //10
|
||||
{ 61, 404, 0, { 80, 150, 224, 264}},
|
||||
{ 65, 466, 0, { 96, 176, 260, 308}},
|
||||
{ 69, 532, 0, { 104, 198, 288, 352}},
|
||||
{ 73, 581, 3, { 120, 216, 320, 384}},
|
||||
{ 77, 655, 3, { 132, 240, 360, 432}}, //15
|
||||
{ 81, 733, 3, { 144, 280, 408, 480}},
|
||||
{ 85, 815, 3, { 168, 308, 448, 532}},
|
||||
{ 89, 901, 3, { 180, 338, 504, 588}},
|
||||
{ 93, 991, 3, { 196, 364, 546, 650}},
|
||||
{ 97, 1085, 3, { 224, 416, 600, 700}}, //20
|
||||
{101, 1156, 4, { 224, 442, 644, 750}},
|
||||
{105, 1258, 4, { 252, 476, 690, 816}},
|
||||
{109, 1364, 4, { 270, 504, 750, 900}},
|
||||
{113, 1474, 4, { 300, 560, 810, 960}},
|
||||
{117, 1588, 4, { 312, 588, 870, 1050}}, //25
|
||||
{121, 1706, 4, { 336, 644, 952, 1110}},
|
||||
{125, 1828, 4, { 360, 700, 1020, 1200}},
|
||||
{129, 1921, 3, { 390, 728, 1050, 1260}},
|
||||
{133, 2051, 3, { 420, 784, 1140, 1350}},
|
||||
{137, 2185, 3, { 450, 812, 1200, 1440}}, //30
|
||||
{141, 2323, 3, { 480, 868, 1290, 1530}},
|
||||
{145, 2465, 3, { 510, 924, 1350, 1620}},
|
||||
{149, 2611, 3, { 540, 980, 1440, 1710}},
|
||||
{153, 2761, 3, { 570, 1036, 1530, 1800}},
|
||||
{157, 2876, 0, { 570, 1064, 1590, 1890}}, //35
|
||||
{161, 3034, 0, { 600, 1120, 1680, 1980}},
|
||||
{165, 3196, 0, { 630, 1204, 1770, 2100}},
|
||||
{169, 3362, 0, { 660, 1260, 1860, 2220}},
|
||||
{173, 3532, 0, { 720, 1316, 1950, 2310}},
|
||||
{177, 3706, 0, { 750, 1372, 2040, 2430}} //40
|
||||
};
|
||||
|
||||
int QRspec_getDataLength(int version, QRecLevel level)
|
||||
{
|
||||
return qrspecCapacity[version].words - qrspecCapacity[version].ec[level];
|
||||
}
|
||||
|
||||
int QRspec_getECCLength(int version, QRecLevel level)
|
||||
{
|
||||
return qrspecCapacity[version].ec[level];
|
||||
}
|
||||
|
||||
int QRspec_getMinimumVersion(int size, QRecLevel level)
|
||||
{
|
||||
int i;
|
||||
int words;
|
||||
|
||||
for(i = 1; i <= QRSPEC_VERSION_MAX; i++) {
|
||||
words = qrspecCapacity[i].words - qrspecCapacity[i].ec[level];
|
||||
if(words >= size) return i;
|
||||
}
|
||||
|
||||
return QRSPEC_VERSION_MAX;
|
||||
}
|
||||
|
||||
int QRspec_getWidth(int version)
|
||||
{
|
||||
return qrspecCapacity[version].width;
|
||||
}
|
||||
|
||||
int QRspec_getRemainder(int version)
|
||||
{
|
||||
return qrspecCapacity[version].remainder;
|
||||
}
|
||||
|
||||
/******************************************************************************
|
||||
* Length indicator
|
||||
*****************************************************************************/
|
||||
|
||||
static const int lengthTableBits[4][3] = {
|
||||
{10, 12, 14},
|
||||
{ 9, 11, 13},
|
||||
{ 8, 16, 16},
|
||||
{ 8, 10, 12}
|
||||
};
|
||||
|
||||
int QRspec_lengthIndicator(QRencodeMode mode, int version)
|
||||
{
|
||||
int l;
|
||||
|
||||
if(!QRinput_isSplittableMode(mode)) return 0;
|
||||
if(version <= 9) {
|
||||
l = 0;
|
||||
} else if(version <= 26) {
|
||||
l = 1;
|
||||
} else {
|
||||
l = 2;
|
||||
}
|
||||
|
||||
return lengthTableBits[mode][l];
|
||||
}
|
||||
|
||||
int QRspec_maximumWords(QRencodeMode mode, int version)
|
||||
{
|
||||
int l;
|
||||
int bits;
|
||||
int words;
|
||||
|
||||
if(!QRinput_isSplittableMode(mode)) return 0;
|
||||
if(version <= 9) {
|
||||
l = 0;
|
||||
} else if(version <= 26) {
|
||||
l = 1;
|
||||
} else {
|
||||
l = 2;
|
||||
}
|
||||
|
||||
bits = lengthTableBits[mode][l];
|
||||
words = (1 << bits) - 1;
|
||||
if(mode == QR_MODE_KANJI) {
|
||||
words *= 2; // the number of bytes is required
|
||||
}
|
||||
|
||||
return words;
|
||||
}
|
||||
|
||||
/******************************************************************************
|
||||
* Error correction code
|
||||
*****************************************************************************/
|
||||
|
||||
/**
|
||||
* Table of the error correction code (Reed-Solomon block)
|
||||
* See Table 12-16 (pp.30-36), JIS X0510:2004.
|
||||
*/
|
||||
static const int eccTable[QRSPEC_VERSION_MAX+1][4][2] = {
|
||||
{{ 0, 0}, { 0, 0}, { 0, 0}, { 0, 0}},
|
||||
{{ 1, 0}, { 1, 0}, { 1, 0}, { 1, 0}}, // 1
|
||||
{{ 1, 0}, { 1, 0}, { 1, 0}, { 1, 0}},
|
||||
{{ 1, 0}, { 1, 0}, { 2, 0}, { 2, 0}},
|
||||
{{ 1, 0}, { 2, 0}, { 2, 0}, { 4, 0}},
|
||||
{{ 1, 0}, { 2, 0}, { 2, 2}, { 2, 2}}, // 5
|
||||
{{ 2, 0}, { 4, 0}, { 4, 0}, { 4, 0}},
|
||||
{{ 2, 0}, { 4, 0}, { 2, 4}, { 4, 1}},
|
||||
{{ 2, 0}, { 2, 2}, { 4, 2}, { 4, 2}},
|
||||
{{ 2, 0}, { 3, 2}, { 4, 4}, { 4, 4}},
|
||||
{{ 2, 2}, { 4, 1}, { 6, 2}, { 6, 2}}, //10
|
||||
{{ 4, 0}, { 1, 4}, { 4, 4}, { 3, 8}},
|
||||
{{ 2, 2}, { 6, 2}, { 4, 6}, { 7, 4}},
|
||||
{{ 4, 0}, { 8, 1}, { 8, 4}, {12, 4}},
|
||||
{{ 3, 1}, { 4, 5}, {11, 5}, {11, 5}},
|
||||
{{ 5, 1}, { 5, 5}, { 5, 7}, {11, 7}}, //15
|
||||
{{ 5, 1}, { 7, 3}, {15, 2}, { 3, 13}},
|
||||
{{ 1, 5}, {10, 1}, { 1, 15}, { 2, 17}},
|
||||
{{ 5, 1}, { 9, 4}, {17, 1}, { 2, 19}},
|
||||
{{ 3, 4}, { 3, 11}, {17, 4}, { 9, 16}},
|
||||
{{ 3, 5}, { 3, 13}, {15, 5}, {15, 10}}, //20
|
||||
{{ 4, 4}, {17, 0}, {17, 6}, {19, 6}},
|
||||
{{ 2, 7}, {17, 0}, { 7, 16}, {34, 0}},
|
||||
{{ 4, 5}, { 4, 14}, {11, 14}, {16, 14}},
|
||||
{{ 6, 4}, { 6, 14}, {11, 16}, {30, 2}},
|
||||
{{ 8, 4}, { 8, 13}, { 7, 22}, {22, 13}}, //25
|
||||
{{10, 2}, {19, 4}, {28, 6}, {33, 4}},
|
||||
{{ 8, 4}, {22, 3}, { 8, 26}, {12, 28}},
|
||||
{{ 3, 10}, { 3, 23}, { 4, 31}, {11, 31}},
|
||||
{{ 7, 7}, {21, 7}, { 1, 37}, {19, 26}},
|
||||
{{ 5, 10}, {19, 10}, {15, 25}, {23, 25}}, //30
|
||||
{{13, 3}, { 2, 29}, {42, 1}, {23, 28}},
|
||||
{{17, 0}, {10, 23}, {10, 35}, {19, 35}},
|
||||
{{17, 1}, {14, 21}, {29, 19}, {11, 46}},
|
||||
{{13, 6}, {14, 23}, {44, 7}, {59, 1}},
|
||||
{{12, 7}, {12, 26}, {39, 14}, {22, 41}}, //35
|
||||
{{ 6, 14}, { 6, 34}, {46, 10}, { 2, 64}},
|
||||
{{17, 4}, {29, 14}, {49, 10}, {24, 46}},
|
||||
{{ 4, 18}, {13, 32}, {48, 14}, {42, 32}},
|
||||
{{20, 4}, {40, 7}, {43, 22}, {10, 67}},
|
||||
{{19, 6}, {18, 31}, {34, 34}, {20, 61}},//40
|
||||
};
|
||||
|
||||
void QRspec_getEccSpec(int version, QRecLevel level, int spec[5])
|
||||
{
|
||||
int b1, b2;
|
||||
int data, ecc;
|
||||
|
||||
b1 = eccTable[version][level][0];
|
||||
b2 = eccTable[version][level][1];
|
||||
data = QRspec_getDataLength(version, level);
|
||||
ecc = QRspec_getECCLength(version, level);
|
||||
|
||||
if(b2 == 0) {
|
||||
spec[0] = b1;
|
||||
spec[1] = data / b1;
|
||||
spec[2] = ecc / b1;
|
||||
spec[3] = spec[4] = 0;
|
||||
} else {
|
||||
spec[0] = b1;
|
||||
spec[1] = data / (b1 + b2);
|
||||
spec[2] = ecc / (b1 + b2);
|
||||
spec[3] = b2;
|
||||
spec[4] = spec[1] + 1;
|
||||
}
|
||||
}
|
||||
|
||||
/******************************************************************************
|
||||
* Alignment pattern
|
||||
*****************************************************************************/
|
||||
|
||||
/**
|
||||
* Positions of alignment patterns.
|
||||
* This array includes only the second and the third position of the alignment
|
||||
* patterns. Rest of them can be calculated from the distance between them.
|
||||
*
|
||||
* See Table 1 in Appendix E (pp.71) of JIS X0510:2004.
|
||||
*/
|
||||
static const int alignmentPattern[QRSPEC_VERSION_MAX+1][2] = {
|
||||
{ 0, 0},
|
||||
{ 0, 0}, {18, 0}, {22, 0}, {26, 0}, {30, 0}, // 1- 5
|
||||
{34, 0}, {22, 38}, {24, 42}, {26, 46}, {28, 50}, // 6-10
|
||||
{30, 54}, {32, 58}, {34, 62}, {26, 46}, {26, 48}, //11-15
|
||||
{26, 50}, {30, 54}, {30, 56}, {30, 58}, {34, 62}, //16-20
|
||||
{28, 50}, {26, 50}, {30, 54}, {28, 54}, {32, 58}, //21-25
|
||||
{30, 58}, {34, 62}, {26, 50}, {30, 54}, {26, 52}, //26-30
|
||||
{30, 56}, {34, 60}, {30, 58}, {34, 62}, {30, 54}, //31-35
|
||||
{24, 50}, {28, 54}, {32, 58}, {26, 54}, {30, 58}, //35-40
|
||||
};
|
||||
|
||||
/**
|
||||
* Put an alignment marker.
|
||||
* @param frame
|
||||
* @param width
|
||||
* @param ox,oy center coordinate of the pattern
|
||||
*/
|
||||
static void QRspec_putAlignmentMarker(unsigned char *frame, int width, int ox, int oy)
|
||||
{
|
||||
static const unsigned char finder[] = {
|
||||
0xa1, 0xa1, 0xa1, 0xa1, 0xa1,
|
||||
0xa1, 0xa0, 0xa0, 0xa0, 0xa1,
|
||||
0xa1, 0xa0, 0xa1, 0xa0, 0xa1,
|
||||
0xa1, 0xa0, 0xa0, 0xa0, 0xa1,
|
||||
0xa1, 0xa1, 0xa1, 0xa1, 0xa1,
|
||||
};
|
||||
int x, y;
|
||||
const unsigned char *s;
|
||||
|
||||
frame += (oy - 2) * width + ox - 2;
|
||||
s = finder;
|
||||
for(y = 0; y < 5; y++) {
|
||||
for(x = 0; x < 5; x++) {
|
||||
frame[x] = s[x];
|
||||
}
|
||||
frame += width;
|
||||
s += 5;
|
||||
}
|
||||
}
|
||||
|
||||
static void QRspec_putAlignmentPattern(int version, unsigned char *frame, int width)
|
||||
{
|
||||
int d, w, x, y, cx, cy;
|
||||
|
||||
if(version < 2) return;
|
||||
|
||||
d = alignmentPattern[version][1] - alignmentPattern[version][0];
|
||||
if(d < 0) {
|
||||
w = 2;
|
||||
} else {
|
||||
w = (width - alignmentPattern[version][0]) / d + 2;
|
||||
}
|
||||
|
||||
if(w * w - 3 == 1) {
|
||||
x = alignmentPattern[version][0];
|
||||
y = alignmentPattern[version][0];
|
||||
QRspec_putAlignmentMarker(frame, width, x, y);
|
||||
return;
|
||||
}
|
||||
|
||||
cx = alignmentPattern[version][0];
|
||||
for(x = 1; x < w - 1; x++) {
|
||||
QRspec_putAlignmentMarker(frame, width, 6, cx);
|
||||
QRspec_putAlignmentMarker(frame, width, cx, 6);
|
||||
cx += d;
|
||||
}
|
||||
|
||||
cy = alignmentPattern[version][0];
|
||||
for(y = 0; y < w-1; y++) {
|
||||
cx = alignmentPattern[version][0];
|
||||
for(x = 0; x < w-1; x++) {
|
||||
QRspec_putAlignmentMarker(frame, width, cx, cy);
|
||||
cx += d;
|
||||
}
|
||||
cy += d;
|
||||
}
|
||||
}
|
||||
|
||||
/******************************************************************************
|
||||
* Version information pattern
|
||||
*****************************************************************************/
|
||||
|
||||
/**
|
||||
* Version information pattern (BCH coded).
|
||||
* See Table 1 in Appendix D (pp.68) of JIS X0510:2004.
|
||||
*/
|
||||
static const unsigned int versionPattern[QRSPEC_VERSION_MAX - 6] = {
|
||||
0x07c94, 0x085bc, 0x09a99, 0x0a4d3, 0x0bbf6, 0x0c762, 0x0d847, 0x0e60d,
|
||||
0x0f928, 0x10b78, 0x1145d, 0x12a17, 0x13532, 0x149a6, 0x15683, 0x168c9,
|
||||
0x177ec, 0x18ec4, 0x191e1, 0x1afab, 0x1b08e, 0x1cc1a, 0x1d33f, 0x1ed75,
|
||||
0x1f250, 0x209d5, 0x216f0, 0x228ba, 0x2379f, 0x24b0b, 0x2542e, 0x26a64,
|
||||
0x27541, 0x28c69
|
||||
};
|
||||
|
||||
unsigned int QRspec_getVersionPattern(int version)
|
||||
{
|
||||
if(version < 7 || version > QRSPEC_VERSION_MAX) return 0;
|
||||
|
||||
return versionPattern[version - 7];
|
||||
}
|
||||
|
||||
/******************************************************************************
|
||||
* Format information
|
||||
*****************************************************************************/
|
||||
|
||||
/* See calcFormatInfo in tests/test_qrspec.c */
|
||||
static const unsigned int formatInfo[4][8] = {
|
||||
{0x77c4, 0x72f3, 0x7daa, 0x789d, 0x662f, 0x6318, 0x6c41, 0x6976},
|
||||
{0x5412, 0x5125, 0x5e7c, 0x5b4b, 0x45f9, 0x40ce, 0x4f97, 0x4aa0},
|
||||
{0x355f, 0x3068, 0x3f31, 0x3a06, 0x24b4, 0x2183, 0x2eda, 0x2bed},
|
||||
{0x1689, 0x13be, 0x1ce7, 0x19d0, 0x0762, 0x0255, 0x0d0c, 0x083b}
|
||||
};
|
||||
|
||||
unsigned int QRspec_getFormatInfo(int mask, QRecLevel level)
|
||||
{
|
||||
if(mask < 0 || mask > 7) return 0;
|
||||
|
||||
return formatInfo[level][mask];
|
||||
}
|
||||
|
||||
/******************************************************************************
|
||||
* Frame
|
||||
*****************************************************************************/
|
||||
|
||||
/**
|
||||
* Put a finder pattern.
|
||||
* @param frame
|
||||
* @param width
|
||||
* @param ox,oy upper-left coordinate of the pattern
|
||||
*/
|
||||
static void putFinderPattern(unsigned char *frame, int width, int ox, int oy)
|
||||
{
|
||||
static const unsigned char finder[] = {
|
||||
0xc1, 0xc1, 0xc1, 0xc1, 0xc1, 0xc1, 0xc1,
|
||||
0xc1, 0xc0, 0xc0, 0xc0, 0xc0, 0xc0, 0xc1,
|
||||
0xc1, 0xc0, 0xc1, 0xc1, 0xc1, 0xc0, 0xc1,
|
||||
0xc1, 0xc0, 0xc1, 0xc1, 0xc1, 0xc0, 0xc1,
|
||||
0xc1, 0xc0, 0xc1, 0xc1, 0xc1, 0xc0, 0xc1,
|
||||
0xc1, 0xc0, 0xc0, 0xc0, 0xc0, 0xc0, 0xc1,
|
||||
0xc1, 0xc1, 0xc1, 0xc1, 0xc1, 0xc1, 0xc1,
|
||||
};
|
||||
int x, y;
|
||||
const unsigned char *s;
|
||||
|
||||
frame += oy * width + ox;
|
||||
s = finder;
|
||||
for(y = 0; y < 7; y++) {
|
||||
for(x = 0; x < 7; x++) {
|
||||
frame[x] = s[x];
|
||||
}
|
||||
frame += width;
|
||||
s += 7;
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
static unsigned char *QRspec_createFrame(int version)
|
||||
{
|
||||
unsigned char *frame, *p, *q;
|
||||
int width;
|
||||
int x, y;
|
||||
unsigned int verinfo, v;
|
||||
|
||||
width = qrspecCapacity[version].width;
|
||||
frame = (unsigned char *)TKMEM_ALLOC((size_t)(width * width));
|
||||
if(frame == NULL) return NULL;
|
||||
|
||||
memset(frame, 0, (size_t)(width * width));
|
||||
/* Finder pattern */
|
||||
putFinderPattern(frame, width, 0, 0);
|
||||
putFinderPattern(frame, width, width - 7, 0);
|
||||
putFinderPattern(frame, width, 0, width - 7);
|
||||
/* Separator */
|
||||
p = frame;
|
||||
q = frame + width * (width - 7);
|
||||
for(y = 0; y < 7; y++) {
|
||||
p[7] = 0xc0;
|
||||
p[width - 8] = 0xc0;
|
||||
q[7] = 0xc0;
|
||||
p += width;
|
||||
q += width;
|
||||
}
|
||||
memset(frame + width * 7, 0xc0, 8);
|
||||
memset(frame + width * 8 - 8, 0xc0, 8);
|
||||
memset(frame + width * (width - 8), 0xc0, 8);
|
||||
/* Mask format information area */
|
||||
memset(frame + width * 8, 0x84, 9);
|
||||
memset(frame + width * 9 - 8, 0x84, 8);
|
||||
p = frame + 8;
|
||||
for(y = 0; y < 8; y++) {
|
||||
*p = 0x84;
|
||||
p += width;
|
||||
}
|
||||
p = frame + width * (width - 7) + 8;
|
||||
for(y = 0; y < 7; y++) {
|
||||
*p = 0x84;
|
||||
p += width;
|
||||
}
|
||||
/* Timing pattern */
|
||||
p = frame + width * 6 + 8;
|
||||
q = frame + width * 8 + 6;
|
||||
for(x = 1; x < width-15; x++) {
|
||||
*p = 0x90 | (x & 1);
|
||||
*q = 0x90 | (x & 1);
|
||||
p++;
|
||||
q += width;
|
||||
}
|
||||
/* Alignment pattern */
|
||||
QRspec_putAlignmentPattern(version, frame, width);
|
||||
|
||||
/* Version information */
|
||||
if(version >= 7) {
|
||||
verinfo = QRspec_getVersionPattern(version);
|
||||
|
||||
p = frame + width * (width - 11);
|
||||
v = verinfo;
|
||||
for(x = 0; x < 6; x++) {
|
||||
for(y = 0; y < 3; y++) {
|
||||
p[width * y + x] = 0x88 | (v & 1);
|
||||
v = v >> 1;
|
||||
}
|
||||
}
|
||||
|
||||
p = frame + width - 11;
|
||||
v = verinfo;
|
||||
for(y = 0; y < 6; y++) {
|
||||
for(x = 0; x < 3; x++) {
|
||||
p[x] = 0x88 | (v & 1);
|
||||
v = v >> 1;
|
||||
}
|
||||
p += width;
|
||||
}
|
||||
}
|
||||
/* and a little bit... */
|
||||
frame[width * (width - 8) + 8] = 0x81;
|
||||
|
||||
return frame;
|
||||
}
|
||||
|
||||
unsigned char *QRspec_newFrame(int version)
|
||||
{
|
||||
if(version < 1 || version > QRSPEC_VERSION_MAX) return NULL;
|
||||
|
||||
return QRspec_createFrame(version);
|
||||
}
|
@ -0,0 +1,174 @@
|
||||
/*
|
||||
* qrencode - QR Code encoder
|
||||
*
|
||||
* QR Code specification in convenient format.
|
||||
* Copyright (C) 2006-2017 Kentaro Fukuchi <kentaro@fukuchi.org>
|
||||
*
|
||||
* This library is free software; you can redistribute it and/or
|
||||
* modify it under the terms of the GNU Lesser General Public
|
||||
* License as published by the Free Software Foundation; either
|
||||
* version 2.1 of the License, or any later version.
|
||||
*
|
||||
* This library is distributed in the hope that it will be useful,
|
||||
* but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
|
||||
* Lesser General Public License for more details.
|
||||
*
|
||||
* You should have received a copy of the GNU Lesser General Public
|
||||
* License along with this library; if not, write to the Free Software
|
||||
* Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA
|
||||
*/
|
||||
|
||||
#ifndef QRSPEC_H
|
||||
#define QRSPEC_H
|
||||
|
||||
#include "qrencode.h"
|
||||
|
||||
/******************************************************************************
|
||||
* Version and capacity
|
||||
*****************************************************************************/
|
||||
|
||||
/**
|
||||
* Maximum width of a symbol
|
||||
*/
|
||||
#define QRSPEC_WIDTH_MAX 177
|
||||
|
||||
/**
|
||||
* Return maximum data code length (bytes) for the version.
|
||||
* @param version version of the symbol
|
||||
* @param level error correction level
|
||||
* @return maximum size (bytes)
|
||||
*/
|
||||
extern int QRspec_getDataLength(int version, QRecLevel level);
|
||||
|
||||
/**
|
||||
* Return maximum error correction code length (bytes) for the version.
|
||||
* @param version version of the symbol
|
||||
* @param level error correction level
|
||||
* @return ECC size (bytes)
|
||||
*/
|
||||
extern int QRspec_getECCLength(int version, QRecLevel level);
|
||||
|
||||
/**
|
||||
* Return a version number that satisfies the input code length.
|
||||
* @param size input code length (byte)
|
||||
* @param level error correction level
|
||||
* @return version number
|
||||
*/
|
||||
extern int QRspec_getMinimumVersion(int size, QRecLevel level);
|
||||
|
||||
/**
|
||||
* Return the width of the symbol for the version.
|
||||
* @param version vesion of the symbol
|
||||
* @return width of the symbol
|
||||
*/
|
||||
extern int QRspec_getWidth(int version);
|
||||
|
||||
/**
|
||||
* Return the numer of remainder bits.
|
||||
* @param version vesion of the symbol
|
||||
* @return number of remainder bits
|
||||
*/
|
||||
extern int QRspec_getRemainder(int version);
|
||||
|
||||
/******************************************************************************
|
||||
* Length indicator
|
||||
*****************************************************************************/
|
||||
|
||||
/**
|
||||
* Return the size of length indicator for the mode and version.
|
||||
* @param mode encode mode
|
||||
* @param version vesion of the symbol
|
||||
* @return the size of the appropriate length indicator (bits).
|
||||
*/
|
||||
extern int QRspec_lengthIndicator(QRencodeMode mode, int version);
|
||||
|
||||
/**
|
||||
* Return the maximum length for the mode and version.
|
||||
* @param mode encode mode
|
||||
* @param version vesion of the symbol
|
||||
* @return the maximum length (bytes)
|
||||
*/
|
||||
extern int QRspec_maximumWords(QRencodeMode mode, int version);
|
||||
|
||||
/******************************************************************************
|
||||
* Error correction code
|
||||
*****************************************************************************/
|
||||
|
||||
/**
|
||||
* Return an array of ECC specification.
|
||||
* @param version version of the symbol
|
||||
* @param level error correction level
|
||||
* @param spec an array of ECC specification contains as following:
|
||||
* {# of type1 blocks, # of data code, # of ecc code,
|
||||
* # of type2 blocks, # of data code}
|
||||
*/
|
||||
void QRspec_getEccSpec(int version, QRecLevel level, int spec[5]);
|
||||
|
||||
#define QRspec_rsBlockNum(__spec__) (__spec__[0] + __spec__[3])
|
||||
#define QRspec_rsBlockNum1(__spec__) (__spec__[0])
|
||||
#define QRspec_rsDataCodes1(__spec__) (__spec__[1])
|
||||
#define QRspec_rsEccCodes1(__spec__) (__spec__[2])
|
||||
#define QRspec_rsBlockNum2(__spec__) (__spec__[3])
|
||||
#define QRspec_rsDataCodes2(__spec__) (__spec__[4])
|
||||
#define QRspec_rsEccCodes2(__spec__) (__spec__[2])
|
||||
|
||||
#define QRspec_rsDataLength(__spec__) \
|
||||
((QRspec_rsBlockNum1(__spec__) * QRspec_rsDataCodes1(__spec__)) + \
|
||||
(QRspec_rsBlockNum2(__spec__) * QRspec_rsDataCodes2(__spec__)))
|
||||
#define QRspec_rsEccLength(__spec__) \
|
||||
(QRspec_rsBlockNum(__spec__) * QRspec_rsEccCodes1(__spec__))
|
||||
|
||||
/******************************************************************************
|
||||
* Version information pattern
|
||||
*****************************************************************************/
|
||||
|
||||
/**
|
||||
* Return BCH encoded version information pattern that is used for the symbol
|
||||
* of version 7 or greater. Use lower 18 bits.
|
||||
* @param version version of the symbol
|
||||
* @return BCH encoded version information pattern
|
||||
*/
|
||||
extern unsigned int QRspec_getVersionPattern(int version);
|
||||
|
||||
/******************************************************************************
|
||||
* Format information
|
||||
*****************************************************************************/
|
||||
|
||||
/**
|
||||
* Return BCH encoded format information pattern.
|
||||
* @param mask mask number
|
||||
* @param level error correction level
|
||||
* @return BCH encoded format information pattern
|
||||
*/
|
||||
extern unsigned int QRspec_getFormatInfo(int mask, QRecLevel level);
|
||||
|
||||
/******************************************************************************
|
||||
* Frame
|
||||
*****************************************************************************/
|
||||
|
||||
/**
|
||||
* Return a copy of initialized frame.
|
||||
* @param version version of the symbol
|
||||
* @return Array of unsigned char. You can free it by free().
|
||||
*/
|
||||
extern unsigned char *QRspec_newFrame(int version);
|
||||
|
||||
/******************************************************************************
|
||||
* Mode indicator
|
||||
*****************************************************************************/
|
||||
|
||||
/**
|
||||
* Mode indicator. See Table 2 of JIS X0510:2004, pp.16.
|
||||
*/
|
||||
#define QRSPEC_MODEID_ECI 7
|
||||
#define QRSPEC_MODEID_NUM 1
|
||||
#define QRSPEC_MODEID_AN 2
|
||||
#define QRSPEC_MODEID_8 4
|
||||
#define QRSPEC_MODEID_KANJI 8
|
||||
#define QRSPEC_MODEID_FNC1FIRST 5
|
||||
#define QRSPEC_MODEID_FNC1SECOND 9
|
||||
#define QRSPEC_MODEID_STRUCTURE 3
|
||||
#define QRSPEC_MODEID_TERMINATOR 0
|
||||
|
||||
#endif /* QRSPEC_H */
|
@ -0,0 +1,149 @@
|
||||
/*
|
||||
* qrencode - QR Code encoder
|
||||
*
|
||||
* Reed solomon error correction code encoder specialized for QR code.
|
||||
* This code is rewritten by Kentaro Fukuchi, referring to the FEC library
|
||||
* developed by Phil Karn (KA9Q).
|
||||
*
|
||||
* Copyright (C) 2002, 2003, 2004, 2006 Phil Karn, KA9Q
|
||||
* Copyright (C) 2014-2017 Kentaro Fukuchi <kentaro@fukuchi.org>
|
||||
*
|
||||
* This library is free software; you can redistribute it and/or
|
||||
* modify it under the terms of the GNU Lesser General Public
|
||||
* License as published by the Free Software Foundation; either
|
||||
* version 2.1 of the License, or any later version.
|
||||
*
|
||||
* This library is distributed in the hope that it will be useful,
|
||||
* but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
|
||||
* Lesser General Public License for more details.
|
||||
*
|
||||
* You should have received a copy of the GNU Lesser General Public
|
||||
* License along with this library; if not, write to the Free Software
|
||||
* Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA
|
||||
*/
|
||||
|
||||
#if HAVE_CONFIG_H
|
||||
# include "config.h"
|
||||
#endif
|
||||
#include <stdlib.h>
|
||||
#include <string.h>
|
||||
#if HAVE_LIBPTHREAD
|
||||
#include <pthread.h>
|
||||
#endif
|
||||
|
||||
#include "rsecc.h"
|
||||
|
||||
#if HAVE_LIBPTHREAD
|
||||
static pthread_mutex_t RSECC_mutex = PTHREAD_MUTEX_INITIALIZER;
|
||||
#endif
|
||||
|
||||
static int initialized = 0;
|
||||
|
||||
#define SYMBOL_SIZE (8)
|
||||
#define symbols ((1U << SYMBOL_SIZE) - 1)
|
||||
static const unsigned int proot = 0x11d; /* stands for x^8+x^4+x^3+x^2+1 (see pp.37 of JIS X0510:2004) */
|
||||
|
||||
/* min/max codeword length of ECC, calculated from the specification. */
|
||||
#define min_length (2)
|
||||
#define max_length (30)
|
||||
#define max_generatorSize (max_length)
|
||||
|
||||
static unsigned char alpha[symbols + 1];
|
||||
static unsigned char aindex[symbols + 1];
|
||||
static unsigned char generator[max_length - min_length + 1][max_generatorSize + 1];
|
||||
static unsigned char generatorInitialized[max_length - min_length + 1];
|
||||
|
||||
static void RSECC_initLookupTable(void)
|
||||
{
|
||||
unsigned int i, b;
|
||||
|
||||
alpha[symbols] = 0;
|
||||
aindex[0] = symbols;
|
||||
|
||||
b = 1;
|
||||
for(i = 0; i < symbols; i++) {
|
||||
alpha[i] = b;
|
||||
aindex[b] = i;
|
||||
b <<= 1;
|
||||
if(b & (symbols + 1)) {
|
||||
b ^= proot;
|
||||
}
|
||||
b &= symbols;
|
||||
}
|
||||
}
|
||||
|
||||
static void RSECC_init(void)
|
||||
{
|
||||
RSECC_initLookupTable();
|
||||
memset(generatorInitialized, 0, (max_length - min_length + 1));
|
||||
initialized = 1;
|
||||
}
|
||||
|
||||
static void generator_init(size_t length)
|
||||
{
|
||||
size_t i, j;
|
||||
int g[max_generatorSize + 1];
|
||||
|
||||
g[0] = 1;
|
||||
for(i = 0; i < length; i++) {
|
||||
g[i + 1] = 1;
|
||||
/* Because g[0] never be zero, skipped some conditional checks. */
|
||||
for(j = i; j > 0; j--) {
|
||||
g[j] = g[j - 1] ^ alpha[(aindex[g[j]] + i) % symbols];
|
||||
}
|
||||
g[0] = alpha[(aindex[g[0]] + i) % symbols];
|
||||
}
|
||||
|
||||
for(i = 0; i <= length; i++) {
|
||||
generator[length - min_length][i] = aindex[g[i]];
|
||||
}
|
||||
|
||||
generatorInitialized[length - min_length] = 1;
|
||||
}
|
||||
|
||||
int RSECC_encode(size_t data_length, size_t ecc_length, const unsigned char *data, unsigned char *ecc)
|
||||
{
|
||||
size_t i, j;
|
||||
unsigned char feedback;
|
||||
unsigned char *gen;
|
||||
|
||||
#if HAVE_LIBPTHREAD
|
||||
pthread_mutex_lock(&RSECC_mutex);
|
||||
#endif
|
||||
if(!initialized) {
|
||||
RSECC_init();
|
||||
}
|
||||
#if HAVE_LIBPTHREAD
|
||||
pthread_mutex_unlock(&RSECC_mutex);
|
||||
#endif
|
||||
|
||||
if(ecc_length > max_length) return -1;
|
||||
|
||||
memset(ecc, 0, ecc_length);
|
||||
#if HAVE_LIBPTHREAD
|
||||
pthread_mutex_lock(&RSECC_mutex);
|
||||
#endif
|
||||
if(!generatorInitialized[ecc_length - min_length]) generator_init(ecc_length);
|
||||
#if HAVE_LIBPTHREAD
|
||||
pthread_mutex_unlock(&RSECC_mutex);
|
||||
#endif
|
||||
gen = generator[ecc_length - min_length];
|
||||
|
||||
for(i = 0; i < data_length; i++) {
|
||||
feedback = aindex[data[i] ^ ecc[0]];
|
||||
if(feedback != symbols) {
|
||||
for(j = 1; j < ecc_length; j++) {
|
||||
ecc[j] ^= alpha[(unsigned int)(feedback + gen[ecc_length - j]) % symbols];
|
||||
}
|
||||
}
|
||||
memmove(&ecc[0], &ecc[1], ecc_length - 1);
|
||||
if(feedback != symbols) {
|
||||
ecc[ecc_length - 1] = alpha[(unsigned int)(feedback + gen[0]) % symbols];
|
||||
} else {
|
||||
ecc[ecc_length - 1] = 0;
|
||||
}
|
||||
}
|
||||
|
||||
return 0;
|
||||
}
|
@ -0,0 +1,31 @@
|
||||
/*
|
||||
* qrencode - QR Code encoder
|
||||
*
|
||||
* Reed solomon error correction code encoder specialized for QR code.
|
||||
* This code is rewritten by Kentaro Fukuchi, referring to the FEC library
|
||||
* developed by Phil Karn (KA9Q).
|
||||
*
|
||||
* Copyright (C) 2002, 2003, 2004, 2006 Phil Karn, KA9Q
|
||||
* Copyright (C) 2014-2017 Kentaro Fukuchi <kentaro@fukuchi.org>
|
||||
*
|
||||
* This library is free software; you can redistribute it and/or
|
||||
* modify it under the terms of the GNU Lesser General Public
|
||||
* License as published by the Free Software Foundation; either
|
||||
* version 2.1 of the License, or any later version.
|
||||
*
|
||||
* This library is distributed in the hope that it will be useful,
|
||||
* but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
|
||||
* Lesser General Public License for more details.
|
||||
*
|
||||
* You should have received a copy of the GNU Lesser General Public
|
||||
* License along with this library; if not, write to the Free Software
|
||||
* Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA
|
||||
*/
|
||||
|
||||
#ifndef RSECC_H
|
||||
#define RSECC_H
|
||||
|
||||
extern int RSECC_encode(size_t data_length, size_t ecc_length, const unsigned char *data, unsigned char *ecc);
|
||||
|
||||
#endif /* RSECC_H */
|
@ -0,0 +1,318 @@
|
||||
/*
|
||||
* qrencode - QR Code encoder
|
||||
*
|
||||
* Input data splitter.
|
||||
* Copyright (C) 2006-2017 Kentaro Fukuchi <kentaro@fukuchi.org>
|
||||
*
|
||||
* The following data / specifications are taken from
|
||||
* "Two dimensional symbol -- QR-code -- Basic Specification" (JIS X0510:2004)
|
||||
* or
|
||||
* "Automatic identification and data capture techniques --
|
||||
* QR Code 2005 bar code symbology specification" (ISO/IEC 18004:2006)
|
||||
*
|
||||
* This library is free software; you can redistribute it and/or
|
||||
* modify it under the terms of the GNU Lesser General Public
|
||||
* License as published by the Free Software Foundation; either
|
||||
* version 2.1 of the License, or any later version.
|
||||
*
|
||||
* This library is distributed in the hope that it will be useful,
|
||||
* but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
|
||||
* Lesser General Public License for more details.
|
||||
*
|
||||
* You should have received a copy of the GNU Lesser General Public
|
||||
* License along with this library; if not, write to the Free Software
|
||||
* Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA
|
||||
*/
|
||||
|
||||
# include "config.h"
|
||||
#include <stdlib.h>
|
||||
#include <string.h>
|
||||
#include <errno.h>
|
||||
#include "qrencode.h"
|
||||
#include "qrinput.h"
|
||||
#include "qrspec.h"
|
||||
#include "split.h"
|
||||
|
||||
#define isdigit(__c__) ((unsigned char)((signed char)(__c__) - '0') < 10)
|
||||
#define isalnum(__c__) (QRinput_lookAnTable(__c__) >= 0)
|
||||
|
||||
#if !HAVE_STRDUP
|
||||
#undef strdup
|
||||
char *strdup(const char *s)
|
||||
{
|
||||
size_t len = strlen(s) + 1;
|
||||
void *newstring = (void*)TKMEM_ALLOC(len);
|
||||
if(newstring == NULL) return NULL;
|
||||
return (char *)memcpy(newstring, s, len);
|
||||
}
|
||||
#endif
|
||||
|
||||
static QRencodeMode Split_identifyMode(const char *string, QRencodeMode hint)
|
||||
{
|
||||
unsigned char c, d;
|
||||
unsigned int word;
|
||||
|
||||
c = (unsigned char)string[0];
|
||||
|
||||
if(c == '\0') return QR_MODE_NUL;
|
||||
if(isdigit(c)) {
|
||||
return QR_MODE_NUM;
|
||||
} else if(isalnum(c)) {
|
||||
return QR_MODE_AN;
|
||||
} else if(hint == QR_MODE_KANJI) {
|
||||
d = (unsigned char)string[1];
|
||||
if(d != '\0') {
|
||||
word = ((unsigned int)c << 8) | d;
|
||||
if((word >= 0x8140 && word <= 0x9ffc) || (word >= 0xe040 && word <= 0xebbf)) {
|
||||
return QR_MODE_KANJI;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
return QR_MODE_8;
|
||||
}
|
||||
|
||||
static int Split_eatAn(const char *string, QRinput *input, QRencodeMode hint);
|
||||
static int Split_eat8(const char *string, QRinput *input, QRencodeMode hint);
|
||||
|
||||
static int Split_eatNum(const char *string, QRinput *input,QRencodeMode hint)
|
||||
{
|
||||
const char *p;
|
||||
int ret;
|
||||
int run;
|
||||
int dif;
|
||||
int ln;
|
||||
QRencodeMode mode;
|
||||
|
||||
ln = QRspec_lengthIndicator(QR_MODE_NUM, input->version);
|
||||
|
||||
p = string;
|
||||
while(isdigit(*p)) {
|
||||
p++;
|
||||
}
|
||||
run = (int)(p - string);
|
||||
mode = Split_identifyMode(p, hint);
|
||||
if(mode == QR_MODE_8) {
|
||||
dif = QRinput_estimateBitsModeNum(run) + 4 + ln
|
||||
+ QRinput_estimateBitsMode8(1) /* + 4 + l8 */
|
||||
- QRinput_estimateBitsMode8(run + 1) /* - 4 - l8 */;
|
||||
if(dif > 0) {
|
||||
return Split_eat8(string, input, hint);
|
||||
}
|
||||
}
|
||||
if(mode == QR_MODE_AN) {
|
||||
dif = QRinput_estimateBitsModeNum(run) + 4 + ln
|
||||
+ QRinput_estimateBitsModeAn(1) /* + 4 + la */
|
||||
- QRinput_estimateBitsModeAn(run + 1) /* - 4 - la */;
|
||||
if(dif > 0) {
|
||||
return Split_eatAn(string, input, hint);
|
||||
}
|
||||
}
|
||||
|
||||
ret = QRinput_append(input, QR_MODE_NUM, run, (unsigned char *)string);
|
||||
if(ret < 0) return -1;
|
||||
|
||||
return run;
|
||||
}
|
||||
|
||||
static int Split_eatAn(const char *string, QRinput *input, QRencodeMode hint)
|
||||
{
|
||||
const char *p, *q;
|
||||
int ret;
|
||||
int run;
|
||||
int dif;
|
||||
int la, ln;
|
||||
|
||||
la = QRspec_lengthIndicator(QR_MODE_AN, input->version);
|
||||
ln = QRspec_lengthIndicator(QR_MODE_NUM, input->version);
|
||||
|
||||
p = string;
|
||||
while(isalnum(*p)) {
|
||||
if(isdigit(*p)) {
|
||||
q = p;
|
||||
while(isdigit(*q)) {
|
||||
q++;
|
||||
}
|
||||
dif = QRinput_estimateBitsModeAn((int)(p - string)) /* + 4 + la */
|
||||
+ QRinput_estimateBitsModeNum((int)(q - p)) + 4 + ln
|
||||
+ (isalnum(*q)?(4 + ln):0)
|
||||
- QRinput_estimateBitsModeAn((int)(q - string)) /* - 4 - la */;
|
||||
if(dif < 0) {
|
||||
break;
|
||||
}
|
||||
p = q;
|
||||
} else {
|
||||
p++;
|
||||
}
|
||||
}
|
||||
|
||||
run = (int)(p - string);
|
||||
|
||||
if(*p && !isalnum(*p)) {
|
||||
dif = QRinput_estimateBitsModeAn(run) + 4 + la
|
||||
+ QRinput_estimateBitsMode8(1) /* + 4 + l8 */
|
||||
- QRinput_estimateBitsMode8(run + 1) /* - 4 - l8 */;
|
||||
if(dif > 0) {
|
||||
return Split_eat8(string, input, hint);
|
||||
}
|
||||
}
|
||||
|
||||
ret = QRinput_append(input, QR_MODE_AN, run, (unsigned char *)string);
|
||||
if(ret < 0) return -1;
|
||||
|
||||
return run;
|
||||
}
|
||||
|
||||
static int Split_eatKanji(const char *string, QRinput *input, QRencodeMode hint)
|
||||
{
|
||||
const char *p;
|
||||
int ret;
|
||||
int run;
|
||||
|
||||
p = string;
|
||||
while(Split_identifyMode(p, hint) == QR_MODE_KANJI) {
|
||||
p += 2;
|
||||
}
|
||||
run = (int)(p - string);
|
||||
ret = QRinput_append(input, QR_MODE_KANJI, run, (unsigned char *)string);
|
||||
if(ret < 0) return -1;
|
||||
|
||||
return run;
|
||||
}
|
||||
|
||||
static int Split_eat8(const char *string, QRinput *input, QRencodeMode hint)
|
||||
{
|
||||
const char *p, *q;
|
||||
QRencodeMode mode;
|
||||
int ret;
|
||||
int run;
|
||||
int dif;
|
||||
int la, ln, l8;
|
||||
int swcost;
|
||||
|
||||
la = QRspec_lengthIndicator(QR_MODE_AN, input->version);
|
||||
ln = QRspec_lengthIndicator(QR_MODE_NUM, input->version);
|
||||
l8 = QRspec_lengthIndicator(QR_MODE_8, input->version);
|
||||
|
||||
p = string + 1;
|
||||
while(*p != '\0') {
|
||||
mode = Split_identifyMode(p, hint);
|
||||
if(mode == QR_MODE_KANJI) {
|
||||
break;
|
||||
}
|
||||
if(mode == QR_MODE_NUM) {
|
||||
q = p;
|
||||
while(isdigit(*q)) {
|
||||
q++;
|
||||
}
|
||||
if(Split_identifyMode(q, hint) == QR_MODE_8) {
|
||||
swcost = 4 + l8;
|
||||
} else {
|
||||
swcost = 0;
|
||||
}
|
||||
dif = QRinput_estimateBitsMode8((int)(p - string)) /* + 4 + l8 */
|
||||
+ QRinput_estimateBitsModeNum((int)(q - p)) + 4 + ln
|
||||
+ swcost
|
||||
- QRinput_estimateBitsMode8((int)(q - string)) /* - 4 - l8 */;
|
||||
if(dif < 0) {
|
||||
break;
|
||||
}
|
||||
p = q;
|
||||
} else if(mode == QR_MODE_AN) {
|
||||
q = p;
|
||||
while(isalnum(*q)) {
|
||||
q++;
|
||||
}
|
||||
if(Split_identifyMode(q, hint) == QR_MODE_8) {
|
||||
swcost = 4 + l8;
|
||||
} else {
|
||||
swcost = 0;
|
||||
}
|
||||
dif = QRinput_estimateBitsMode8((int)(p - string)) /* + 4 + l8 */
|
||||
+ QRinput_estimateBitsModeAn((int)(q - p)) + 4 + la
|
||||
+ swcost
|
||||
- QRinput_estimateBitsMode8((int)(q - string)) /* - 4 - l8 */;
|
||||
if(dif < 0) {
|
||||
break;
|
||||
}
|
||||
p = q;
|
||||
} else {
|
||||
p++;
|
||||
}
|
||||
}
|
||||
|
||||
run = (int)(p - string);
|
||||
ret = QRinput_append(input, QR_MODE_8, run, (unsigned char *)string);
|
||||
if(ret < 0) return -1;
|
||||
|
||||
return run;
|
||||
}
|
||||
|
||||
static int Split_splitString(const char *string, QRinput *input,
|
||||
QRencodeMode hint)
|
||||
{
|
||||
int length;
|
||||
QRencodeMode mode;
|
||||
|
||||
if(*string == '\0') return 0;
|
||||
|
||||
mode = Split_identifyMode(string, hint);
|
||||
if(mode == QR_MODE_NUM) {
|
||||
length = Split_eatNum(string, input, hint);
|
||||
} else if(mode == QR_MODE_AN) {
|
||||
length = Split_eatAn(string, input, hint);
|
||||
} else if(mode == QR_MODE_KANJI && hint == QR_MODE_KANJI) {
|
||||
length = Split_eatKanji(string, input, hint);
|
||||
} else {
|
||||
length = Split_eat8(string, input, hint);
|
||||
}
|
||||
if(length == 0) return 0;
|
||||
if(length < 0) return -1;
|
||||
return Split_splitString(&string[length], input, hint);
|
||||
}
|
||||
|
||||
static char *dupAndToUpper(const char *str, QRencodeMode hint)
|
||||
{
|
||||
char *newstr, *p;
|
||||
QRencodeMode mode;
|
||||
|
||||
newstr = strdup(str);
|
||||
if(newstr == NULL) return NULL;
|
||||
|
||||
p = newstr;
|
||||
while(*p != '\0') {
|
||||
mode = Split_identifyMode(p, hint);
|
||||
if(mode == QR_MODE_KANJI) {
|
||||
p += 2;
|
||||
} else {
|
||||
if (*p >= 'a' && *p <= 'z') {
|
||||
*p = (char)((int)*p - 32);
|
||||
}
|
||||
p++;
|
||||
}
|
||||
}
|
||||
|
||||
return newstr;
|
||||
}
|
||||
|
||||
int Split_splitStringToQRinput(const char *string, QRinput *input,
|
||||
QRencodeMode hint, int casesensitive)
|
||||
{
|
||||
char *newstr;
|
||||
int ret;
|
||||
|
||||
if(string == NULL || *string == '\0') {
|
||||
return -1;
|
||||
}
|
||||
if(!casesensitive) {
|
||||
newstr = dupAndToUpper(string, hint);
|
||||
if(newstr == NULL) return -1;
|
||||
ret = Split_splitString(newstr, input, hint);
|
||||
tk_free(newstr);
|
||||
} else {
|
||||
ret = Split_splitString(string, input, hint);
|
||||
}
|
||||
|
||||
return ret;
|
||||
}
|
@ -0,0 +1,47 @@
|
||||
/*
|
||||
* qrencode - QR Code encoder
|
||||
*
|
||||
* Input data splitter.
|
||||
* Copyright (C) 2006-2017 Kentaro Fukuchi <kentaro@fukuchi.org>
|
||||
*
|
||||
* The following data / specifications are taken from
|
||||
* "Two dimensional symbol -- QR-code -- Basic Specification" (JIS X0510:2004)
|
||||
* or
|
||||
* "Automatic identification and data capture techniques --
|
||||
* QR Code 2005 bar code symbology specification" (ISO/IEC 18004:2006)
|
||||
*
|
||||
* This library is free software; you can redistribute it and/or
|
||||
* modify it under the terms of the GNU Lesser General Public
|
||||
* License as published by the Free Software Foundation; either
|
||||
* version 2.1 of the License, or any later version.
|
||||
*
|
||||
* This library is distributed in the hope that it will be useful,
|
||||
* but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
|
||||
* Lesser General Public License for more details.
|
||||
*
|
||||
* You should have received a copy of the GNU Lesser General Public
|
||||
* License along with this library; if not, write to the Free Software
|
||||
* Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA
|
||||
*/
|
||||
|
||||
#ifndef SPLIT_H
|
||||
#define SPLIT_H
|
||||
|
||||
#include "qrencode.h"
|
||||
|
||||
/**
|
||||
* Split the input string (null terminated) into QRinput.
|
||||
* @param string input string
|
||||
* @param hint give QR_MODE_KANJI if the input string contains Kanji character encoded in Shift-JIS. If not, give QR_MODE_8.
|
||||
* @param casesensitive 0 for case-insensitive encoding (all alphabet characters are replaced to UPPER-CASE CHARACTERS.
|
||||
* @retval 0 success.
|
||||
* @retval -1 an error occurred. errno is set to indicate the error. See
|
||||
* Exceptions for the details.
|
||||
* @throw EINVAL invalid input object.
|
||||
* @throw ENOMEM unable to allocate memory for input objects.
|
||||
*/
|
||||
extern int Split_splitStringToQRinput(const char *string, QRinput *input,
|
||||
QRencodeMode hint, int casesensitive);
|
||||
|
||||
#endif /* SPLIT_H */
|
@ -0,0 +1,34 @@
|
||||
/**
|
||||
* File: qr_register.c
|
||||
* Author: AWTK Develop Team
|
||||
* Brief: qr register
|
||||
*
|
||||
* Copyright (c) 2020 - 2020 Guangzhou ZHIYUAN Electronics Co.,Ltd.
|
||||
*
|
||||
* This program is distributed in the hope that it will be useful,
|
||||
* but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
* License file for more details.
|
||||
*
|
||||
*/
|
||||
|
||||
/**
|
||||
* History:
|
||||
* ================================================================
|
||||
* 2020-06-01 Li XianJing <xianjimli@hotmail.com> created
|
||||
*
|
||||
*/
|
||||
|
||||
#include "tkc/mem.h"
|
||||
#include "tkc/utils.h"
|
||||
#include "base/widget_factory.h"
|
||||
#include "qr_register.h"
|
||||
#include "qr/qr.h"
|
||||
|
||||
ret_t qr_register(void) {
|
||||
return widget_factory_register(widget_factory(), WIDGET_TYPE_QR, qr_create);
|
||||
}
|
||||
|
||||
const char* qr_supported_render_mode(void) {
|
||||
return "OpenGL|AGGE-BGR565|AGGE-BGRA8888|AGGE-MONO";
|
||||
}
|
@ -0,0 +1,51 @@
|
||||
/**
|
||||
* File: qr_register.h
|
||||
* Author: AWTK Develop Team
|
||||
* Brief: qr register
|
||||
*
|
||||
* Copyright (c) 2020 - 2020 Guangzhou ZHIYUAN Electronics Co.,Ltd.
|
||||
*
|
||||
* This program is distributed in the hope that it will be useful,
|
||||
* but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
* License file for more details.
|
||||
*
|
||||
*/
|
||||
|
||||
/**
|
||||
* History:
|
||||
* ================================================================
|
||||
* 2020-06-01 Li XianJing <xianjimli@hotmail.com> created
|
||||
*
|
||||
*/
|
||||
|
||||
#ifndef TK_QR_REGISTER_H
|
||||
#define TK_QR_REGISTER_H
|
||||
|
||||
#include "base/widget.h"
|
||||
|
||||
BEGIN_C_DECLS
|
||||
|
||||
/**
|
||||
* @method qr_register
|
||||
* 注册控件。
|
||||
*
|
||||
* @annotation ["global"]
|
||||
*
|
||||
* @return {ret_t} 返回RET_OK表示成功,否则表示失败。
|
||||
*/
|
||||
ret_t qr_register(void);
|
||||
|
||||
/**
|
||||
* @method qr_supported_render_mode
|
||||
* 获取支持的渲染模式。
|
||||
*
|
||||
* @annotation ["global"]
|
||||
*
|
||||
* @return {const char*} 返回渲染模式。
|
||||
*/
|
||||
const char* qr_supported_render_mode(void);
|
||||
|
||||
END_C_DECLS
|
||||
|
||||
#endif /*TK_QR_REGISTER_H*/
|
13
lib/awtk/awtk-examples/Meter.v2-Demo/SConstruct
Normal file
@ -0,0 +1,13 @@
|
||||
import os
|
||||
import scripts.app_helper as app
|
||||
|
||||
ARGUMENTS['SHARED'] = 'False'
|
||||
ARGUMENTS['IDL_DEF'] = 'False'
|
||||
helper = app.Helper(ARGUMENTS)
|
||||
CUSTOM_WIDGET_LIBS = ['awtk-widget-qr']
|
||||
helper.add_libs(CUSTOM_WIDGET_LIBS)
|
||||
helper.call(DefaultEnvironment)
|
||||
|
||||
CustomWidgetSConscriptFiles = ['3rd/widgets/awtk-widget-qr/src/SConscript']
|
||||
SConscriptFiles = CustomWidgetSConscriptFiles + ['src/SConscript']
|
||||
SConscript(SConscriptFiles)
|
9
lib/awtk/awtk-examples/Meter.v2-Demo/bin/uses_sdk.json
Normal file
@ -0,0 +1,9 @@
|
||||
{
|
||||
"compileSDK": {
|
||||
"awtk": {
|
||||
"path": "e:/install/AWTK/AWStudio/AWTK/SDK/awtk",
|
||||
"release_id": "2210",
|
||||
"nanovg_backend": "AGGE"
|
||||
}
|
||||
}
|
||||
}
|
@ -0,0 +1 @@
|
||||
!"#$%&'()*+,-./0123456789:;<=>?@ABCDEFGHIJKLMNOPQRSTUVWXYZ[]^_`abcdefghijklmnopqrstuvwxyz{|}~仪表演示
|
@ -0,0 +1 @@
|
||||
!"#$%&'()*+,-./0123456789:;<=>?@ABCDEFGHIJKLMNOPQRSTUVWXYZ[]^_`abcdefghijklmnopqrstuvwxyz{|}~仪表演示
|
After Width: | Height: | Size: 1.0 KiB |
After Width: | Height: | Size: 1.0 KiB |
After Width: | Height: | Size: 1.0 KiB |
After Width: | Height: | Size: 1.0 KiB |
After Width: | Height: | Size: 1.0 KiB |
After Width: | Height: | Size: 1.1 KiB |
After Width: | Height: | Size: 1.0 KiB |
After Width: | Height: | Size: 1.1 KiB |
After Width: | Height: | Size: 1.1 KiB |
After Width: | Height: | Size: 1.0 KiB |
After Width: | Height: | Size: 1.1 KiB |
After Width: | Height: | Size: 1.1 KiB |
After Width: | Height: | Size: 1.1 KiB |
After Width: | Height: | Size: 1.1 KiB |
After Width: | Height: | Size: 1.1 KiB |
After Width: | Height: | Size: 1.1 KiB |
After Width: | Height: | Size: 1.1 KiB |
After Width: | Height: | Size: 1.1 KiB |
After Width: | Height: | Size: 1.1 KiB |
After Width: | Height: | Size: 1.1 KiB |
After Width: | Height: | Size: 1.5 KiB |
After Width: | Height: | Size: 1.4 KiB |
After Width: | Height: | Size: 1.4 KiB |
After Width: | Height: | Size: 1.4 KiB |
After Width: | Height: | Size: 1.4 KiB |
After Width: | Height: | Size: 1.1 KiB |
After Width: | Height: | Size: 1.1 KiB |
After Width: | Height: | Size: 1.1 KiB |
After Width: | Height: | Size: 1.1 KiB |
After Width: | Height: | Size: 1.1 KiB |
After Width: | Height: | Size: 11 KiB |
After Width: | Height: | Size: 1.4 KiB |
After Width: | Height: | Size: 1.5 KiB |
After Width: | Height: | Size: 1.2 KiB |
After Width: | Height: | Size: 1.1 KiB |
After Width: | Height: | Size: 32 KiB |